It:Hexahelicene
Appearance
Hexahelicene is an aromatics compound that is part of a homologous series of Helicenes. Helicenes are ortho-condensed polyarommatic cyclic compounds. Helicenes are notable in organic chemistry for having optical enantomers without chiral centres and asymmetric carbons. Their chirality comes from the fact that they can turn either clockwise or anticlockwise.
| Hexahelicene | ||||
|---|---|---|---|---|
| ||||
| General | ||||
| Systematic name | [6]helicene | |||
| Other names | Hexahelicene | |||
| Molecular formula | C26H16 | |||
| SMILES | C12=CC=CC=C1C3=C(C=CC(C=C6)=C3C4=C6C=CC5=C4C=CC=C5)C=C2 | |||
| Molar mass | 328.13 | |||
| Appearance | Solid crystalls | |||
| CAS number | [187-83-7] | |||
| Properties | ||||
| Density and phase | 1.2715 g/cm³, Crystalls | |||
| Melting point | 229-231°C (? K) | |||
| Chiral rotation [α]D | 1.9° | |||
| Structure | ||||
| Crystal structure | rhombic | |||
| Supplementary data page | ||||
| Structure and properties |
n, εr, etc. | |||
| Thermodynamic data |
Phase behaviour Solid, liquid, gas | |||
| Spectral data | UV, IR, NMR, MS | |||
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) Infobox disclaimer and references | ||||
Synthesis
Above is a possible synthetic route for Hexahelicene [1]
- ↑ Newman & Lednicer, American Chemical Society, 1956 p.4765