It07:PETN
| It07:PETN | |
|---|---|
| |
| General | |
| Systematic name | [3-nitrooxy-2,2-bis(nitrooxymethyl)propyl] nitrate |
| Molecular formula | C5H8N4O12 |
| SMILES | O=[N+]([O-])OCC(CO[N+]([O-])=O)(CO[N+]([O-])=O)CO[N+]([O-])=O |
| Molar mass | 316.13662 g/mol |
| CAS number | 78-11-5 |
| Explosive Verlocity | 1.773 g/cm3 |
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) Infobox disclaimer and references | |
| Structure | |
|---|---|
| Molecular shape | {{{MolShape}}} |
| Coordination geometry |
{{{Coordination}}} |
| Crystal structure | {{{CrystalStruct}}} |
| Dipole moment | {{{Dipole}}} D |
Jmol 3D structural views of molecule:
PETN
PETN is used primarily as an explosives detonator, normally in small caliber ammunition. It is one of the most high powered explosives known. PETN can also be found in some land mines and is used as the core of detonation cords.