It07:Hexyl Cinnamal
Hexyl Cinnamal
Introduction
Hexyl Cinnamal is a fragrance added to everyday toiletries and cleaning products. Has a floral, waxy odour. Which, smells particularly of jasmine. It does not dissolve in aqueous solvents, but will in organic solvents (oils).
| It07:Hexyl Cinnamal | |
|---|---|
| |
| General | |
| Systematic name | (2Z)-2-(cyclohexylmethylidene)octanal |
| Other names | 2- benzylidene octanal, 2- hexyl cinnamaldehyde, alpha- hexyl cinnamic aldehyde, alpha-N- hexyl cinnamic aldehyde, alpha- hexyl cinnamyl aldehyde, 2- hexyl-3-phenyl-2-propenal, alpha-N- hexyl-beta-phenyl acrolein, jasmonal h, 2-( phenyl methylene) octanal |
| Molecular formula | C15 H20 O |
| SMILES | CCCCCC\C(C=O)=C/C1=CC=CC=C1 |
| Molar mass | 216 |
| Appearance | Clear, yellow liquid |
| CAS number | {101-86-0} |
| Properties | |
| Density & phase | 0.954 ± 0.06 g/cm³ |
| Solubility in water | not soluble g/100 ml (25°C) |
| Boiling point | 174.00-175.00 K at 15.00mmHg |
| Acidity (pKa) | {{{pKa}}} |
| Basicity (pKb) | {{{pKb}}} |
| Chiral rotation [α]D | {{{Rotation}}}° |
| Viscosity | {{{Viscosity}}} cP at 25°C |
| Hazards | |
| MSDS | [MSDS] |
| Main hazards | Xi-irritant |
| NFPA 704 | {{{NFPA}}} |
| Flash point | 93.33°C |
| R/S statement | R: {{{R-S}}} S: ? |
| RTECS number | {{{RTECS}}} |
| Supplementary data page | |
| Structure and properties |
n, εr, etc. |
| Thermodynamic data |
Phase behaviour Solid, liquid, gas |
| Spectral data | UV, IR, NMR, MS |
Common Uses
- Shampoo
- Soap
- Deodorant
- Anti-perspirant
- Alcoholic cleanser
- Fabric softener
- Detergents
- Hard surface cleaner
- Acid cleaner liquid
References
http://www.iff.com/Ingredients.nsf/0/8A7C28F4050F32428025699300390223