It07:Cyclopentasiloxane
-44°C (229 K)
| It07:Cyclopentasiloxane | |
|---|---|
| |
| General | |
| Systematic name | 2,4,6,8,10-pentamethylcyclopentasiloxane |
| Other names | Cyclic pentamer, D5 |
| Molecular formula | C5H20O5Si5 |
| SMILES | C[SiH]1O[SiH](C)O[SiH](C)O[SiH](C)O[SiH](C)O1 |
| Molar mass | 370.77 g/mol |
| Appearance | Clear, nearly odorless liquid |
| CAS number | 541-02-6 |
| Properties | |
| Density & phase | 0.958 g/cm³, liquid |
| Solubility in water | Insoluble |
| Melting point | -44°C (229 K) |
| Boiling point | 90°C at 10 mmHg (363 K)
|
| Viscosity | 3.74 cP at ?°C |
| Hazards | |
| MSDS | MSDS-Cyclo-2245.pdf |
| Main hazards | Flammable, irritant |
| NFPA 704 | 75px-NFPA_704_svg
4
4
4
OX
|
| Flash point | 76°C |
| R/S statement | R: 36, 37, 38 |
| S: 23, 24, 25 | |
| GY5945200 | |
| Related compounds | |
| Other related organosilican compoundss | silicon carbide, tetramethylsilane, silabenzene |
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) Infobox disclaimer and references | |
|
Cyclopentasiloxane |
|
Cyclopentasiloxane |
Overview
Cyclopentasiloxane is a colorless, odorless, transparent, nongreasy silicone
fluid commonly used in cosmetics products as a spreading or wetting agent which
provides a light lubrication to hair and skin.
Cyclopentasiloxane has a low viscosity, surface tension and a relatively high
vapor pressure that allows most of the silicone portion to evaporate from the
surface to which it is applied.
Uses
Cyclopentasiloxane is used as a base fluid in a number of personal care products, such as: * skin cream* antiperspirants * hair sprays * deodorants * cleansing creams * bath oils * sunblocks
* shaving product * make-up * nail polishes * stick products(Cyclopentasiloxane gives the right balance between volatility and spreading)
Benefits:
* Imparts a soft-silky feel to the skin * Excellent spreading * Leaves no oily residue or build-up * Detackification * Non-greasy * Compatible with a wide range of cosmetic ingredients * Low surface tension
IR of 2,4,6,8,10-pentamethylcyclopentasiloxane
