ChemWiki - User contributions [en]

It07:Verbenone

2007-12-06T19:50:18Z

Rqn06: /* Synthesis */

= '''VERBENONE'''=
==Verbenone==

<jmol>
<jmolApplet>
<size>200</size>
<color>white</color>
<script>zoom 80; cpk on;frame 1; move 10 -20 10 0 0 0 0 0 3; delay 1;</script>
<inlineContents>Verbenone.mol
title1
title2
25 26 0 0 1 V2000
2.0000 2.1840 -0.0680 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1440 0.9560 0.0960 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6160 -0.2640 -0.1960 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6760 -1.3880 0.0080 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9960 -2.5440 -0.1720 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.7200 -0.9880 0.4680 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.5960 -0.0120 1.6600 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2800 1.0560 0.6040 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2200 0.2360 -0.3160 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8000 0.2440 -1.7880 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7040 0.5440 -0.1120 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9840 1.8960 -0.4400 H 0 0 0 0 0 0 0 0 0 0 0 0
1.5280 2.8640 -0.7800 H 0 0 0 0 0 0 0 0 0 0 0 0
2.1080 2.6840 0.8920 H 0 0 0 0 0 0 0 0 0 0 0 0
2.6240 -0.4200 -0.5600 H 0 0 0 0 0 0 0 0 0 0 0 0
-1.4160 -1.8160 0.5920 H 0 0 0 0 0 0 0 0 0 0 0 0
-1.5360 0.1560 2.1880 H 0 0 0 0 0 0 0 0 0 0 0 0
0.2360 -0.2280 2.3280 H 0 0 0 0 0 0 0 0 0 0 0 0
-0.6000 2.0680 0.8480 H 0 0 0 0 0 0 0 0 0 0 0 0
0.1960 -0.1800 -1.8800 H 0 0 0 0 0 0 0 0 0 0 0 0
-1.5040 -0.3480 -2.3680 H 0 0 0 0 0 0 0 0 0 0 0 0
-0.7920 1.2680 -2.1600 H 0 0 0 0 0 0 0 0 0 0 0 0
-2.8880 1.5960 -0.3160 H 0 0 0 0 0 0 0 0 0 0 0 0
-3.2960 -0.0640 -0.7920 H 0 0 0 0 0 0 0 0 0 0 0 0
-2.9840 0.3160 0.9160 H 0 0 0 0 0 0 0 0 0 0 0 0
11 25 1 0
11 24 1 0
11 23 1 0
10 22 1 0
10 21 1 0
10 20 1 0
9 11 1 0
9 10 1 0
8 19 1 0
8 9 1 0
7 18 1 0
7 17 1 0
7 8 1 0
6 16 1 0
6 7 1 0
6 9 1 0
4 6 1 0
4 5 1 0
3 15 1 0
3 4 1 0
2 3 1 0
2 8 1 0
1 14 1 0
1 13 1 0
1 12 1 0
1 2 1 0
M END</inlineContents>
</jmolApplet>
</jmol>

== Natural Product==
Identification of Verbenone in natural products (essential oils) has been carried out.
Its idenfication in Rosmarinus ocinalis L. (Uzi Ravid1, Eli Putievsky1, Irena Katzir1, Efraim Lewinsohn1 and Nativ Dudai1, FLAVOUR AND FRAGRANCE JOURNAL, VOL. 12, 109±112 (1997)) shows that
relatively large quantities of verbenone (observed in three rosemary oils) amounted to 27.0±28.9% whilst the average content was only 2.3±21.6%. These relatively low quantities warrants a synthetic route.

[[Image:Natural_prod.JPG|Natural_prod.JPG]]

==Synthesis==
Verbenone results from the autoxidation of a-pinene, simply in air.

[[Image:oxidised verbenone.JPG|oxidised verbenone.JPG]]

Synthetic routes have been estabilshed to catalyse this oxidation. Lajunen and Koskinen (Terrahedmn Lwer.s, Vol. 35. No 25. pp. 44614464, 1994) has used Co(11) to catalyse its oxidation.

<noinclude>

</noinclude>{| class="toccolours" border="1" style="float: right; clear: right; margin: 0 0 1em 1em; border-collapse: collapse; width: 280px"
! {{chembox header}} | {{PAGENAME}} 
|-
| align="center" colspan="2" bgcolor="#ffffff" | [[Image:2,4-dnph.png|200px|{{PAGENAME}}]] 
|-

==Mass Spectrum==
|-
[[Image:Verbenone mass spectrum.JPG ]]

|-
! {{chembox header}} | General
|-
| [http://en.wikipedia.org/wiki/IUPAC Systematic name]
| (1R)-cis-4,6,6-Trimethylbicyclo-
[3.1.1]hept-3-en-2-one

|-
| Other names
| Verbenone
2-Pinen-4-one
|-
| [http://en.wikipedia.org/wiki/Chemical_formula Molecular formula]
| C<sub>14</sub>H<sub>10</sub>O
|-
| [http://en.wikipedia.org/wiki/Chemical_file_format SMILES] 
| CC(C1C2)(C)C2C(C)=CC1=O
|-
| [http://en.wikipedia.org/wiki/Molar_mass Molar mass]
| 150.21 g/mol
|-
| [http://en.wikipedia.org/wiki/CAS_registry_number CAS number]
| [18308-32-5]
|-
! {{chembox header}} | Properties
|-
| [http://en.wikipedia.org/wiki/Melting_point Melting point]
| 6.5 °C
|-
| [http://en.wikipedia.org/wiki/Boiling_point Boiling point]
| 227-228 °C
|-
| [http://en.wikipedia.org/wiki/Density Density]
| 0.978 g/cm3
|-
| [http://en.wikipedia.org/wiki/Physical_state Physical state]
| liquid
|-
| [http://en.wikipedia.org/wiki/Appearance appearance]
| clear, colorless
|-
|[http://en.wikipedia.org/wiki/MSDS MSDS]
|external link to Material Safety and Data Sheet [http://fscimage.fishersci.com/msds/92615.htm link title]
|-

It07:Verbenone

2007-12-06T19:49:37Z

Rqn06: synthesis blurb

= '''VERBENONE'''=
==Verbenone==

<jmol>
<jmolApplet>
<size>200</size>
<color>white</color>
<script>zoom 80; cpk on;frame 1; move 10 -20 10 0 0 0 0 0 3; delay 1;</script>
<inlineContents>Verbenone.mol
title1
title2
25 26 0 0 1 V2000
2.0000 2.1840 -0.0680 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1440 0.9560 0.0960 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6160 -0.2640 -0.1960 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6760 -1.3880 0.0080 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9960 -2.5440 -0.1720 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.7200 -0.9880 0.4680 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.5960 -0.0120 1.6600 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2800 1.0560 0.6040 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2200 0.2360 -0.3160 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8000 0.2440 -1.7880 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7040 0.5440 -0.1120 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9840 1.8960 -0.4400 H 0 0 0 0 0 0 0 0 0 0 0 0
1.5280 2.8640 -0.7800 H 0 0 0 0 0 0 0 0 0 0 0 0
2.1080 2.6840 0.8920 H 0 0 0 0 0 0 0 0 0 0 0 0
2.6240 -0.4200 -0.5600 H 0 0 0 0 0 0 0 0 0 0 0 0
-1.4160 -1.8160 0.5920 H 0 0 0 0 0 0 0 0 0 0 0 0
-1.5360 0.1560 2.1880 H 0 0 0 0 0 0 0 0 0 0 0 0
0.2360 -0.2280 2.3280 H 0 0 0 0 0 0 0 0 0 0 0 0
-0.6000 2.0680 0.8480 H 0 0 0 0 0 0 0 0 0 0 0 0
0.1960 -0.1800 -1.8800 H 0 0 0 0 0 0 0 0 0 0 0 0
-1.5040 -0.3480 -2.3680 H 0 0 0 0 0 0 0 0 0 0 0 0
-0.7920 1.2680 -2.1600 H 0 0 0 0 0 0 0 0 0 0 0 0
-2.8880 1.5960 -0.3160 H 0 0 0 0 0 0 0 0 0 0 0 0
-3.2960 -0.0640 -0.7920 H 0 0 0 0 0 0 0 0 0 0 0 0
-2.9840 0.3160 0.9160 H 0 0 0 0 0 0 0 0 0 0 0 0
11 25 1 0
11 24 1 0
11 23 1 0
10 22 1 0
10 21 1 0
10 20 1 0
9 11 1 0
9 10 1 0
8 19 1 0
8 9 1 0
7 18 1 0
7 17 1 0
7 8 1 0
6 16 1 0
6 7 1 0
6 9 1 0
4 6 1 0
4 5 1 0
3 15 1 0
3 4 1 0
2 3 1 0
2 8 1 0
1 14 1 0
1 13 1 0
1 12 1 0
1 2 1 0
M END</inlineContents>
</jmolApplet>
</jmol>

== Natural Product==
Identification of Verbenone in natural products (essential oils) has been carried out.
Its idenfication in Rosmarinus ocinalis L. (Uzi Ravid1, Eli Putievsky1, Irena Katzir1, Efraim Lewinsohn1 and Nativ Dudai1, FLAVOUR AND FRAGRANCE JOURNAL, VOL. 12, 109±112 (1997)) shows that
relatively large quantities of verbenone (observed in three rosemary oils) amounted to 27.0±28.9% whilst the average content was only 2.3±21.6%. These relatively low quantities warrants a synthetic route.

[[Image:Natural_prod.JPG|Natural_prod.JPG]]

==Synthesis==
Verbenone results from the autoxidation of a-pinene simply in air.

[[Image:oxidised verbenone.JPG|oxidised verbenone.JPG]]

Synthetic routes have been estabilshed to catalyse this oxidation. Lajunen and Koskinen (Terrahedmn Lwer.s, Vol. 35. No 25. pp. 44614464, 1994) has used Co(11) to catalyse its oxidation.

<noinclude>

</noinclude>{| class="toccolours" border="1" style="float: right; clear: right; margin: 0 0 1em 1em; border-collapse: collapse; width: 280px"
! {{chembox header}} | {{PAGENAME}} 
|-
| align="center" colspan="2" bgcolor="#ffffff" | [[Image:2,4-dnph.png|200px|{{PAGENAME}}]] 
|-

==Mass Spectrum==
|-
[[Image:Verbenone mass spectrum.JPG ]]

|-
! {{chembox header}} | General
|-
| [http://en.wikipedia.org/wiki/IUPAC Systematic name]
| (1R)-cis-4,6,6-Trimethylbicyclo-
[3.1.1]hept-3-en-2-one

|-
| Other names
| Verbenone
2-Pinen-4-one
|-
| [http://en.wikipedia.org/wiki/Chemical_formula Molecular formula]
| C<sub>14</sub>H<sub>10</sub>O
|-
| [http://en.wikipedia.org/wiki/Chemical_file_format SMILES] 
| CC(C1C2)(C)C2C(C)=CC1=O
|-
| [http://en.wikipedia.org/wiki/Molar_mass Molar mass]
| 150.21 g/mol
|-
| [http://en.wikipedia.org/wiki/CAS_registry_number CAS number]
| [18308-32-5]
|-
! {{chembox header}} | Properties
|-
| [http://en.wikipedia.org/wiki/Melting_point Melting point]
| 6.5 °C
|-
| [http://en.wikipedia.org/wiki/Boiling_point Boiling point]
| 227-228 °C
|-
| [http://en.wikipedia.org/wiki/Density Density]
| 0.978 g/cm3
|-
| [http://en.wikipedia.org/wiki/Physical_state Physical state]
| liquid
|-
| [http://en.wikipedia.org/wiki/Appearance appearance]
| clear, colorless
|-
|[http://en.wikipedia.org/wiki/MSDS MSDS]
|external link to Material Safety and Data Sheet [http://fscimage.fishersci.com/msds/92615.htm link title]
|-

It07:Verbenone

2007-12-06T19:30:34Z

Rqn06: /* Natural Product */

= '''VERBENONE'''=
==Verbenone==

<jmol>
<jmolApplet>
<size>200</size>
<color>white</color>
<script>zoom 80; cpk on;frame 1; move 10 -20 10 0 0 0 0 0 3; delay 1;</script>
<inlineContents>Verbenone.mol
title1
title2
25 26 0 0 1 V2000
2.0000 2.1840 -0.0680 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1440 0.9560 0.0960 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6160 -0.2640 -0.1960 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6760 -1.3880 0.0080 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9960 -2.5440 -0.1720 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.7200 -0.9880 0.4680 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.5960 -0.0120 1.6600 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2800 1.0560 0.6040 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2200 0.2360 -0.3160 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8000 0.2440 -1.7880 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7040 0.5440 -0.1120 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9840 1.8960 -0.4400 H 0 0 0 0 0 0 0 0 0 0 0 0
1.5280 2.8640 -0.7800 H 0 0 0 0 0 0 0 0 0 0 0 0
2.1080 2.6840 0.8920 H 0 0 0 0 0 0 0 0 0 0 0 0
2.6240 -0.4200 -0.5600 H 0 0 0 0 0 0 0 0 0 0 0 0
-1.4160 -1.8160 0.5920 H 0 0 0 0 0 0 0 0 0 0 0 0
-1.5360 0.1560 2.1880 H 0 0 0 0 0 0 0 0 0 0 0 0
0.2360 -0.2280 2.3280 H 0 0 0 0 0 0 0 0 0 0 0 0
-0.6000 2.0680 0.8480 H 0 0 0 0 0 0 0 0 0 0 0 0
0.1960 -0.1800 -1.8800 H 0 0 0 0 0 0 0 0 0 0 0 0
-1.5040 -0.3480 -2.3680 H 0 0 0 0 0 0 0 0 0 0 0 0
-0.7920 1.2680 -2.1600 H 0 0 0 0 0 0 0 0 0 0 0 0
-2.8880 1.5960 -0.3160 H 0 0 0 0 0 0 0 0 0 0 0 0
-3.2960 -0.0640 -0.7920 H 0 0 0 0 0 0 0 0 0 0 0 0
-2.9840 0.3160 0.9160 H 0 0 0 0 0 0 0 0 0 0 0 0
11 25 1 0
11 24 1 0
11 23 1 0
10 22 1 0
10 21 1 0
10 20 1 0
9 11 1 0
9 10 1 0
8 19 1 0
8 9 1 0
7 18 1 0
7 17 1 0
7 8 1 0
6 16 1 0
6 7 1 0
6 9 1 0
4 6 1 0
4 5 1 0
3 15 1 0
3 4 1 0
2 3 1 0
2 8 1 0
1 14 1 0
1 13 1 0
1 12 1 0
1 2 1 0
M END</inlineContents>
</jmolApplet>
</jmol>

== Natural Product==
Identification of Verbenone in natural products (essential oils) has been carried out.
Its idenfication in Rosmarinus ocinalis L. (Uzi Ravid1, Eli Putievsky1, Irena Katzir1, Efraim Lewinsohn1 and Nativ Dudai1, FLAVOUR AND FRAGRANCE JOURNAL, VOL. 12, 109±112 (1997)) shows that
relatively large quantities of verbenone (observed in three rosemary oils) amounted to 27.0±28.9% whilst the average content was only 2.3±21.6%. These relatively low quantities warrants a synthetic route.

[[Image:Natural_prod.JPG|Natural_prod.JPG]]

==Synthesis==
catalytic air-oxidation entry to verbenone

[[Image:oxidised verbenone.JPG|oxidised verbenone.JPG]]

<noinclude>

</noinclude>{| class="toccolours" border="1" style="float: right; clear: right; margin: 0 0 1em 1em; border-collapse: collapse; width: 280px"
! {{chembox header}} | {{PAGENAME}} 
|-
| align="center" colspan="2" bgcolor="#ffffff" | [[Image:2,4-dnph.png|200px|{{PAGENAME}}]] 
|-

==Mass Spectrum==
|-
[[Image:Verbenone mass spectrum.JPG ]]

|-
! {{chembox header}} | General
|-
| [http://en.wikipedia.org/wiki/IUPAC Systematic name]
| (1R)-cis-4,6,6-Trimethylbicyclo-
[3.1.1]hept-3-en-2-one

|-
| Other names
| Verbenone
2-Pinen-4-one
|-
| [http://en.wikipedia.org/wiki/Chemical_formula Molecular formula]
| C<sub>14</sub>H<sub>10</sub>O
|-
| [http://en.wikipedia.org/wiki/Chemical_file_format SMILES] 
| CC(C1C2)(C)C2C(C)=CC1=O
|-
| [http://en.wikipedia.org/wiki/Molar_mass Molar mass]
| 150.21 g/mol
|-
| [http://en.wikipedia.org/wiki/CAS_registry_number CAS number]
| [18308-32-5]
|-
! {{chembox header}} | Properties
|-
| [http://en.wikipedia.org/wiki/Melting_point Melting point]
| 6.5 °C
|-
| [http://en.wikipedia.org/wiki/Boiling_point Boiling point]
| 227-228 °C
|-
| [http://en.wikipedia.org/wiki/Density Density]
| 0.978 g/cm3
|-
| [http://en.wikipedia.org/wiki/Physical_state Physical state]
| liquid
|-
| [http://en.wikipedia.org/wiki/Appearance appearance]
| clear, colorless
|-
|[http://en.wikipedia.org/wiki/MSDS MSDS]
|external link to Material Safety and Data Sheet [http://fscimage.fishersci.com/msds/92615.htm link title]
|-

It07:Verbenone

2007-12-06T19:29:31Z

Rqn06: /* Natural Product */

= '''VERBENONE'''=
==Verbenone==

<jmol>
<jmolApplet>
<size>200</size>
<color>white</color>
<script>zoom 80; cpk on;frame 1; move 10 -20 10 0 0 0 0 0 3; delay 1;</script>
<inlineContents>Verbenone.mol
title1
title2
25 26 0 0 1 V2000
2.0000 2.1840 -0.0680 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1440 0.9560 0.0960 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6160 -0.2640 -0.1960 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6760 -1.3880 0.0080 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9960 -2.5440 -0.1720 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.7200 -0.9880 0.4680 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.5960 -0.0120 1.6600 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2800 1.0560 0.6040 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2200 0.2360 -0.3160 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8000 0.2440 -1.7880 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7040 0.5440 -0.1120 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9840 1.8960 -0.4400 H 0 0 0 0 0 0 0 0 0 0 0 0
1.5280 2.8640 -0.7800 H 0 0 0 0 0 0 0 0 0 0 0 0
2.1080 2.6840 0.8920 H 0 0 0 0 0 0 0 0 0 0 0 0
2.6240 -0.4200 -0.5600 H 0 0 0 0 0 0 0 0 0 0 0 0
-1.4160 -1.8160 0.5920 H 0 0 0 0 0 0 0 0 0 0 0 0
-1.5360 0.1560 2.1880 H 0 0 0 0 0 0 0 0 0 0 0 0
0.2360 -0.2280 2.3280 H 0 0 0 0 0 0 0 0 0 0 0 0
-0.6000 2.0680 0.8480 H 0 0 0 0 0 0 0 0 0 0 0 0
0.1960 -0.1800 -1.8800 H 0 0 0 0 0 0 0 0 0 0 0 0
-1.5040 -0.3480 -2.3680 H 0 0 0 0 0 0 0 0 0 0 0 0
-0.7920 1.2680 -2.1600 H 0 0 0 0 0 0 0 0 0 0 0 0
-2.8880 1.5960 -0.3160 H 0 0 0 0 0 0 0 0 0 0 0 0
-3.2960 -0.0640 -0.7920 H 0 0 0 0 0 0 0 0 0 0 0 0
-2.9840 0.3160 0.9160 H 0 0 0 0 0 0 0 0 0 0 0 0
11 25 1 0
11 24 1 0
11 23 1 0
10 22 1 0
10 21 1 0
10 20 1 0
9 11 1 0
9 10 1 0
8 19 1 0
8 9 1 0
7 18 1 0
7 17 1 0
7 8 1 0
6 16 1 0
6 7 1 0
6 9 1 0
4 6 1 0
4 5 1 0
3 15 1 0
3 4 1 0
2 3 1 0
2 8 1 0
1 14 1 0
1 13 1 0
1 12 1 0
1 2 1 0
M END</inlineContents>
</jmolApplet>
</jmol>

== Natural Product==
Identification of Verbenone in natural products (essential oils) has been carried out.
Its idenfication in Rosmarinus ocinalis L. (Uzi Ravid1, Eli Putievsky1, Irena Katzir1, Efraim Lewinsohn1 and Nativ Dudai1, FLAVOUR AND FRAGRANCE JOURNAL, VOL. 12, 109±112 (1997)) shows that
relatively large quantities of verbenone (observed in three rosemary oils) amounted to 27.0±28.9% whilst the average content was 2.3±21.6%.

[[Image:Natural_prod.JPG|Natural_prod.JPG]]

==Synthesis==
catalytic air-oxidation entry to verbenone

[[Image:oxidised verbenone.JPG|oxidised verbenone.JPG]]

<noinclude>

</noinclude>{| class="toccolours" border="1" style="float: right; clear: right; margin: 0 0 1em 1em; border-collapse: collapse; width: 280px"
! {{chembox header}} | {{PAGENAME}} 
|-
| align="center" colspan="2" bgcolor="#ffffff" | [[Image:2,4-dnph.png|200px|{{PAGENAME}}]] 
|-

==Mass Spectrum==
|-
[[Image:Verbenone mass spectrum.JPG ]]

|-
! {{chembox header}} | General
|-
| [http://en.wikipedia.org/wiki/IUPAC Systematic name]
| (1R)-cis-4,6,6-Trimethylbicyclo-
[3.1.1]hept-3-en-2-one

|-
| Other names
| Verbenone
2-Pinen-4-one
|-
| [http://en.wikipedia.org/wiki/Chemical_formula Molecular formula]
| C<sub>14</sub>H<sub>10</sub>O
|-
| [http://en.wikipedia.org/wiki/Chemical_file_format SMILES] 
| CC(C1C2)(C)C2C(C)=CC1=O
|-
| [http://en.wikipedia.org/wiki/Molar_mass Molar mass]
| 150.21 g/mol
|-
| [http://en.wikipedia.org/wiki/CAS_registry_number CAS number]
| [18308-32-5]
|-
! {{chembox header}} | Properties
|-
| [http://en.wikipedia.org/wiki/Melting_point Melting point]
| 6.5 °C
|-
| [http://en.wikipedia.org/wiki/Boiling_point Boiling point]
| 227-228 °C
|-
| [http://en.wikipedia.org/wiki/Density Density]
| 0.978 g/cm3
|-
| [http://en.wikipedia.org/wiki/Physical_state Physical state]
| liquid
|-
| [http://en.wikipedia.org/wiki/Appearance appearance]
| clear, colorless
|-
|[http://en.wikipedia.org/wiki/MSDS MSDS]
|external link to Material Safety and Data Sheet [http://fscimage.fishersci.com/msds/92615.htm link title]
|-

File:Natural prod.JPG

2007-12-06T19:27:23Z

Rqn06:

It07:Verbenone

2007-12-06T19:26:30Z

Rqn06: natural product

= '''VERBENONE'''=
==Verbenone==

<jmol>
<jmolApplet>
<size>200</size>
<color>white</color>
<script>zoom 80; cpk on;frame 1; move 10 -20 10 0 0 0 0 0 3; delay 1;</script>
<inlineContents>Verbenone.mol
title1
title2
25 26 0 0 1 V2000
2.0000 2.1840 -0.0680 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1440 0.9560 0.0960 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6160 -0.2640 -0.1960 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6760 -1.3880 0.0080 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9960 -2.5440 -0.1720 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.7200 -0.9880 0.4680 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.5960 -0.0120 1.6600 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2800 1.0560 0.6040 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2200 0.2360 -0.3160 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8000 0.2440 -1.7880 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7040 0.5440 -0.1120 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9840 1.8960 -0.4400 H 0 0 0 0 0 0 0 0 0 0 0 0
1.5280 2.8640 -0.7800 H 0 0 0 0 0 0 0 0 0 0 0 0
2.1080 2.6840 0.8920 H 0 0 0 0 0 0 0 0 0 0 0 0
2.6240 -0.4200 -0.5600 H 0 0 0 0 0 0 0 0 0 0 0 0
-1.4160 -1.8160 0.5920 H 0 0 0 0 0 0 0 0 0 0 0 0
-1.5360 0.1560 2.1880 H 0 0 0 0 0 0 0 0 0 0 0 0
0.2360 -0.2280 2.3280 H 0 0 0 0 0 0 0 0 0 0 0 0
-0.6000 2.0680 0.8480 H 0 0 0 0 0 0 0 0 0 0 0 0
0.1960 -0.1800 -1.8800 H 0 0 0 0 0 0 0 0 0 0 0 0
-1.5040 -0.3480 -2.3680 H 0 0 0 0 0 0 0 0 0 0 0 0
-0.7920 1.2680 -2.1600 H 0 0 0 0 0 0 0 0 0 0 0 0
-2.8880 1.5960 -0.3160 H 0 0 0 0 0 0 0 0 0 0 0 0
-3.2960 -0.0640 -0.7920 H 0 0 0 0 0 0 0 0 0 0 0 0
-2.9840 0.3160 0.9160 H 0 0 0 0 0 0 0 0 0 0 0 0
11 25 1 0
11 24 1 0
11 23 1 0
10 22 1 0
10 21 1 0
10 20 1 0
9 11 1 0
9 10 1 0
8 19 1 0
8 9 1 0
7 18 1 0
7 17 1 0
7 8 1 0
6 16 1 0
6 7 1 0
6 9 1 0
4 6 1 0
4 5 1 0
3 15 1 0
3 4 1 0
2 3 1 0
2 8 1 0
1 14 1 0
1 13 1 0
1 12 1 0
1 2 1 0
M END</inlineContents>
</jmolApplet>
</jmol>

== Natural Product==
Identification of Verbenone in natural products (essential oils) has been carried out.
Its idenfication in Rosmarinus ocinalis L. (Uzi Ravid1, Eli Putievsky1, Irena Katzir1, Efraim Lewinsohn1 and Nativ Dudai1, FLAVOUR AND FRAGRANCE JOURNAL, VOL. 12, 109±112 (1997)) shows that
relatively large quantities of verbenone (observed in three rosemary oils) amounted to 27.0±28.9% whilst the average content was 2.3±21.6%.

==Synthesis==
catalytic air-oxidation entry to verbenone

[[Image:oxidised verbenone.JPG|oxidised verbenone.JPG]]

<noinclude>

</noinclude>{| class="toccolours" border="1" style="float: right; clear: right; margin: 0 0 1em 1em; border-collapse: collapse; width: 280px"
! {{chembox header}} | {{PAGENAME}} 
|-
| align="center" colspan="2" bgcolor="#ffffff" | [[Image:2,4-dnph.png|200px|{{PAGENAME}}]] 
|-

==Mass Spectrum==
|-
[[Image:Verbenone mass spectrum.JPG ]]

|-
! {{chembox header}} | General
|-
| [http://en.wikipedia.org/wiki/IUPAC Systematic name]
| (1R)-cis-4,6,6-Trimethylbicyclo-
[3.1.1]hept-3-en-2-one

|-
| Other names
| Verbenone
2-Pinen-4-one
|-
| [http://en.wikipedia.org/wiki/Chemical_formula Molecular formula]
| C<sub>14</sub>H<sub>10</sub>O
|-
| [http://en.wikipedia.org/wiki/Chemical_file_format SMILES] 
| CC(C1C2)(C)C2C(C)=CC1=O
|-
| [http://en.wikipedia.org/wiki/Molar_mass Molar mass]
| 150.21 g/mol
|-
| [http://en.wikipedia.org/wiki/CAS_registry_number CAS number]
| [18308-32-5]
|-
! {{chembox header}} | Properties
|-
| [http://en.wikipedia.org/wiki/Melting_point Melting point]
| 6.5 °C
|-
| [http://en.wikipedia.org/wiki/Boiling_point Boiling point]
| 227-228 °C
|-
| [http://en.wikipedia.org/wiki/Density Density]
| 0.978 g/cm3
|-
| [http://en.wikipedia.org/wiki/Physical_state Physical state]
| liquid
|-
| [http://en.wikipedia.org/wiki/Appearance appearance]
| clear, colorless
|-
|[http://en.wikipedia.org/wiki/MSDS MSDS]
|external link to Material Safety and Data Sheet [http://fscimage.fishersci.com/msds/92615.htm link title]
|-

It07:Verbenone

2007-12-06T19:16:02Z

Rqn06:

= '''VERBENONE'''=
==Verbenone==

<jmol>
<jmolApplet>
<size>200</size>
<color>white</color>
<script>zoom 80; cpk on;frame 1; move 10 -20 10 0 0 0 0 0 3; delay 1;</script>
<inlineContents>Verbenone.mol
title1
title2
25 26 0 0 1 V2000
2.0000 2.1840 -0.0680 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1440 0.9560 0.0960 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6160 -0.2640 -0.1960 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6760 -1.3880 0.0080 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9960 -2.5440 -0.1720 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.7200 -0.9880 0.4680 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.5960 -0.0120 1.6600 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2800 1.0560 0.6040 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2200 0.2360 -0.3160 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8000 0.2440 -1.7880 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7040 0.5440 -0.1120 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9840 1.8960 -0.4400 H 0 0 0 0 0 0 0 0 0 0 0 0
1.5280 2.8640 -0.7800 H 0 0 0 0 0 0 0 0 0 0 0 0
2.1080 2.6840 0.8920 H 0 0 0 0 0 0 0 0 0 0 0 0
2.6240 -0.4200 -0.5600 H 0 0 0 0 0 0 0 0 0 0 0 0
-1.4160 -1.8160 0.5920 H 0 0 0 0 0 0 0 0 0 0 0 0
-1.5360 0.1560 2.1880 H 0 0 0 0 0 0 0 0 0 0 0 0
0.2360 -0.2280 2.3280 H 0 0 0 0 0 0 0 0 0 0 0 0
-0.6000 2.0680 0.8480 H 0 0 0 0 0 0 0 0 0 0 0 0
0.1960 -0.1800 -1.8800 H 0 0 0 0 0 0 0 0 0 0 0 0
-1.5040 -0.3480 -2.3680 H 0 0 0 0 0 0 0 0 0 0 0 0
-0.7920 1.2680 -2.1600 H 0 0 0 0 0 0 0 0 0 0 0 0
-2.8880 1.5960 -0.3160 H 0 0 0 0 0 0 0 0 0 0 0 0
-3.2960 -0.0640 -0.7920 H 0 0 0 0 0 0 0 0 0 0 0 0
-2.9840 0.3160 0.9160 H 0 0 0 0 0 0 0 0 0 0 0 0
11 25 1 0
11 24 1 0
11 23 1 0
10 22 1 0
10 21 1 0
10 20 1 0
9 11 1 0
9 10 1 0
8 19 1 0
8 9 1 0
7 18 1 0
7 17 1 0
7 8 1 0
6 16 1 0
6 7 1 0
6 9 1 0
4 6 1 0
4 5 1 0
3 15 1 0
3 4 1 0
2 3 1 0
2 8 1 0
1 14 1 0
1 13 1 0
1 12 1 0
1 2 1 0
M END</inlineContents>
</jmolApplet>
</jmol>

==Synthesis==
catalytic air-oxidation entry to verbenone

[[Image:oxidised verbenone.JPG|oxidised verbenone.JPG]]

<noinclude>

</noinclude>{| class="toccolours" border="1" style="float: right; clear: right; margin: 0 0 1em 1em; border-collapse: collapse; width: 280px"
! {{chembox header}} | {{PAGENAME}} 
|-
| align="center" colspan="2" bgcolor="#ffffff" | [[Image:2,4-dnph.png|200px|{{PAGENAME}}]] 
|-
==Mass Spectrum==
|-
[[Image:Verbenone mass spectrum.JPG ]]

|-
! {{chembox header}} | General
|-
| [http://en.wikipedia.org/wiki/IUPAC Systematic name]
| (1R)-cis-4,6,6-Trimethylbicyclo-
[3.1.1]hept-3-en-2-one

|-
| Other names
| Verbenone
2-Pinen-4-one
|-
| [http://en.wikipedia.org/wiki/Chemical_formula Molecular formula]
| C<sub>14</sub>H<sub>10</sub>O
|-
| [http://en.wikipedia.org/wiki/Chemical_file_format SMILES] 
| CC(C1C2)(C)C2C(C)=CC1=O
|-
| [http://en.wikipedia.org/wiki/Molar_mass Molar mass]
| 150.21 g/mol
|-
| [http://en.wikipedia.org/wiki/CAS_registry_number CAS number]
| [18308-32-5]
|-
! {{chembox header}} | Properties
|-
| [http://en.wikipedia.org/wiki/Melting_point Melting point]
| 6.5 °C
|-
| [http://en.wikipedia.org/wiki/Boiling_point Boiling point]
| 227-228 °C
|-
| [http://en.wikipedia.org/wiki/Density Density]
| 0.978 g/cm3
|-
| [http://en.wikipedia.org/wiki/Physical_state Physical state]
| liquid
|-
| [http://en.wikipedia.org/wiki/Appearance appearance]
| clear, colorless
|-
|[http://en.wikipedia.org/wiki/MSDS MSDS]
|external link to Material Safety and Data Sheet [http://fscimage.fishersci.com/msds/92615.htm link title]
|-

It07:Verbenone

2007-12-06T19:12:08Z

Rqn06: editted table

= '''VERBENONE'''=
==Verbenone==

<jmol>
<jmolApplet>
<size>200</size>
<color>white</color>
<script>zoom 80; cpk on;frame 1; move 10 -20 10 0 0 0 0 0 3; delay 1;</script>
<inlineContents>Verbenone.mol
title1
title2
25 26 0 0 1 V2000
2.0000 2.1840 -0.0680 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1440 0.9560 0.0960 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6160 -0.2640 -0.1960 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6760 -1.3880 0.0080 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9960 -2.5440 -0.1720 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.7200 -0.9880 0.4680 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.5960 -0.0120 1.6600 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2800 1.0560 0.6040 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2200 0.2360 -0.3160 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8000 0.2440 -1.7880 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7040 0.5440 -0.1120 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9840 1.8960 -0.4400 H 0 0 0 0 0 0 0 0 0 0 0 0
1.5280 2.8640 -0.7800 H 0 0 0 0 0 0 0 0 0 0 0 0
2.1080 2.6840 0.8920 H 0 0 0 0 0 0 0 0 0 0 0 0
2.6240 -0.4200 -0.5600 H 0 0 0 0 0 0 0 0 0 0 0 0
-1.4160 -1.8160 0.5920 H 0 0 0 0 0 0 0 0 0 0 0 0
-1.5360 0.1560 2.1880 H 0 0 0 0 0 0 0 0 0 0 0 0
0.2360 -0.2280 2.3280 H 0 0 0 0 0 0 0 0 0 0 0 0
-0.6000 2.0680 0.8480 H 0 0 0 0 0 0 0 0 0 0 0 0
0.1960 -0.1800 -1.8800 H 0 0 0 0 0 0 0 0 0 0 0 0
-1.5040 -0.3480 -2.3680 H 0 0 0 0 0 0 0 0 0 0 0 0
-0.7920 1.2680 -2.1600 H 0 0 0 0 0 0 0 0 0 0 0 0
-2.8880 1.5960 -0.3160 H 0 0 0 0 0 0 0 0 0 0 0 0
-3.2960 -0.0640 -0.7920 H 0 0 0 0 0 0 0 0 0 0 0 0
-2.9840 0.3160 0.9160 H 0 0 0 0 0 0 0 0 0 0 0 0
11 25 1 0
11 24 1 0
11 23 1 0
10 22 1 0
10 21 1 0
10 20 1 0
9 11 1 0
9 10 1 0
8 19 1 0
8 9 1 0
7 18 1 0
7 17 1 0
7 8 1 0
6 16 1 0
6 7 1 0
6 9 1 0
4 6 1 0
4 5 1 0
3 15 1 0
3 4 1 0
2 3 1 0
2 8 1 0
1 14 1 0
1 13 1 0
1 12 1 0
1 2 1 0
M END</inlineContents>
</jmolApplet>
</jmol>

==Synthesis==
catalytic air-oxidation entry to verbenone

[[Image:oxidised verbenone.JPG|oxidised verbenone.JPG]]

<noinclude>

</noinclude>{| class="toccolours" border="1" style="float: right; clear: right; margin: 0 0 1em 1em; border-collapse: collapse; width: 280px"
! {{chembox header}} | {{PAGENAME}} 
|-
| align="center" colspan="2" bgcolor="#ffffff" | [[Image:2,4-dnph.png|200px|{{PAGENAME}}]] 
|-
==Mass Spectrum==
|-
[[Image:Verbenone mass spectrum.JPG ]]

|-
! {{chembox header}} | General
|-
| [http://en.wikipedia.org/wiki/IUPAC Systematic name]
| (1R)-cis-4,6,6-Trimethylbicyclo-
[3.1.1]hept-3-en-2-one

|-
| Other names
| Verbenone
2-Pinen-4-one
|-
| [http://en.wikipedia.org/wiki/Chemical_formula Molecular formula]
| C<sub>14</sub>H<sub>10</sub>O
|-
| [http://en.wikipedia.org/wiki/Chemical_file_format SMILES] 
| CC(C1C2)(C)C2C(C)=CC1=O
|-
| [http://en.wikipedia.org/wiki/Molar_mass Molar mass]
| 150.21 g/mol
|-
| [http://en.wikipedia.org/wiki/CAS_registry_number CAS number]
| [18308-32-5]
|-
! {{chembox header}} | Properties
|-
| [http://en.wikipedia.org/wiki/Melting_point Melting point]
| 6.5 °C
|-
| [http://en.wikipedia.org/wiki/Boiling_point Boiling point]
| 227-228 °C
|-
| [http://en.wikipedia.org/wiki/Density Density]
| 0.978 g/cm3
|-
| [http://en.wikipedia.org/wiki/Physical_state Physical state]
| liquid
|-
| [http://en.wikipedia.org/wiki/Appearance appearance]
| clear, colorless
|-

It07:Verbenone

2007-12-06T18:48:15Z

Rqn06: synthesis by oxidation

= '''VERBENONE'''=

==Synthesis==
catalytic air-oxidation entry to verbenone

[[Image:oxidised verbenone.JPG|oxidised verbenone.JPG]]

<noinclude>

</noinclude>{| class="toccolours" border="1" style="float: right; clear: right; margin: 0 0 1em 1em; border-collapse: collapse; width: 280px"
! {{chembox header}} | {{PAGENAME}} 
|-
| align="center" colspan="2" bgcolor="#ffffff" | [[Image:2,4-dnph.png|200px|{{PAGENAME}}]] 

==Verbenone==

<jmol>
<jmolApplet>
<size>200</size>
<color>white</color>
<script>zoom 80; cpk on;frame 1; move 10 -20 10 0 0 0 0 0 3; delay 1;</script>
<inlineContents>Verbenone.mol
title1
title2
25 26 0 0 1 V2000
2.0000 2.1840 -0.0680 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1440 0.9560 0.0960 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6160 -0.2640 -0.1960 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6760 -1.3880 0.0080 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9960 -2.5440 -0.1720 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.7200 -0.9880 0.4680 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.5960 -0.0120 1.6600 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2800 1.0560 0.6040 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2200 0.2360 -0.3160 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8000 0.2440 -1.7880 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7040 0.5440 -0.1120 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9840 1.8960 -0.4400 H 0 0 0 0 0 0 0 0 0 0 0 0
1.5280 2.8640 -0.7800 H 0 0 0 0 0 0 0 0 0 0 0 0
2.1080 2.6840 0.8920 H 0 0 0 0 0 0 0 0 0 0 0 0
2.6240 -0.4200 -0.5600 H 0 0 0 0 0 0 0 0 0 0 0 0
-1.4160 -1.8160 0.5920 H 0 0 0 0 0 0 0 0 0 0 0 0
-1.5360 0.1560 2.1880 H 0 0 0 0 0 0 0 0 0 0 0 0
0.2360 -0.2280 2.3280 H 0 0 0 0 0 0 0 0 0 0 0 0
-0.6000 2.0680 0.8480 H 0 0 0 0 0 0 0 0 0 0 0 0
0.1960 -0.1800 -1.8800 H 0 0 0 0 0 0 0 0 0 0 0 0
-1.5040 -0.3480 -2.3680 H 0 0 0 0 0 0 0 0 0 0 0 0
-0.7920 1.2680 -2.1600 H 0 0 0 0 0 0 0 0 0 0 0 0
-2.8880 1.5960 -0.3160 H 0 0 0 0 0 0 0 0 0 0 0 0
-3.2960 -0.0640 -0.7920 H 0 0 0 0 0 0 0 0 0 0 0 0
-2.9840 0.3160 0.9160 H 0 0 0 0 0 0 0 0 0 0 0 0
11 25 1 0
11 24 1 0
11 23 1 0
10 22 1 0
10 21 1 0
10 20 1 0
9 11 1 0
9 10 1 0
8 19 1 0
8 9 1 0
7 18 1 0
7 17 1 0
7 8 1 0
6 16 1 0
6 7 1 0
6 9 1 0
4 6 1 0
4 5 1 0
3 15 1 0
3 4 1 0
2 3 1 0
2 8 1 0
1 14 1 0
1 13 1 0
1 12 1 0
1 2 1 0
M END</inlineContents>
</jmolApplet>
</jmol>

|-
! {{chembox header}} | General
|-
| [http://en.wikipedia.org/wiki/IUPAC Systematic name]
| (1R)-cis-4,6,6-Trimethylbicyclo-
[3.1.1]hept-3-en-2-one

|-
| Other names
| Verbenone
2-Pinen-4-one
|-
| [http://en.wikipedia.org/wiki/Chemical_formula Molecular formula]
| C<sub>14</sub>H<sub>10</sub>O
|-
| [http://en.wikipedia.org/wiki/Chemical_file_format SMILES] 
| CC(C1C2)(C)C2C(C)=CC1=O
|-
| [http://en.wikipedia.org/wiki/Molar_mass Molar mass]
| 150.21 g/mol
|-
| [http://en.wikipedia.org/wiki/CAS_registry_number CAS number]
| [18308-32-5]
|-
! {{chembox header}} | Properties
|-
| [http://en.wikipedia.org/wiki/Melting_point Melting point]
| 6.5 °C
|-
| [http://en.wikipedia.org/wiki/Boiling_point Boiling point]
| 227-228 °C
|-
| [http://en.wikipedia.org/wiki/Density Density]
| 0.978 g/cm3

File:Oxidised verbenone.JPG

2007-12-06T18:43:25Z

Rqn06:

It07:Verbenone

2007-12-06T18:42:39Z

Rqn06:

= '''VERBENONE'''=

==Synthesis==
catalytic air-oxidation entry to verbenone

<noinclude>

</noinclude>{| class="toccolours" border="1" style="float: right; clear: right; margin: 0 0 1em 1em; border-collapse: collapse; width: 280px"
! {{chembox header}} | {{PAGENAME}} 
|-
| align="center" colspan="2" bgcolor="#ffffff" | [[Image:2,4-dnph.png|200px|{{PAGENAME}}]] 

==Verbenone==

<jmol>
<jmolApplet>
<size>200</size>
<color>white</color>
<script>zoom 80; cpk on;frame 1; move 10 -20 10 0 0 0 0 0 3; delay 1;</script>
<inlineContents>Verbenone.mol
title1
title2
25 26 0 0 1 V2000
2.0000 2.1840 -0.0680 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1440 0.9560 0.0960 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6160 -0.2640 -0.1960 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6760 -1.3880 0.0080 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9960 -2.5440 -0.1720 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.7200 -0.9880 0.4680 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.5960 -0.0120 1.6600 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2800 1.0560 0.6040 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2200 0.2360 -0.3160 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8000 0.2440 -1.7880 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7040 0.5440 -0.1120 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9840 1.8960 -0.4400 H 0 0 0 0 0 0 0 0 0 0 0 0
1.5280 2.8640 -0.7800 H 0 0 0 0 0 0 0 0 0 0 0 0
2.1080 2.6840 0.8920 H 0 0 0 0 0 0 0 0 0 0 0 0
2.6240 -0.4200 -0.5600 H 0 0 0 0 0 0 0 0 0 0 0 0
-1.4160 -1.8160 0.5920 H 0 0 0 0 0 0 0 0 0 0 0 0
-1.5360 0.1560 2.1880 H 0 0 0 0 0 0 0 0 0 0 0 0
0.2360 -0.2280 2.3280 H 0 0 0 0 0 0 0 0 0 0 0 0
-0.6000 2.0680 0.8480 H 0 0 0 0 0 0 0 0 0 0 0 0
0.1960 -0.1800 -1.8800 H 0 0 0 0 0 0 0 0 0 0 0 0
-1.5040 -0.3480 -2.3680 H 0 0 0 0 0 0 0 0 0 0 0 0
-0.7920 1.2680 -2.1600 H 0 0 0 0 0 0 0 0 0 0 0 0
-2.8880 1.5960 -0.3160 H 0 0 0 0 0 0 0 0 0 0 0 0
-3.2960 -0.0640 -0.7920 H 0 0 0 0 0 0 0 0 0 0 0 0
-2.9840 0.3160 0.9160 H 0 0 0 0 0 0 0 0 0 0 0 0
11 25 1 0
11 24 1 0
11 23 1 0
10 22 1 0
10 21 1 0
10 20 1 0
9 11 1 0
9 10 1 0
8 19 1 0
8 9 1 0
7 18 1 0
7 17 1 0
7 8 1 0
6 16 1 0
6 7 1 0
6 9 1 0
4 6 1 0
4 5 1 0
3 15 1 0
3 4 1 0
2 3 1 0
2 8 1 0
1 14 1 0
1 13 1 0
1 12 1 0
1 2 1 0
M END</inlineContents>
</jmolApplet>
</jmol>

|-
! {{chembox header}} | General
|-
| [http://en.wikipedia.org/wiki/IUPAC Systematic name]
| (1R)-cis-4,6,6-Trimethylbicyclo-
[3.1.1]hept-3-en-2-one

|-
| Other names
| Verbenone
2-Pinen-4-one
|-
| [http://en.wikipedia.org/wiki/Chemical_formula Molecular formula]
| C<sub>14</sub>H<sub>10</sub>O
|-
| [http://en.wikipedia.org/wiki/Chemical_file_format SMILES] 
| CC(C1C2)(C)C2C(C)=CC1=O
|-
| [http://en.wikipedia.org/wiki/Molar_mass Molar mass]
| 150.21 g/mol
|-
| [http://en.wikipedia.org/wiki/CAS_registry_number CAS number]
| [18308-32-5]
|-
! {{chembox header}} | Properties
|-
| [http://en.wikipedia.org/wiki/Melting_point Melting point]
| 6.5 °C
|-
| [http://en.wikipedia.org/wiki/Boiling_point Boiling point]
| 227-228 °C
|-
| [http://en.wikipedia.org/wiki/Density Density]
| 0.978 g/cm3

It07:Verbenone

2007-12-06T17:59:09Z

Rqn06:

<noinclude>

</noinclude>{| class="toccolours" border="1" style="float: right; clear: right; margin: 0 0 1em 1em; border-collapse: collapse; width: 280px"
! {{chembox header}} | {{PAGENAME}} 
|-
| align="center" colspan="2" bgcolor="#ffffff" | [[Image:2,4-dnph.png|200px|{{PAGENAME}}]] 

==Verbenone==

<jmol>
<jmolApplet>
<size>200</size>
<color>white</color>
<script>zoom 80; cpk on;frame 1; move 10 -20 10 0 0 0 0 0 3; delay 1;</script>
<inlineContents>Verbenone.mol
title1
title2
25 26 0 0 1 V2000
2.0000 2.1840 -0.0680 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1440 0.9560 0.0960 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6160 -0.2640 -0.1960 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6760 -1.3880 0.0080 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9960 -2.5440 -0.1720 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.7200 -0.9880 0.4680 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.5960 -0.0120 1.6600 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2800 1.0560 0.6040 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2200 0.2360 -0.3160 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8000 0.2440 -1.7880 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7040 0.5440 -0.1120 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9840 1.8960 -0.4400 H 0 0 0 0 0 0 0 0 0 0 0 0
1.5280 2.8640 -0.7800 H 0 0 0 0 0 0 0 0 0 0 0 0
2.1080 2.6840 0.8920 H 0 0 0 0 0 0 0 0 0 0 0 0
2.6240 -0.4200 -0.5600 H 0 0 0 0 0 0 0 0 0 0 0 0
-1.4160 -1.8160 0.5920 H 0 0 0 0 0 0 0 0 0 0 0 0
-1.5360 0.1560 2.1880 H 0 0 0 0 0 0 0 0 0 0 0 0
0.2360 -0.2280 2.3280 H 0 0 0 0 0 0 0 0 0 0 0 0
-0.6000 2.0680 0.8480 H 0 0 0 0 0 0 0 0 0 0 0 0
0.1960 -0.1800 -1.8800 H 0 0 0 0 0 0 0 0 0 0 0 0
-1.5040 -0.3480 -2.3680 H 0 0 0 0 0 0 0 0 0 0 0 0
-0.7920 1.2680 -2.1600 H 0 0 0 0 0 0 0 0 0 0 0 0
-2.8880 1.5960 -0.3160 H 0 0 0 0 0 0 0 0 0 0 0 0
-3.2960 -0.0640 -0.7920 H 0 0 0 0 0 0 0 0 0 0 0 0
-2.9840 0.3160 0.9160 H 0 0 0 0 0 0 0 0 0 0 0 0
11 25 1 0
11 24 1 0
11 23 1 0
10 22 1 0
10 21 1 0
10 20 1 0
9 11 1 0
9 10 1 0
8 19 1 0
8 9 1 0
7 18 1 0
7 17 1 0
7 8 1 0
6 16 1 0
6 7 1 0
6 9 1 0
4 6 1 0
4 5 1 0
3 15 1 0
3 4 1 0
2 3 1 0
2 8 1 0
1 14 1 0
1 13 1 0
1 12 1 0
1 2 1 0
M END</inlineContents>
</jmolApplet>
</jmol>

|-
! {{chembox header}} | General
|-
| [http://en.wikipedia.org/wiki/IUPAC Systematic name]
| (1R)-cis-4,6,6-Trimethylbicyclo-
[3.1.1]hept-3-en-2-one

|-
| Other names
| Verbenone
2-Pinen-4-one
|-
| [http://en.wikipedia.org/wiki/Chemical_formula Molecular formula]
| C<sub>14</sub>H<sub>10</sub>O
|-
| [http://en.wikipedia.org/wiki/Chemical_file_format SMILES] 
| CC(C1C2)(C)C2C(C)=CC1=O
|-
| [http://en.wikipedia.org/wiki/Molar_mass Molar mass]
| 150.21 g/mol
|-
| [http://en.wikipedia.org/wiki/CAS_registry_number CAS number]
| [18308-32-5]
|-
! {{chembox header}} | Properties
|-
| [http://en.wikipedia.org/wiki/Melting_point Melting point]
| 6.5 °C
|-
| [http://en.wikipedia.org/wiki/Boiling_point Boiling point]
| 227-228 °C
|-
| [http://en.wikipedia.org/wiki/Density Density]
| 0.978 g/cm3

It07:Verbenone

2007-12-06T17:57:21Z

Rqn06:

<noinclude>

</noinclude>{| class="toccolours" border="1" style="float: right; clear: right; margin: 0 0 1em 1em; border-collapse: collapse; width: 280px"
! {{chembox header}} | {{PAGENAME}} 
|-
| align="center" colspan="2" bgcolor="#ffffff" | [[Image:2,4-dnph.png|200px|{{PAGENAME}}]] 
==Verbenone==

<jmol>
<jmolApplet>
<size>200</size>
<color>white</color>
<script>zoom 80; cpk on;frame 1; move 10 -20 10 0 0 0 0 0 3; delay 1;</script>
<inlineContents>Verbenone.mol
title1
title2
25 26 0 0 1 V2000
2.0000 2.1840 -0.0680 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1440 0.9560 0.0960 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6160 -0.2640 -0.1960 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6760 -1.3880 0.0080 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9960 -2.5440 -0.1720 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.7200 -0.9880 0.4680 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.5960 -0.0120 1.6600 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2800 1.0560 0.6040 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2200 0.2360 -0.3160 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8000 0.2440 -1.7880 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7040 0.5440 -0.1120 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9840 1.8960 -0.4400 H 0 0 0 0 0 0 0 0 0 0 0 0
1.5280 2.8640 -0.7800 H 0 0 0 0 0 0 0 0 0 0 0 0
2.1080 2.6840 0.8920 H 0 0 0 0 0 0 0 0 0 0 0 0
2.6240 -0.4200 -0.5600 H 0 0 0 0 0 0 0 0 0 0 0 0
-1.4160 -1.8160 0.5920 H 0 0 0 0 0 0 0 0 0 0 0 0
-1.5360 0.1560 2.1880 H 0 0 0 0 0 0 0 0 0 0 0 0
0.2360 -0.2280 2.3280 H 0 0 0 0 0 0 0 0 0 0 0 0
-0.6000 2.0680 0.8480 H 0 0 0 0 0 0 0 0 0 0 0 0
0.1960 -0.1800 -1.8800 H 0 0 0 0 0 0 0 0 0 0 0 0
-1.5040 -0.3480 -2.3680 H 0 0 0 0 0 0 0 0 0 0 0 0
-0.7920 1.2680 -2.1600 H 0 0 0 0 0 0 0 0 0 0 0 0
-2.8880 1.5960 -0.3160 H 0 0 0 0 0 0 0 0 0 0 0 0
-3.2960 -0.0640 -0.7920 H 0 0 0 0 0 0 0 0 0 0 0 0
-2.9840 0.3160 0.9160 H 0 0 0 0 0 0 0 0 0 0 0 0
11 25 1 0
11 24 1 0
11 23 1 0
10 22 1 0
10 21 1 0
10 20 1 0
9 11 1 0
9 10 1 0
8 19 1 0
8 9 1 0
7 18 1 0
7 17 1 0
7 8 1 0
6 16 1 0
6 7 1 0
6 9 1 0
4 6 1 0
4 5 1 0
3 15 1 0
3 4 1 0
2 3 1 0
2 8 1 0
1 14 1 0
1 13 1 0
1 12 1 0
1 2 1 0
M END</inlineContents>
</jmolApplet>
</jmol>

|-
! {{chembox header}} | General
|-
| [http://en.wikipedia.org/wiki/IUPAC Systematic name]
| (1R)-cis-4,6,6-Trimethylbicyclo-
[3.1.1]hept-3-en-2-one

|-
| Other names
| Verbenone
2-Pinen-4-one
|-
| [http://en.wikipedia.org/wiki/Chemical_formula Molecular formula]
| C<sub>14</sub>H<sub>10</sub>O
|-
| [http://en.wikipedia.org/wiki/Chemical_file_format SMILES] 
| CC(C1C2)(C)C2C(C)=CC1=O
|-
| [http://en.wikipedia.org/wiki/Molar_mass Molar mass]
| 150.21 g/mol
|-
| [http://en.wikipedia.org/wiki/CAS_registry_number CAS number]
| [18308-32-5]
|-
! {{chembox header}} | Properties
|-
| [http://en.wikipedia.org/wiki/Melting_point Melting point]
| 200-202°C (473-475K) decomposes
|-
| [http://en.wikipedia.org/wiki/Density Density Melting]
| 0.978 g/cm3

It07:Verbenone

2007-12-06T17:56:33Z

Rqn06: uploaded table

<noinclude>

</noinclude>{| class="toccolours" border="1" style="float: right; clear: right; margin: 0 0 1em 1em; border-collapse: collapse; width: 280px"
! {{chembox header}} | {{PAGENAME}} 
|-
| align="center" colspan="2" bgcolor="#ffffff" | [[Image:2,4-dnph.png|200px|{{PAGENAME}}]] 
==Verbenone==

<jmol>
<jmolApplet>
<size>200</size>
<color>white</color>
<script>zoom 80; cpk on;frame 1; move 10 -20 10 0 0 0 0 0 3; delay 1;</script>
<inlineContents>Verbenone.mol
title1
title2
25 26 0 0 1 V2000
2.0000 2.1840 -0.0680 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1440 0.9560 0.0960 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6160 -0.2640 -0.1960 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6760 -1.3880 0.0080 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9960 -2.5440 -0.1720 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.7200 -0.9880 0.4680 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.5960 -0.0120 1.6600 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2800 1.0560 0.6040 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2200 0.2360 -0.3160 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8000 0.2440 -1.7880 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7040 0.5440 -0.1120 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9840 1.8960 -0.4400 H 0 0 0 0 0 0 0 0 0 0 0 0
1.5280 2.8640 -0.7800 H 0 0 0 0 0 0 0 0 0 0 0 0
2.1080 2.6840 0.8920 H 0 0 0 0 0 0 0 0 0 0 0 0
2.6240 -0.4200 -0.5600 H 0 0 0 0 0 0 0 0 0 0 0 0
-1.4160 -1.8160 0.5920 H 0 0 0 0 0 0 0 0 0 0 0 0
-1.5360 0.1560 2.1880 H 0 0 0 0 0 0 0 0 0 0 0 0
0.2360 -0.2280 2.3280 H 0 0 0 0 0 0 0 0 0 0 0 0
-0.6000 2.0680 0.8480 H 0 0 0 0 0 0 0 0 0 0 0 0
0.1960 -0.1800 -1.8800 H 0 0 0 0 0 0 0 0 0 0 0 0
-1.5040 -0.3480 -2.3680 H 0 0 0 0 0 0 0 0 0 0 0 0
-0.7920 1.2680 -2.1600 H 0 0 0 0 0 0 0 0 0 0 0 0
-2.8880 1.5960 -0.3160 H 0 0 0 0 0 0 0 0 0 0 0 0
-3.2960 -0.0640 -0.7920 H 0 0 0 0 0 0 0 0 0 0 0 0
-2.9840 0.3160 0.9160 H 0 0 0 0 0 0 0 0 0 0 0 0
11 25 1 0
11 24 1 0
11 23 1 0
10 22 1 0
10 21 1 0
10 20 1 0
9 11 1 0
9 10 1 0
8 19 1 0
8 9 1 0
7 18 1 0
7 17 1 0
7 8 1 0
6 16 1 0
6 7 1 0
6 9 1 0
4 6 1 0
4 5 1 0
3 15 1 0
3 4 1 0
2 3 1 0
2 8 1 0
1 14 1 0
1 13 1 0
1 12 1 0
1 2 1 0
M END</inlineContents>
</jmolApplet>
</jmol>

|-
! {{chembox header}} | General
|-
| [http://en.wikipedia.org/wiki/IUPAC Systematic name]
| (1R)-cis-4,6,6-Trimethylbicyclo-
[3.1.1]hept-3-en-2-one

|-
| Other names
| Verbenone
2-Pinen-4-one
|-
| [http://en.wikipedia.org/wiki/Chemical_formula Molecular formula]
| C<sub>14</sub>H<sub>10</sub>O
|-
| [http://en.wikipedia.org/wiki/Chemical_file_format SMILES] 
| [H]N([H])N([H])C1=CC=C([N+]
[O-])=O)C=C1[N+]([O-])=O
|-
| [http://en.wikipedia.org/wiki/Molar_mass Molar mass]
| 150.21 g/mol
|-
| Appearance
| wet, red or orange, crystalline powder
|-
| [http://en.wikipedia.org/wiki/CAS_registry_number CAS number]
| [18308-32-5]
|-
! {{chembox header}} | Properties
|-
| [http://en.wikipedia.org/wiki/Melting_point Melting point]
| 200-202°C (473-475K) decomposes
|-
| [http://en.wikipedia.org/wiki/Density Density Melting]
| 0.978 g/cm3

It07:Verbenone

2007-11-14T15:38:51Z

Rqn06: 3D molecule uploaded

==Verbenone==

<jmol>
<jmolApplet>
<size>200</size>
<color>white</color>
<script>zoom 80; cpk on;frame 1; move 10 -20 10 0 0 0 0 0 3; delay 1;</script>
<inlineContents>Verbenone.mol
title1
title2
25 26 0 0 1 V2000
2.0000 2.1840 -0.0680 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1440 0.9560 0.0960 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6160 -0.2640 -0.1960 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6760 -1.3880 0.0080 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9960 -2.5440 -0.1720 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.7200 -0.9880 0.4680 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.5960 -0.0120 1.6600 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2800 1.0560 0.6040 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2200 0.2360 -0.3160 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8000 0.2440 -1.7880 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7040 0.5440 -0.1120 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9840 1.8960 -0.4400 H 0 0 0 0 0 0 0 0 0 0 0 0
1.5280 2.8640 -0.7800 H 0 0 0 0 0 0 0 0 0 0 0 0
2.1080 2.6840 0.8920 H 0 0 0 0 0 0 0 0 0 0 0 0
2.6240 -0.4200 -0.5600 H 0 0 0 0 0 0 0 0 0 0 0 0
-1.4160 -1.8160 0.5920 H 0 0 0 0 0 0 0 0 0 0 0 0
-1.5360 0.1560 2.1880 H 0 0 0 0 0 0 0 0 0 0 0 0
0.2360 -0.2280 2.3280 H 0 0 0 0 0 0 0 0 0 0 0 0
-0.6000 2.0680 0.8480 H 0 0 0 0 0 0 0 0 0 0 0 0
0.1960 -0.1800 -1.8800 H 0 0 0 0 0 0 0 0 0 0 0 0
-1.5040 -0.3480 -2.3680 H 0 0 0 0 0 0 0 0 0 0 0 0
-0.7920 1.2680 -2.1600 H 0 0 0 0 0 0 0 0 0 0 0 0
-2.8880 1.5960 -0.3160 H 0 0 0 0 0 0 0 0 0 0 0 0
-3.2960 -0.0640 -0.7920 H 0 0 0 0 0 0 0 0 0 0 0 0
-2.9840 0.3160 0.9160 H 0 0 0 0 0 0 0 0 0 0 0 0
11 25 1 0
11 24 1 0
11 23 1 0
10 22 1 0
10 21 1 0
10 20 1 0
9 11 1 0
9 10 1 0
8 19 1 0
8 9 1 0
7 18 1 0
7 17 1 0
7 8 1 0
6 16 1 0
6 7 1 0
6 9 1 0
4 6 1 0
4 5 1 0
3 15 1 0
3 4 1 0
2 3 1 0
2 8 1 0
1 14 1 0
1 13 1 0
1 12 1 0
1 2 1 0
M END</inlineContents>
</jmolApplet>
</jmol>

File:Verbenone.MOL

2007-11-14T15:25:11Z

Rqn06:

It07:Verbenone

2007-11-14T15:19:43Z

Rqn06: New page: ==Verbenone==

==Verbenone==

It:projects

2007-11-14T15:19:14Z

Rqn06: Verbenone

__FORCETOC__

'''''You MUST use the Edit buttons on the right to edit this content. Do NOT use the Edit button on the top of this page.'''''
== Sandbox (Play-Pen) ==

This is an area where you can play without worrying what you do. Enter it by pressing the [Edit] button '''on the right''' and '''not''' at the top. Go here for a [http://en.wikipedia.org/wiki/Wikipedia:Cheatsheet ''cheat sheet''] summary of how to create a Wiki page. It's a free-for-all in here! Learn how to use a Wiki by coming here! PS This is how to do Greek:α, β Δ, δ
Try copying/pasting some of the [http://www.ch.ic.ac.uk/local/it/lab1.html examples in the course work] into this page. See the effect by selecting '''Show Preview'''. Do not use '''Save Page''' so as to leave this area uncluttered for others.
----
{| summary="CIT Project Titles" border="1"
|NEW: This demonstrates the use of Jmol loading discrete molecule files (rather than having to paste them into the wiki page). Upload the molecule file, and invoke it as shown here. Use it for eg loading large proteins etc.--[[User:Rzepa|Rzepa]] 16:07, 4 December 2006 (UTC) and --[[User:Rzepa|Rzepa]] 07:41, 16 October 2007 (BST) and --[[User:Rzepa|Rzepa]] 15:56, 18 October 2007 (BST)

If no rotatable molecule appears to the right, test that [http://www.java.com/en/download/help/testvm.xml Java] is correctly functioning on your system.

===References ===
This shows how citations<ref>Example of adding a citation {{DOI|10.1021/ja9825332}}</ref> can be added to
text<ref>adding a further citation {{DOI|10.1021/ja9825332}}</ref> to produce a nice effect.

===Multiple uses of the same footnote ===

The code for citing multiple quotes from the same source can be found [http://www.mediawiki.org/wiki/Extension:Cite/Cite.php here]. This stops the same reference being stated multiple times at the bottom of the page when you try to reference more than one item from the same source.

=== Collected citations appear below here ===
<references />--[[User:Rzepa|Rzepa]] 15:18, 25 October 2007 (BST)
|<jmol>
<jmolApplet>
<title>Pentahelicene</title><color>yellow</color><size>200</size>
<script>zoom 80; cpk on;frame 1; move 10 -20 10 0 0 0 0 0 3; delay 1;</script>
<uploadedFileContents>Pentahelicene.mol</uploadedFileContents>
</jmolApplet>
<jmolMenu>
<item><text>Start spinning</text><script>spin on</script></item>
<item><text>Stop spinning</text><script>spin off</script></item>
<menuHeight>-1</menuHeight>
</jmolMenu>
<jmolButton>
<script>console</script>
<text>open a console window</text>
</jmolButton>
</jmol>
<jmol><jmolAppletButton><title>Show CIYSIM.cif in popup window</title><color>cyan</color>
<uploadedFileContents>CIYSIM.cif</uploadedFileContents></jmolAppletButton>
</jmol>
|}

== Main Project Page ==
'''Please do not edit this page itself'''. Click on one of the titles to start editing.
{| summary="CIT Project Titles" border="1"
! bgcolor="cyan" |Project<br /> Number
! bgcolor="cyan" |General Keywords
|-
| bgcolor="#CCFF00" |01
| bgcolor="#CCFF00" | [[it07:Lignocaine|Lignocaine (used in dentistry as a "local")]]
|-
| bgcolor="#CCFF00" |02
| bgcolor="#66FF99" | [[it07:Piperine|Piperine (active ingredient of both black and white pepper)]]
|-
| bgcolor="#CCFF00" |03
| bgcolor="#CCFF00" | [[it07:Rapamycin|Rapamycin (prevents transplant rejection)]]
|-
| bgcolor="#CCFF00" |04
| bgcolor="#66FF99" | [[it07:Gossypol|Gossypol (male birth control)]]
|-
| bgcolor="#CCFF00" |05
| bgcolor="#CCFF00" | [[it07:Gentamycin|Gentamicin A (aminoglycoside antibiotic)]]
|-
| bgcolor="#CCFF00" |06
| bgcolor="#66FF99" | [[it07:Herceptin|Herceptin (topical anticancer drug)]]
|-
| bgcolor="#CCFF00" |07
| bgcolor="#CCFF00" | [[it07:Gingerone|Zingerone (the characteristic smell of ginger)]]
|-
| bgcolor="#CCFF00" |08
| bgcolor="#66FF99" | [[it07:Sucralose|Sucralose (non-metabolizable sweetening agent)]]
|-
| bgcolor="#CCFF00" |09
| bgcolor="#CCFF00" | [[it07:Bufotoxin|Bufotoxin (active component of the toad ''Bufo vulgaris'')]]
|-
| bgcolor="#CCFF00" |10
| bgcolor="#66FF99" | [[it07:Roaccutane|Roaccutane (treatment for severe acne)]]
|-
| bgcolor="#CCFF00" |11
| bgcolor="#CCFF00" | [[it07:Sibutramine|Sibutramine (appetite suppresor)]]
|-
| bgcolor="#CCFF00" |12
| bgcolor="#66FF99" | [[it07:Anandamide|Anandamide (the "feel-good" factor in chocolate)]]
|-
| bgcolor="#CCFF00" |13
| bgcolor="#CCFF00" | [[it07:h3nbh3|Ammonia-borane: H<sub>3</sub>N-BH<sub>3</sub> (Hydrogen storage molecule?)]]
|-
| bgcolor="#CCFF00" |14
| bgcolor="#66FF99" | [[it07:Methoxsalen|Methoxsalen (Treatment of psoriasis)]]
|-
| bgcolor="#CCFF00" |15
| bgcolor="#CCFF00" | [[it07:Hycocine|Hyoscine (From Mandrake and Witches Henbane, pre-med before surgery)]]
|-
| bgcolor="#CCFF00" |16
| bgcolor="#66FF99" | [[it07:Capreomycin|Capreomycin (Drug-resistant TB)]]
|}

== Supplemental Project Page ==

This area is for people who wish to create their own projects if none of the above appeal to them. Click on the '''Edit''' button to the right to open up an editable page,
then add an entry below as follows

*<nowiki> [[it07:name_of_project|Descriptive name of intended project]]</nowiki>
*This will produce the effect: [[it07:name_of_project|Descriptive name of intended project]]
----
#[[it07:sitagliptin_page|An example entry- in edit mode, please copy this line and paste below to add to this list]]
#[[it07:name_of_project|Vitamin C ]]
#[[it07:Cylcophosphamide|Cyclophosphamide]]
#[[it07:Terbutaline Sulphate|Terbutaline Sulphate]]
#[[it07:Caffeine|Caffeine]]
#[[it07:Mefloquine|Mefloquine]]
#[[it07:Cadaverine|Cadaverine]]
#[[it07:Cyanidin|Cyanidin]]
#[[it07:Ezetimibe|Ezetimibe]]
#[[it07:Octanitrocubane|Octanitrocubane]]
#[[it07:Azadirachtin|Azadirachtin]]
#[[it07:Nicotine|Nicotine]]
#[[Image:chem.png]][[it07:Cyclopentasiloxane|Cyclopentasiloxane]]
#[[it07:Trinitrotoluene|Trinitrotoluene]]
#[[it07:Hydroxychloroquine|Hydroxychloroquine]]
#[[it07:Aspartame|Aspartame]]
#[[it07:Azulene|Azulene]]
#[[it07:Chlorine Trifluoride|Chlorine Trifluoride]]
#[[it07:Cholesterol|Cholesterol]]
#[[it07:Vitamin E|Vitamin E]]
#[[it07:Phenothiazine|Phenothiazine]]
#[[it07:linalool|linalool]]
#[[it07:Glutamic acid|Glutamic acid]]
#[[it07:N-(4-hydroxyphenyl)ethanamide|N-(4-hydroxyphenyl)ethanamide]]
#[[it07:Epinephrine|Epinephrine]]
#[[it07:Sodium Valproate|Sodium Valproate]]
#[[it07:Hyaluronic acid |Hyaluronic acid ]]
#[[it07:Methylenedioxymethamphetamine |Methylenedioxymethamphetamine ]]
#[[it07:salicylic acid |salicylic acid ]]
#[[it07:Morphine|Morphine]]
#[[Cetirizine]]
#[[it07:Bisacodyl|Bisacodyl]]
#[[it07:Rivaroxaban|Rivaroxaban]]
#[[it07:Sodium Lauryl Sulfate|Sodium Lauryl Sulfate]]
#[[it07:Silicon Dioxide|Silicon Dioxide]]
#[[it07:Vanillin|Vanillin]]
#[[it07:Tetrahydrocannabinol|Tetrahydrocannabinol]]
#[[it07:Capsaicin|Capsaicin]]
#[[it07:Menthol|Menthol]]
#[[it07:Tamoxifen|Tamoxifen]]
#[[it07:Copper arsenate|Scheele's Green]]
#[[it07:Strychnine|Strychnine]]
#[[it07:Testosterone|Testosterone]]
#[[it07:Monosodium glutamate|Monosodium glutamate]]
#[[it07:Taurine|Taurine]]
#[[it07:Phenethylamine|Phenethylamine]]
#[[it07:Verbenone|Verbenone]]

== Cetirizine ==
Utilities have been written to help the conversion of material from HTML.
# [http://diberri.dyndns.org/wikipedia/html2wiki/ A HTML2Wiki Converter]
----

== Wiki Templates ==

[[Template:DOI]] and [[Template:Doi-inline]] are providea as (protected) templates for your use. Many other templates exist, often to be found on e.g. Wikipedia pages. You may decide one of these is of particular use, or of interest. If so, you can install it on the wiki here for you and others to use. Add below a line that looks like Template:Template-name, save, and click on the red text to create the new template. If you prefer the task of adding useful templates to that of adding information about molecules, then you will be given full credit for performing this valuable service for others! --Rzepa 14:41, 20 October 2006 (BST)

[[Template:Chem-Data]]

[[Template:Drug-Box]] - For pharmaceutical drugs just copy variable names and code generates tables

[[Template:Chembox supplement]] - to be linked to from the supplementary section of the table in the template above, for usage see [[Template_talk:chembox_supplement|here]]

[[Template:NFPA_704]] - for notes on how to use, see [[Template_talk:NFPA_704|here]]

[[R & S Phrases]]

[[Template:Chembox new]]

Cetirizine

2007-11-14T14:47:34Z

Rqn06: /* '''Usages of ZYRTEC''' */

=Cetirizine=

<jmol>
<jmolApplet>
<size>200</size>
<color>black</color>
<script>zoom 80; cpk on;frame 1; move 10 -20 10 0 0 0 0 0 3; delay 1;</script>
<inlineContents>Cetirizine_3d.mol
title1
title2
52 54 0 0 1 V2000
1.8720 -0.7280 1.2200 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7520 -1.1400 0.2680 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.4120 -0.2680 0.4680 N 0 0 0 0 0 0 0 0 0 0 0 0
0.0200 1.0960 0.1560 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1400 1.5080 1.1120 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3040 0.6400 0.9120 N 0 0 0 0 0 0 0 0 0 0 0 0
3.2920 1.0120 1.9360 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6240 0.3240 1.6360 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1520 0.8200 0.4040 O 0 0 0 0 0 0 0 0 0 0 0 0
6.3880 0.1400 0.1800 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9960 0.6200 -1.1080 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4320 1.4600 -1.7720 O 0 0 0 0 0 0 0 0 0 0 0 0
8.1720 0.1200 -1.5280 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.3960 -0.6440 -0.5520 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.8320 -2.0680 -0.3360 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.9280 -2.9320 -1.4080 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3280 -4.2400 -1.2080 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6280 -4.6880 0.0600 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5240 -3.8240 1.1360 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1240 -2.5160 0.9360 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5920 0.2640 -0.4520 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.1960 0.7400 -1.6000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.2960 1.5760 -1.5080 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.7880 1.9360 -0.2680 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.1840 1.4560 0.8800 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.0920 0.6160 0.7880 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.1680 2.9840 -0.1520 Cl 0 0 0 0 0 0 0 0 0 0 0 0
1.5080 -0.7680 2.2480 H 0 0 0 0 0 0 0 0 0 0 0 0
2.7160 -1.4080 1.1080 H 0 0 0 0 0 0 0 0 0 0 0 0
1.1000 -1.0480 -0.7600 H 0 0 0 0 0 0 0 0 0 0 0 0
0.4720 -2.1760 0.4640 H 0 0 0 0 0 0 0 0 0 0 0 0
0.3840 1.1360 -0.8680 H 0 0 0 0 0 0 0 0 0 0 0 0
-0.8200 1.7760 0.2720 H 0 0 0 0 0 0 0 0 0 0 0 0
1.4200 2.5440 0.9120 H 0 0 0 0 0 0 0 0 0 0 0 0
0.7920 1.4200 2.1400 H 0 0 0 0 0 0 0 0 0 0 0 0
3.4320 2.0920 1.9280 H 0 0 0 0 0 0 0 0 0 0 0 0
2.9320 0.7000 2.9160 H 0 0 0 0 0 0 0 0 0 0 0 0
5.3280 0.5280 2.4400 H 0 0 0 0 0 0 0 0 0 0 0 0
4.4640 -0.7520 1.5560 H 0 0 0 0 0 0 0 0 0 0 0 0
7.0720 0.3480 1.0040 H 0 0 0 0 0 0 0 0 0 0 0 0
6.2080 -0.9280 0.1160 H 0 0 0 0 0 0 0 0 0 0 0 0
8.5640 0.4280 -2.3560 H 0 0 0 0 0 0 0 0 0 0 0 0
-0.9480 -0.5440 -1.5400 H 0 0 0 0 0 0 0 0 0 0 0 0
-1.6960 -2.5840 -2.4040 H 0 0 0 0 0 0 0 0 0 0 0 0
-2.4080 -4.9160 -2.0480 H 0 0 0 0 0 0 0 0 0 0 0 0
-2.9400 -5.7080 0.2160 H 0 0 0 0 0 0 0 0 0 0 0 0
-2.7600 -4.1720 2.1320 H 0 0 0 0 0 0 0 0 0 0 0 0
-2.0440 -1.8400 1.7760 H 0 0 0 0 0 0 0 0 0 0 0 0
-2.8120 0.4640 -2.5680 H 0 0 0 0 0 0 0 0 0 0 0 0
-4.7680 1.9480 -2.4040 H 0 0 0 0 0 0 0 0 0 0 0 0
-4.5720 1.7360 1.8480 H 0 0 0 0 0 0 0 0 0 0 0 0
-2.6200 0.2440 1.6840 H 0 0 0 0 0 0 0 0 0 0 0 0
26 52 1 0
25 51 1 0
25 26 1 0
24 27 1 0
24 25 1 0
23 50 1 0
23 24 1 0
22 49 1 0
22 23 1 0
21 22 1 0
21 26 1 0
20 48 1 0
19 47 1 0
19 20 1 0
18 46 1 0
18 19 1 0
17 45 1 0
17 18 1 0
16 44 1 0
16 17 1 0
15 16 1 0
15 20 1 0
14 43 1 0
14 21 1 0
14 15 1 0
13 42 1 0
11 13 1 0
11 12 1 0
10 41 1 0
10 40 1 0
10 11 1 0
9 10 1 0
8 39 1 0
8 38 1 0
8 9 1 0
7 37 1 0
7 36 1 0
7 8 1 0
6 7 1 0
5 35 1 0
5 34 1 0
5 6 1 0
4 33 1 0
4 32 1 0
4 5 1 0
3 14 1 0
3 4 1 0
2 31 1 0
2 30 1 0
2 3 1 0
1 29 1 0
1 28 1 0
1 2 1 0
1 6 1 0
M END</inlineContents>
</jmolApplet>
</jmol>

<jmol>
<jmolApplet>
<title>Cetirizine 3d.MOL</title><color>black</color>
<size>200</size>
<script>zoom 80; cpk -25;frame 1; move 10 -20 10 0 0 0 0 0 3; delay 1;</script>
<uploadedFileContents>Cetirizine 3d.MOL</uploadedFileContents>
</jmolApplet>

<jmolMenu>
<item><text>Start spinning</text><script>spin on</script></item>
<item><text>Stop spinning</text><script>spin off</script></item>
<menuHeight>-1</menuHeight>
</jmolMenu>
<jmolButton>
<script>console</script>
<text>open a console window</text>
</jmolButton>
</jmol>

<jmol>
<jmolAppletButton>
<title>Show Citirizine in popup window</title>
<color>cyan</color>
<uploadedFileContents>Cetirizine 3d.MOL</uploadedFileContents>
</jmolAppletButton>
</jmol>

==General==
'''Cetirizine''', with the chemical name '''''(±) - [2- [4- [ (4-chlorophenyl)phenylmethyl] -1- piperazinyl] ethoxy]acetic acid dihydrochloride''''',a major matabolite of Hydroxyzine,which is an orally active and selective H1-receptor antagonist. The chemical structure is shown below:

[[Image:Cetirizine structure.gif|thumb|Image of Cyclophosphamide]]

This chemical compound is a white, crystalline powder and is water soluble, it is mainly used in medical treatment of allergies, hay fever, angioedema, and urticaria. ZYRTEC tablets(the active component of the chemical compound)are formulated as white, film-coated, rounded-off rectangular shaped tablets for oral administration and are available in 5 and 10 mg strengths.

==Synthesis==

'''(S)-cetirizine.2HCl''' is prepared via the diastereoselective organometallic addition to N-tert-butanesulfnyl adlimines (''scheme 1''). Organometallic reagent addition to imines is advantageous in that either enantiomeric forms of ceterizine (''structure 2'') can be produced by changing the imine/ organometallic partner; the imine of 4-chlorobenzaleldehyde (''structure 4'') with metallobenzene gives the opposite enantiomer to the reaction of benzaldehyde imine (''structure 3'') with the 4-chlorometallobenzene.

==Spectra==

NMR Spectral information showing a variation of chemical shifts against pD; these pD values are obtained when a correction of 0.4 were added to measured pH values[1]

<sup>1</sup>H-NMR spectra

[[Image:HNMR_cetirizine.JPG|HNMR_cetirizine.JPG]]

<sup>13</sup>C-NMR spectra for the <sup>13</sup>C nuclei in D<sub>2</sub> nuclei at 24.85 C and 200 MHz.

[[Image:CNMR_cetirizine.JPG|CNMR_cetirizine.JPG]]

==Pharmaceutical Usage==

== '''[[Usages of ZYRTEC]]''' ==

'''Seasonal Allergic Rhinitis'''

''Symptoms:'' Zyrtec provides relief to symptoms of sneezing, rhinorrhea, nasal prutitus, ocular pruritus, tearing, and redness of the eyes

''Allergens:'' ragweed, grass and tree pollens are causes of seasonal allergic rhinitis

'''Perennial Allergic Rhinitis:'''

''Symptoms:'' sneezing, rhinorrhea, postnasal discharge, nasal pruritus, ocular pruritus, and tearing.

''Allergens:'' dust mites, animal dander and molds

'''Chronic Urticaria:'''
''Symptoms:'' uncomplicated skin

''Allergens:'' hives

'''DOSING''': Cetirizine should be taken at doses specifically directed by a physician, it can be taken with food.

'''DRUG INTERACTIONS''': Cetirizine should be taken only in doses prescribed. Increasing the dose can be dangerous. When taking cetirizine with theophylline the dose of theophylline may need to be reduced. Cetirizine occasionally can cause sleepiness . Cetirizine can be taken with erythromycin or ketaconazole without the increased risk of heart irregularities common to other non-sedating antihistamines. Cetirizine also can be used to treat children.
SIDE EFFECTS: Sleepiness occurs in 14% of patients. Dry mouth, nausea, headache, fatigue, jitteriness and sore throat are infrequently reported with cetirizine.
|-

==References==

</noinclude>{| class="toccolours" border="1" style="float: right; clear: right; margin: 0 0 1em 1em; border-collapse: collapse; width: 280px"
! {{chembox header}} | {{PAGENAME}} 
|-
! {{chembox header}} | General
|-
| [http://en.wikipedia.org/wiki/IUPAC Systematic name]
| (±) - [2- [4- [ (4-chlorophenyl)phenylmethyl] -1- piperazinyl] ethoxy]acetic acid dihydrochloride
|-
| [http://en.wikipedia.org/wiki/Chemical_formula Molecular formula]
| C21H25ClN2O3
|-
| [http://en.wikipedia.org/wiki/Chemical_file_format SMILES] 
| C1CN(CCN1CCOCC(=O)O)C(C2=CC=CC=C2)C3=CC=C(C=C3)Cl
|-
| [http://en.wikipedia.org/wiki/Molar_mass Molar mass]
| 461.82g/mol
|-
| [http://en.wikipedia.org/wiki/Percentage_composition Percentage composition]
| C 64.86%, H 6.48%, Cl 9.12%, N 7.20%, O 12.34%
|-
| Appearance
| White Crystalline powder, water soluble
|-
| [http://en.wikipedia.org/wiki/CAS_registry_number CAS number]
| 83881-51-0
|-
| [http://en.wikipedia.org/wiki/Synonyms]
| Alatrol, Cetirizina MERCK, Cetzine Glaxo, Cetirizin, Humex, Letizen, Razene, Reactine, Zyrtec, Zirtec, Zodac, Zirtek, Zynor, Zyrlek
|-
| [http://en.wikipedia.org/wiki/Boiling_point Boiling point]
|
|-
| [http://en.wikipedia.org/wiki/Melting_point Melting point]
|110-115°(for crystals from ethanol)
|-
| [http://en.wikipedia.org/wiki/Refractive_Index Refractive index]
|
|-
| [http://en.wikipedia.org/wiki/Bioavailability]
| Well absorbed
|-
|[http://en.wikipedia.org/wiki/Protein_Binding]
| 93% avg
|-
| [[Lawson Number]]
| 28000, 14305, 3122, 1771
|-
! {{chembox header}} | [[{{PAGENAME}} (data page)|Supplementary data page]]
|-
| [[{{PAGENAME}} (data page)#Structure and properties|Structure and<br />properties]]
| [http://en.wikipedia.org/wiki/Refractive_index ''n''], [http://en.wikipedia.org/wiki/Dielectric_constant ε<sub>r</sub>], etc.
|-
| [[{{PAGENAME}} (data page)#Thermodynamic properties|Thermodynamic<br />data]]
| Phase behaviour<br />Solid, liquid, gas
|-

|-
! {{chembox header}} | Related compounds
|-
| Other [[Ion|anion]]s 
| {{{Other_anion}}} 
|-
| Other [[Ion|cation]]s 
| {{{Ohter_cation}}} 
|-
| Related compounds

| {{{Relative_Compounds}}}
|-
| {{chembox header}} | <small>Except where noted otherwise, data are given for<br /> materials in their [[standard state|standard state (at 25 °C, 100 kPa)]]<br />[[wikipedia:Chemical infobox|Infobox disclaimer and references]]</small>

Cetirizine

2007-11-14T14:45:12Z

Rqn06: Pharmaceutical Usage updated

=Cetirizine=

<jmol>
<jmolApplet>
<size>200</size>
<color>black</color>
<script>zoom 80; cpk on;frame 1; move 10 -20 10 0 0 0 0 0 3; delay 1;</script>
<inlineContents>Cetirizine_3d.mol
title1
title2
52 54 0 0 1 V2000
1.8720 -0.7280 1.2200 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7520 -1.1400 0.2680 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.4120 -0.2680 0.4680 N 0 0 0 0 0 0 0 0 0 0 0 0
0.0200 1.0960 0.1560 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1400 1.5080 1.1120 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3040 0.6400 0.9120 N 0 0 0 0 0 0 0 0 0 0 0 0
3.2920 1.0120 1.9360 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6240 0.3240 1.6360 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1520 0.8200 0.4040 O 0 0 0 0 0 0 0 0 0 0 0 0
6.3880 0.1400 0.1800 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9960 0.6200 -1.1080 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4320 1.4600 -1.7720 O 0 0 0 0 0 0 0 0 0 0 0 0
8.1720 0.1200 -1.5280 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.3960 -0.6440 -0.5520 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.8320 -2.0680 -0.3360 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.9280 -2.9320 -1.4080 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3280 -4.2400 -1.2080 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6280 -4.6880 0.0600 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5240 -3.8240 1.1360 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1240 -2.5160 0.9360 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5920 0.2640 -0.4520 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.1960 0.7400 -1.6000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.2960 1.5760 -1.5080 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.7880 1.9360 -0.2680 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.1840 1.4560 0.8800 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.0920 0.6160 0.7880 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.1680 2.9840 -0.1520 Cl 0 0 0 0 0 0 0 0 0 0 0 0
1.5080 -0.7680 2.2480 H 0 0 0 0 0 0 0 0 0 0 0 0
2.7160 -1.4080 1.1080 H 0 0 0 0 0 0 0 0 0 0 0 0
1.1000 -1.0480 -0.7600 H 0 0 0 0 0 0 0 0 0 0 0 0
0.4720 -2.1760 0.4640 H 0 0 0 0 0 0 0 0 0 0 0 0
0.3840 1.1360 -0.8680 H 0 0 0 0 0 0 0 0 0 0 0 0
-0.8200 1.7760 0.2720 H 0 0 0 0 0 0 0 0 0 0 0 0
1.4200 2.5440 0.9120 H 0 0 0 0 0 0 0 0 0 0 0 0
0.7920 1.4200 2.1400 H 0 0 0 0 0 0 0 0 0 0 0 0
3.4320 2.0920 1.9280 H 0 0 0 0 0 0 0 0 0 0 0 0
2.9320 0.7000 2.9160 H 0 0 0 0 0 0 0 0 0 0 0 0
5.3280 0.5280 2.4400 H 0 0 0 0 0 0 0 0 0 0 0 0
4.4640 -0.7520 1.5560 H 0 0 0 0 0 0 0 0 0 0 0 0
7.0720 0.3480 1.0040 H 0 0 0 0 0 0 0 0 0 0 0 0
6.2080 -0.9280 0.1160 H 0 0 0 0 0 0 0 0 0 0 0 0
8.5640 0.4280 -2.3560 H 0 0 0 0 0 0 0 0 0 0 0 0
-0.9480 -0.5440 -1.5400 H 0 0 0 0 0 0 0 0 0 0 0 0
-1.6960 -2.5840 -2.4040 H 0 0 0 0 0 0 0 0 0 0 0 0
-2.4080 -4.9160 -2.0480 H 0 0 0 0 0 0 0 0 0 0 0 0
-2.9400 -5.7080 0.2160 H 0 0 0 0 0 0 0 0 0 0 0 0
-2.7600 -4.1720 2.1320 H 0 0 0 0 0 0 0 0 0 0 0 0
-2.0440 -1.8400 1.7760 H 0 0 0 0 0 0 0 0 0 0 0 0
-2.8120 0.4640 -2.5680 H 0 0 0 0 0 0 0 0 0 0 0 0
-4.7680 1.9480 -2.4040 H 0 0 0 0 0 0 0 0 0 0 0 0
-4.5720 1.7360 1.8480 H 0 0 0 0 0 0 0 0 0 0 0 0
-2.6200 0.2440 1.6840 H 0 0 0 0 0 0 0 0 0 0 0 0
26 52 1 0
25 51 1 0
25 26 1 0
24 27 1 0
24 25 1 0
23 50 1 0
23 24 1 0
22 49 1 0
22 23 1 0
21 22 1 0
21 26 1 0
20 48 1 0
19 47 1 0
19 20 1 0
18 46 1 0
18 19 1 0
17 45 1 0
17 18 1 0
16 44 1 0
16 17 1 0
15 16 1 0
15 20 1 0
14 43 1 0
14 21 1 0
14 15 1 0
13 42 1 0
11 13 1 0
11 12 1 0
10 41 1 0
10 40 1 0
10 11 1 0
9 10 1 0
8 39 1 0
8 38 1 0
8 9 1 0
7 37 1 0
7 36 1 0
7 8 1 0
6 7 1 0
5 35 1 0
5 34 1 0
5 6 1 0
4 33 1 0
4 32 1 0
4 5 1 0
3 14 1 0
3 4 1 0
2 31 1 0
2 30 1 0
2 3 1 0
1 29 1 0
1 28 1 0
1 2 1 0
1 6 1 0
M END</inlineContents>
</jmolApplet>
</jmol>

<jmol>
<jmolApplet>
<title>Cetirizine 3d.MOL</title><color>black</color>
<size>200</size>
<script>zoom 80; cpk -25;frame 1; move 10 -20 10 0 0 0 0 0 3; delay 1;</script>
<uploadedFileContents>Cetirizine 3d.MOL</uploadedFileContents>
</jmolApplet>

<jmolMenu>
<item><text>Start spinning</text><script>spin on</script></item>
<item><text>Stop spinning</text><script>spin off</script></item>
<menuHeight>-1</menuHeight>
</jmolMenu>
<jmolButton>
<script>console</script>
<text>open a console window</text>
</jmolButton>
</jmol>

<jmol>
<jmolAppletButton>
<title>Show Citirizine in popup window</title>
<color>cyan</color>
<uploadedFileContents>Cetirizine 3d.MOL</uploadedFileContents>
</jmolAppletButton>
</jmol>

==General==
'''Cetirizine''', with the chemical name '''''(±) - [2- [4- [ (4-chlorophenyl)phenylmethyl] -1- piperazinyl] ethoxy]acetic acid dihydrochloride''''',a major matabolite of Hydroxyzine,which is an orally active and selective H1-receptor antagonist. The chemical structure is shown below:

[[Image:Cetirizine structure.gif|thumb|Image of Cyclophosphamide]]

This chemical compound is a white, crystalline powder and is water soluble, it is mainly used in medical treatment of allergies, hay fever, angioedema, and urticaria. ZYRTEC tablets(the active component of the chemical compound)are formulated as white, film-coated, rounded-off rectangular shaped tablets for oral administration and are available in 5 and 10 mg strengths.

==Synthesis==

'''(S)-cetirizine.2HCl''' is prepared via the diastereoselective organometallic addition to N-tert-butanesulfnyl adlimines (''scheme 1''). Organometallic reagent addition to imines is advantageous in that either enantiomeric forms of ceterizine (''structure 2'') can be produced by changing the imine/ organometallic partner; the imine of 4-chlorobenzaleldehyde (''structure 4'') with metallobenzene gives the opposite enantiomer to the reaction of benzaldehyde imine (''structure 3'') with the 4-chlorometallobenzene.

==Spectra==

NMR Spectral information showing a variation of chemical shifts against pD; these pD values are obtained when a correction of 0.4 were added to measured pH values[1]

<sup>1</sup>H-NMR spectra

[[Image:HNMR_cetirizine.JPG|HNMR_cetirizine.JPG]]

<sup>13</sup>C-NMR spectra for the <sup>13</sup>C nuclei in D<sub>2</sub> nuclei at 24.85 C and 200 MHz.

[[Image:CNMR_cetirizine.JPG|CNMR_cetirizine.JPG]]

==Pharmaceutical Usage==

== '''[[Usages of ZYRTEC]]''' ==

'''Seasonal Allergic Rhinitis'''

''Symptoms:'' Zyrtec provides relief to symptoms of sneezing, rhinorrhea, nasal prutitus, ocular pruritus, tearing, and redness of the eyes

''Allergens:'' ragweed, grass and tree pollens are causes of seasonal allergic rhinitis

'''Perennial Allergic Rhinitis:'''

''Symptoms:'' sneezing, rhinorrhea, postnasal discharge, nasal pruritus, ocular pruritus, and tearing.

''Allergens:'' dust mites, animal dander and molds

'''Chronic Urticaria:'''
''Symptoms:'' uncomplicated skin
''Allergens:'' hives

'''DOSING''': Cetirizine should be taken at doses specifically directed by a physician, it can be taken with food.

'''DRUG INTERACTIONS''': Cetirizine should be taken only in doses prescribed. Increasing the dose can be dangerous. When taking cetirizine with theophylline the dose of theophylline may need to be reduced. Cetirizine occasionally can cause sleepiness . Cetirizine can be taken with erythromycin or ketaconazole without the increased risk of heart irregularities common to other non-sedating antihistamines. Cetirizine also can be used to treat children.
SIDE EFFECTS: Sleepiness occurs in 14% of patients. Dry mouth, nausea, headache, fatigue, jitteriness and sore throat are infrequently reported with cetirizine.
|-

==References==

</noinclude>{| class="toccolours" border="1" style="float: right; clear: right; margin: 0 0 1em 1em; border-collapse: collapse; width: 280px"
! {{chembox header}} | {{PAGENAME}} 
|-
! {{chembox header}} | General
|-
| [http://en.wikipedia.org/wiki/IUPAC Systematic name]
| (±) - [2- [4- [ (4-chlorophenyl)phenylmethyl] -1- piperazinyl] ethoxy]acetic acid dihydrochloride
|-
| [http://en.wikipedia.org/wiki/Chemical_formula Molecular formula]
| C21H25ClN2O3
|-
| [http://en.wikipedia.org/wiki/Chemical_file_format SMILES] 
| C1CN(CCN1CCOCC(=O)O)C(C2=CC=CC=C2)C3=CC=C(C=C3)Cl
|-
| [http://en.wikipedia.org/wiki/Molar_mass Molar mass]
| 461.82g/mol
|-
| [http://en.wikipedia.org/wiki/Percentage_composition Percentage composition]
| C 64.86%, H 6.48%, Cl 9.12%, N 7.20%, O 12.34%
|-
| Appearance
| White Crystalline powder, water soluble
|-
| [http://en.wikipedia.org/wiki/CAS_registry_number CAS number]
| 83881-51-0
|-
| [http://en.wikipedia.org/wiki/Synonyms]
| Alatrol, Cetirizina MERCK, Cetzine Glaxo, Cetirizin, Humex, Letizen, Razene, Reactine, Zyrtec, Zirtec, Zodac, Zirtek, Zynor, Zyrlek
|-
| [http://en.wikipedia.org/wiki/Boiling_point Boiling point]
|
|-
| [http://en.wikipedia.org/wiki/Melting_point Melting point]
|110-115°(for crystals from ethanol)
|-
| [http://en.wikipedia.org/wiki/Refractive_Index Refractive index]
|
|-
| [http://en.wikipedia.org/wiki/Bioavailability]
| Well absorbed
|-
|[http://en.wikipedia.org/wiki/Protein_Binding]
| 93% avg
|-
| [[Lawson Number]]
| 28000, 14305, 3122, 1771
|-
! {{chembox header}} | [[{{PAGENAME}} (data page)|Supplementary data page]]
|-
| [[{{PAGENAME}} (data page)#Structure and properties|Structure and<br />properties]]
| [http://en.wikipedia.org/wiki/Refractive_index ''n''], [http://en.wikipedia.org/wiki/Dielectric_constant ε<sub>r</sub>], etc.
|-
| [[{{PAGENAME}} (data page)#Thermodynamic properties|Thermodynamic<br />data]]
| Phase behaviour<br />Solid, liquid, gas
|-

|-
! {{chembox header}} | Related compounds
|-
| Other [[Ion|anion]]s 
| {{{Other_anion}}} 
|-
| Other [[Ion|cation]]s 
| {{{Ohter_cation}}} 
|-
| Related compounds

| {{{Relative_Compounds}}}
|-
| {{chembox header}} | <small>Except where noted otherwise, data are given for<br /> materials in their [[standard state|standard state (at 25 °C, 100 kPa)]]<br />[[wikipedia:Chemical infobox|Infobox disclaimer and references]]</small>

Cetirizine

2007-11-14T14:26:19Z

Rqn06: /* Spectra */

=Cetirizine=

<jmol>
<jmolApplet>
<size>200</size>
<color>black</color>
<script>zoom 80; cpk on;frame 1; move 10 -20 10 0 0 0 0 0 3; delay 1;</script>
<inlineContents>Cetirizine_3d.mol
title1
title2
52 54 0 0 1 V2000
1.8720 -0.7280 1.2200 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7520 -1.1400 0.2680 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.4120 -0.2680 0.4680 N 0 0 0 0 0 0 0 0 0 0 0 0
0.0200 1.0960 0.1560 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1400 1.5080 1.1120 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3040 0.6400 0.9120 N 0 0 0 0 0 0 0 0 0 0 0 0
3.2920 1.0120 1.9360 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6240 0.3240 1.6360 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1520 0.8200 0.4040 O 0 0 0 0 0 0 0 0 0 0 0 0
6.3880 0.1400 0.1800 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9960 0.6200 -1.1080 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4320 1.4600 -1.7720 O 0 0 0 0 0 0 0 0 0 0 0 0
8.1720 0.1200 -1.5280 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.3960 -0.6440 -0.5520 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.8320 -2.0680 -0.3360 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.9280 -2.9320 -1.4080 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3280 -4.2400 -1.2080 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6280 -4.6880 0.0600 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5240 -3.8240 1.1360 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1240 -2.5160 0.9360 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5920 0.2640 -0.4520 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.1960 0.7400 -1.6000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.2960 1.5760 -1.5080 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.7880 1.9360 -0.2680 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.1840 1.4560 0.8800 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.0920 0.6160 0.7880 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.1680 2.9840 -0.1520 Cl 0 0 0 0 0 0 0 0 0 0 0 0
1.5080 -0.7680 2.2480 H 0 0 0 0 0 0 0 0 0 0 0 0
2.7160 -1.4080 1.1080 H 0 0 0 0 0 0 0 0 0 0 0 0
1.1000 -1.0480 -0.7600 H 0 0 0 0 0 0 0 0 0 0 0 0
0.4720 -2.1760 0.4640 H 0 0 0 0 0 0 0 0 0 0 0 0
0.3840 1.1360 -0.8680 H 0 0 0 0 0 0 0 0 0 0 0 0
-0.8200 1.7760 0.2720 H 0 0 0 0 0 0 0 0 0 0 0 0
1.4200 2.5440 0.9120 H 0 0 0 0 0 0 0 0 0 0 0 0
0.7920 1.4200 2.1400 H 0 0 0 0 0 0 0 0 0 0 0 0
3.4320 2.0920 1.9280 H 0 0 0 0 0 0 0 0 0 0 0 0
2.9320 0.7000 2.9160 H 0 0 0 0 0 0 0 0 0 0 0 0
5.3280 0.5280 2.4400 H 0 0 0 0 0 0 0 0 0 0 0 0
4.4640 -0.7520 1.5560 H 0 0 0 0 0 0 0 0 0 0 0 0
7.0720 0.3480 1.0040 H 0 0 0 0 0 0 0 0 0 0 0 0
6.2080 -0.9280 0.1160 H 0 0 0 0 0 0 0 0 0 0 0 0
8.5640 0.4280 -2.3560 H 0 0 0 0 0 0 0 0 0 0 0 0
-0.9480 -0.5440 -1.5400 H 0 0 0 0 0 0 0 0 0 0 0 0
-1.6960 -2.5840 -2.4040 H 0 0 0 0 0 0 0 0 0 0 0 0
-2.4080 -4.9160 -2.0480 H 0 0 0 0 0 0 0 0 0 0 0 0
-2.9400 -5.7080 0.2160 H 0 0 0 0 0 0 0 0 0 0 0 0
-2.7600 -4.1720 2.1320 H 0 0 0 0 0 0 0 0 0 0 0 0
-2.0440 -1.8400 1.7760 H 0 0 0 0 0 0 0 0 0 0 0 0
-2.8120 0.4640 -2.5680 H 0 0 0 0 0 0 0 0 0 0 0 0
-4.7680 1.9480 -2.4040 H 0 0 0 0 0 0 0 0 0 0 0 0
-4.5720 1.7360 1.8480 H 0 0 0 0 0 0 0 0 0 0 0 0
-2.6200 0.2440 1.6840 H 0 0 0 0 0 0 0 0 0 0 0 0
26 52 1 0
25 51 1 0
25 26 1 0
24 27 1 0
24 25 1 0
23 50 1 0
23 24 1 0
22 49 1 0
22 23 1 0
21 22 1 0
21 26 1 0
20 48 1 0
19 47 1 0
19 20 1 0
18 46 1 0
18 19 1 0
17 45 1 0
17 18 1 0
16 44 1 0
16 17 1 0
15 16 1 0
15 20 1 0
14 43 1 0
14 21 1 0
14 15 1 0
13 42 1 0
11 13 1 0
11 12 1 0
10 41 1 0
10 40 1 0
10 11 1 0
9 10 1 0
8 39 1 0
8 38 1 0
8 9 1 0
7 37 1 0
7 36 1 0
7 8 1 0
6 7 1 0
5 35 1 0
5 34 1 0
5 6 1 0
4 33 1 0
4 32 1 0
4 5 1 0
3 14 1 0
3 4 1 0
2 31 1 0
2 30 1 0
2 3 1 0
1 29 1 0
1 28 1 0
1 2 1 0
1 6 1 0
M END</inlineContents>
</jmolApplet>
</jmol>

<jmol>
<jmolApplet>
<title>Cetirizine 3d.MOL</title><color>black</color>
<size>200</size>
<script>zoom 80; cpk -25;frame 1; move 10 -20 10 0 0 0 0 0 3; delay 1;</script>
<uploadedFileContents>Cetirizine 3d.MOL</uploadedFileContents>
</jmolApplet>

<jmolMenu>
<item><text>Start spinning</text><script>spin on</script></item>
<item><text>Stop spinning</text><script>spin off</script></item>
<menuHeight>-1</menuHeight>
</jmolMenu>
<jmolButton>
<script>console</script>
<text>open a console window</text>
</jmolButton>
</jmol>

<jmol>
<jmolAppletButton>
<title>Show Citirizine in popup window</title>
<color>cyan</color>
<uploadedFileContents>Cetirizine 3d.MOL</uploadedFileContents>
</jmolAppletButton>
</jmol>

==General==
'''Cetirizine''', with the chemical name '''''(±) - [2- [4- [ (4-chlorophenyl)phenylmethyl] -1- piperazinyl] ethoxy]acetic acid dihydrochloride''''',a major matabolite of Hydroxyzine,which is an orally active and selective H1-receptor antagonist. The chemical structure is shown below:

[[Image:Cetirizine structure.gif|thumb|Image of Cyclophosphamide]]

This chemical compound is a white, crystalline powder and is water soluble, it is mainly used in medical treatment of allergies, hay fever, angioedema, and urticaria. ZYRTEC tablets(the active component of the chemical compound)are formulated as white, film-coated, rounded-off rectangular shaped tablets for oral administration and are available in 5 and 10 mg strengths.

==Synthesis==

'''(S)-cetirizine.2HCl''' is prepared via the diastereoselective organometallic addition to N-tert-butanesulfnyl adlimines (''scheme 1''). Organometallic reagent addition to imines is advantageous in that either enantiomeric forms of ceterizine (''structure 2'') can be produced by changing the imine/ organometallic partner; the imine of 4-chlorobenzaleldehyde (''structure 4'') with metallobenzene gives the opposite enantiomer to the reaction of benzaldehyde imine (''structure 3'') with the 4-chlorometallobenzene.

==Spectra==

NMR Spectral information showing a variation of chemical shifts against pD; these pD values are obtained when a correction of 0.4 were added to measured pH values[1]

<sup>1</sup>H-NMR spectra

[[Image:HNMR_cetirizine.JPG|HNMR_cetirizine.JPG]]

<sup>13</sup>C-NMR spectra for the <sup>13</sup>C nuclei in D<sub>2</sub> nuclei at 24.85 C and 200 MHz.

[[Image:CNMR_cetirizine.JPG|CNMR_cetirizine.JPG]]

==Pharmaceutical Usage==

'''DOSING''': Cetirizine should be taken at doses specifically directed by a physician, it can be taken with food.

'''DRUG INTERACTIONS''': Cetirizine should be taken only in doses prescribed. Increasing the dose can be dangerous. When taking cetirizine with theophylline the dose of theophylline may need to be reduced. Cetirizine occasionally can cause sleepiness . Cetirizine can be taken with erythromycin or ketaconazole without the increased risk of heart irregularities common to other non-sedating antihistamines. Cetirizine also can be used to treat children.
SIDE EFFECTS: Sleepiness occurs in 14% of patients. Dry mouth, nausea, headache, fatigue, jitteriness and sore throat are infrequently reported with cetirizine.
|-
==References==

</noinclude>{| class="toccolours" border="1" style="float: right; clear: right; margin: 0 0 1em 1em; border-collapse: collapse; width: 280px"
! {{chembox header}} | {{PAGENAME}} 
|-
! {{chembox header}} | General
|-
| [http://en.wikipedia.org/wiki/IUPAC Systematic name]
| (±) - [2- [4- [ (4-chlorophenyl)phenylmethyl] -1- piperazinyl] ethoxy]acetic acid dihydrochloride
|-
| [http://en.wikipedia.org/wiki/Chemical_formula Molecular formula]
| C21H25ClN2O3
|-
| [http://en.wikipedia.org/wiki/Chemical_file_format SMILES] 
| C1CN(CCN1CCOCC(=O)O)C(C2=CC=CC=C2)C3=CC=C(C=C3)Cl
|-
| [http://en.wikipedia.org/wiki/Molar_mass Molar mass]
| 461.82g/mol
|-
| [http://en.wikipedia.org/wiki/Percentage_composition Percentage composition]
| C 64.86%, H 6.48%, Cl 9.12%, N 7.20%, O 12.34%
|-
| Appearance
| White Crystalline powder, water soluble
|-
| [http://en.wikipedia.org/wiki/CAS_registry_number CAS number]
| 83881-51-0
|-
| [http://en.wikipedia.org/wiki/Synonyms]
| Alatrol, Cetirizina MERCK, Cetzine Glaxo, Cetirizin, Humex, Letizen, Razene, Reactine, Zyrtec, Zirtec, Zodac, Zirtek, Zynor, Zyrlek
|-
| [http://en.wikipedia.org/wiki/Boiling_point Boiling point]
|
|-
| [http://en.wikipedia.org/wiki/Melting_point Melting point]
|110-115°(for crystals from ethanol)
|-
| [http://en.wikipedia.org/wiki/Refractive_Index Refractive index]
|
|-
| [http://en.wikipedia.org/wiki/Bioavailability]
| Well absorbed
|-
|[http://en.wikipedia.org/wiki/Protein_Binding]
| 93% avg
|-
| [[Material safety data sheet|MSDS]]
| [[{{PAGENAME}} (data page)#Material Safety Data Sheet|External MSDS]] 
|-
| [[Risk and Safety Statements|R/S statement]]
| [[List of R-phrases|R]]: {{{R-S}}} <br /> [[List of S-phrases|S]]: ?
|-
! {{chembox header}} | [[{{PAGENAME}} (data page)|Supplementary data page]]
|-
| [[{{PAGENAME}} (data page)#Structure and properties|Structure and<br />properties]]
| [http://en.wikipedia.org/wiki/Refractive_index ''n''], [http://en.wikipedia.org/wiki/Dielectric_constant ε<sub>r</sub>], etc.
|-
| [[{{PAGENAME}} (data page)#Thermodynamic properties|Thermodynamic<br />data]]
| Phase behaviour<br />Solid, liquid, gas
|-

|-
! {{chembox header}} | Related compounds
|-
| Other [[Ion|anion]]s 
| {{{Other_anion}}} 
|-
| Other [[Ion|cation]]s 
| {{{Ohter_cation}}} 
|-
| Related compounds

| {{{Relative_Compounds}}}
|-
| {{chembox header}} | <small>Except where noted otherwise, data are given for<br /> materials in their [[standard state|standard state (at 25 °C, 100 kPa)]]<br />[[wikipedia:Chemical infobox|Infobox disclaimer and references]]</small>

Cetirizine

2007-11-14T14:07:04Z

Rqn06: 13CNMR uploaded

=Cetirizine=

<jmol>
<jmolApplet>
<size>200</size>
<color>black</color>
<script>zoom 80; cpk on;frame 1; move 10 -20 10 0 0 0 0 0 3; delay 1;</script>
<inlineContents>Cetirizine_3d.mol
title1
title2
52 54 0 0 1 V2000
1.8720 -0.7280 1.2200 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7520 -1.1400 0.2680 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.4120 -0.2680 0.4680 N 0 0 0 0 0 0 0 0 0 0 0 0
0.0200 1.0960 0.1560 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1400 1.5080 1.1120 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3040 0.6400 0.9120 N 0 0 0 0 0 0 0 0 0 0 0 0
3.2920 1.0120 1.9360 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6240 0.3240 1.6360 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1520 0.8200 0.4040 O 0 0 0 0 0 0 0 0 0 0 0 0
6.3880 0.1400 0.1800 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9960 0.6200 -1.1080 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4320 1.4600 -1.7720 O 0 0 0 0 0 0 0 0 0 0 0 0
8.1720 0.1200 -1.5280 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.3960 -0.6440 -0.5520 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.8320 -2.0680 -0.3360 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.9280 -2.9320 -1.4080 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3280 -4.2400 -1.2080 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6280 -4.6880 0.0600 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5240 -3.8240 1.1360 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1240 -2.5160 0.9360 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5920 0.2640 -0.4520 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.1960 0.7400 -1.6000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.2960 1.5760 -1.5080 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.7880 1.9360 -0.2680 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.1840 1.4560 0.8800 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.0920 0.6160 0.7880 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.1680 2.9840 -0.1520 Cl 0 0 0 0 0 0 0 0 0 0 0 0
1.5080 -0.7680 2.2480 H 0 0 0 0 0 0 0 0 0 0 0 0
2.7160 -1.4080 1.1080 H 0 0 0 0 0 0 0 0 0 0 0 0
1.1000 -1.0480 -0.7600 H 0 0 0 0 0 0 0 0 0 0 0 0
0.4720 -2.1760 0.4640 H 0 0 0 0 0 0 0 0 0 0 0 0
0.3840 1.1360 -0.8680 H 0 0 0 0 0 0 0 0 0 0 0 0
-0.8200 1.7760 0.2720 H 0 0 0 0 0 0 0 0 0 0 0 0
1.4200 2.5440 0.9120 H 0 0 0 0 0 0 0 0 0 0 0 0
0.7920 1.4200 2.1400 H 0 0 0 0 0 0 0 0 0 0 0 0
3.4320 2.0920 1.9280 H 0 0 0 0 0 0 0 0 0 0 0 0
2.9320 0.7000 2.9160 H 0 0 0 0 0 0 0 0 0 0 0 0
5.3280 0.5280 2.4400 H 0 0 0 0 0 0 0 0 0 0 0 0
4.4640 -0.7520 1.5560 H 0 0 0 0 0 0 0 0 0 0 0 0
7.0720 0.3480 1.0040 H 0 0 0 0 0 0 0 0 0 0 0 0
6.2080 -0.9280 0.1160 H 0 0 0 0 0 0 0 0 0 0 0 0
8.5640 0.4280 -2.3560 H 0 0 0 0 0 0 0 0 0 0 0 0
-0.9480 -0.5440 -1.5400 H 0 0 0 0 0 0 0 0 0 0 0 0
-1.6960 -2.5840 -2.4040 H 0 0 0 0 0 0 0 0 0 0 0 0
-2.4080 -4.9160 -2.0480 H 0 0 0 0 0 0 0 0 0 0 0 0
-2.9400 -5.7080 0.2160 H 0 0 0 0 0 0 0 0 0 0 0 0
-2.7600 -4.1720 2.1320 H 0 0 0 0 0 0 0 0 0 0 0 0
-2.0440 -1.8400 1.7760 H 0 0 0 0 0 0 0 0 0 0 0 0
-2.8120 0.4640 -2.5680 H 0 0 0 0 0 0 0 0 0 0 0 0
-4.7680 1.9480 -2.4040 H 0 0 0 0 0 0 0 0 0 0 0 0
-4.5720 1.7360 1.8480 H 0 0 0 0 0 0 0 0 0 0 0 0
-2.6200 0.2440 1.6840 H 0 0 0 0 0 0 0 0 0 0 0 0
26 52 1 0
25 51 1 0
25 26 1 0
24 27 1 0
24 25 1 0
23 50 1 0
23 24 1 0
22 49 1 0
22 23 1 0
21 22 1 0
21 26 1 0
20 48 1 0
19 47 1 0
19 20 1 0
18 46 1 0
18 19 1 0
17 45 1 0
17 18 1 0
16 44 1 0
16 17 1 0
15 16 1 0
15 20 1 0
14 43 1 0
14 21 1 0
14 15 1 0
13 42 1 0
11 13 1 0
11 12 1 0
10 41 1 0
10 40 1 0
10 11 1 0
9 10 1 0
8 39 1 0
8 38 1 0
8 9 1 0
7 37 1 0
7 36 1 0
7 8 1 0
6 7 1 0
5 35 1 0
5 34 1 0
5 6 1 0
4 33 1 0
4 32 1 0
4 5 1 0
3 14 1 0
3 4 1 0
2 31 1 0
2 30 1 0
2 3 1 0
1 29 1 0
1 28 1 0
1 2 1 0
1 6 1 0
M END</inlineContents>
</jmolApplet>
</jmol>

<jmol>
<jmolApplet>
<title>Cetirizine 3d.MOL</title><color>black</color>
<size>200</size>
<script>zoom 80; cpk -25;frame 1; move 10 -20 10 0 0 0 0 0 3; delay 1;</script>
<uploadedFileContents>Cetirizine 3d.MOL</uploadedFileContents>
</jmolApplet>

<jmolMenu>
<item><text>Start spinning</text><script>spin on</script></item>
<item><text>Stop spinning</text><script>spin off</script></item>
<menuHeight>-1</menuHeight>
</jmolMenu>
<jmolButton>
<script>console</script>
<text>open a console window</text>
</jmolButton>
</jmol>

<jmol>
<jmolAppletButton>
<title>Show Citirizine in popup window</title>
<color>cyan</color>
<uploadedFileContents>Cetirizine 3d.MOL</uploadedFileContents>
</jmolAppletButton>
</jmol>

==General==
'''Cetirizine''', with the chemical name '''''(±) - [2- [4- [ (4-chlorophenyl)phenylmethyl] -1- piperazinyl] ethoxy]acetic acid dihydrochloride''''',a major matabolite of Hydroxyzine,which is an orally active and selective H1-receptor antagonist. The chemical structure is shown below:

[[Image:Cetirizine structure.gif|thumb|Image of Cyclophosphamide]]

This chemical compound is a white, crystalline powder and is water soluble, it is mainly used in medical treatment of allergies, hay fever, angioedema, and urticaria. ZYRTEC tablets(the active component of the chemical compound)are formulated as white, film-coated, rounded-off rectangular shaped tablets for oral administration and are available in 5 and 10 mg strengths.

==Synthesis==

'''(S)-cetirizine.2HCl''' is prepared via the diastereoselective organometallic addition to N-tert-butanesulfnyl adlimines (''scheme 1''). Organometallic reagent addition to imines is advantageous in that either enantiomeric forms of ceterizine (''structure 2'') can be produced by changing the imine/ organometallic partner; the imine of 4-chlorobenzaleldehyde (''structure 4'') with metallobenzene gives the opposite enantiomer to the reaction of benzaldehyde imine (''structure 3'') with the 4-chlorometallobenzene.

==Spectra==

NMR Spectral information showing a variation of chemical shifts against pD; these pD values are obtained when a correction of 0.4 were added to measured pH values[1]

<sup>1</sup>H-NMR spectra

[[Image:HNMR_cetirizine.JPG|HNMR_cetirizine.JPG]]

<sup>13</sup>C-NMR spectra

[[Image:CNMR_cetirizine.JPG|CNMR_cetirizine.JPG]]

==Pharmaceutical Usage==

'''DOSING''': Cetirizine should be taken at doses specifically directed by a physician, it can be taken with food.

'''DRUG INTERACTIONS''': Cetirizine should be taken only in doses prescribed. Increasing the dose can be dangerous. When taking cetirizine with theophylline the dose of theophylline may need to be reduced. Cetirizine occasionally can cause sleepiness . Cetirizine can be taken with erythromycin or ketaconazole without the increased risk of heart irregularities common to other non-sedating antihistamines. Cetirizine also can be used to treat children.
SIDE EFFECTS: Sleepiness occurs in 14% of patients. Dry mouth, nausea, headache, fatigue, jitteriness and sore throat are infrequently reported with cetirizine.
|-
==References==

</noinclude>{| class="toccolours" border="1" style="float: right; clear: right; margin: 0 0 1em 1em; border-collapse: collapse; width: 280px"
! {{chembox header}} | {{PAGENAME}} 
|-
! {{chembox header}} | General
|-
| [http://en.wikipedia.org/wiki/IUPAC Systematic name]
| (±) - [2- [4- [ (4-chlorophenyl)phenylmethyl] -1- piperazinyl] ethoxy]acetic acid dihydrochloride
|-
| [http://en.wikipedia.org/wiki/Chemical_formula Molecular formula]
| C21H25ClN2O3
|-
| [http://en.wikipedia.org/wiki/Chemical_file_format SMILES] 
| C1CN(CCN1CCOCC(=O)O)C(C2=CC=CC=C2)C3=CC=C(C=C3)Cl
|-
| [http://en.wikipedia.org/wiki/Molar_mass Molar mass]
| 461.82g/mol
|-
| [http://en.wikipedia.org/wiki/Percentage_composition Percentage composition]
| C 64.86%, H 6.48%, Cl 9.12%, N 7.20%, O 12.34%
|-
| Appearance
| White Crystalline powder, water soluble
|-
| [http://en.wikipedia.org/wiki/CAS_registry_number CAS number]
| 83881-51-0
|-
| [http://en.wikipedia.org/wiki/Synonyms]
| Alatrol, Cetirizina MERCK, Cetzine Glaxo, Cetirizin, Humex, Letizen, Razene, Reactine, Zyrtec, Zirtec, Zodac, Zirtek, Zynor, Zyrlek
|-
| [http://en.wikipedia.org/wiki/Boiling_point Boiling point]
|
|-
| [http://en.wikipedia.org/wiki/Melting_point Melting point]
|110-115°(for crystals from ethanol)
|-
| [http://en.wikipedia.org/wiki/Refractive_Index Refractive index]
|
|-
| [http://en.wikipedia.org/wiki/Bioavailability]
| Well absorbed
|-
|[http://en.wikipedia.org/wiki/Protein_Binding]
| 93% avg
|-
| [[Material safety data sheet|MSDS]]
| [[{{PAGENAME}} (data page)#Material Safety Data Sheet|External MSDS]] 
|-
| [[Risk and Safety Statements|R/S statement]]
| [[List of R-phrases|R]]: {{{R-S}}} <br /> [[List of S-phrases|S]]: ?
|-
! {{chembox header}} | [[{{PAGENAME}} (data page)|Supplementary data page]]
|-
| [[{{PAGENAME}} (data page)#Structure and properties|Structure and<br />properties]]
| [http://en.wikipedia.org/wiki/Refractive_index ''n''], [http://en.wikipedia.org/wiki/Dielectric_constant ε<sub>r</sub>], etc.
|-
| [[{{PAGENAME}} (data page)#Thermodynamic properties|Thermodynamic<br />data]]
| Phase behaviour<br />Solid, liquid, gas
|-

|-
! {{chembox header}} | Related compounds
|-
| Other [[Ion|anion]]s 
| {{{Other_anion}}} 
|-
| Other [[Ion|cation]]s 
| {{{Ohter_cation}}} 
|-
| Related compounds

| {{{Relative_Compounds}}}
|-
| {{chembox header}} | <small>Except where noted otherwise, data are given for<br /> materials in their [[standard state|standard state (at 25 °C, 100 kPa)]]<br />[[wikipedia:Chemical infobox|Infobox disclaimer and references]]</small>

File:CNMR cetirizine.JPG

2007-11-14T14:00:50Z

Rqn06:

Cetirizine

2007-11-14T14:00:11Z

Rqn06: /* Spectra */

=Cetirizine=

<jmol>
<jmolApplet>
<size>200</size>
<color>black</color>
<script>zoom 80; cpk on;frame 1; move 10 -20 10 0 0 0 0 0 3; delay 1;</script>
<inlineContents>Cetirizine_3d.mol
title1
title2
52 54 0 0 1 V2000
1.8720 -0.7280 1.2200 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7520 -1.1400 0.2680 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.4120 -0.2680 0.4680 N 0 0 0 0 0 0 0 0 0 0 0 0
0.0200 1.0960 0.1560 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1400 1.5080 1.1120 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3040 0.6400 0.9120 N 0 0 0 0 0 0 0 0 0 0 0 0
3.2920 1.0120 1.9360 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6240 0.3240 1.6360 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1520 0.8200 0.4040 O 0 0 0 0 0 0 0 0 0 0 0 0
6.3880 0.1400 0.1800 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9960 0.6200 -1.1080 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4320 1.4600 -1.7720 O 0 0 0 0 0 0 0 0 0 0 0 0
8.1720 0.1200 -1.5280 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.3960 -0.6440 -0.5520 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.8320 -2.0680 -0.3360 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.9280 -2.9320 -1.4080 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3280 -4.2400 -1.2080 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6280 -4.6880 0.0600 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5240 -3.8240 1.1360 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1240 -2.5160 0.9360 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5920 0.2640 -0.4520 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.1960 0.7400 -1.6000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.2960 1.5760 -1.5080 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.7880 1.9360 -0.2680 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.1840 1.4560 0.8800 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.0920 0.6160 0.7880 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.1680 2.9840 -0.1520 Cl 0 0 0 0 0 0 0 0 0 0 0 0
1.5080 -0.7680 2.2480 H 0 0 0 0 0 0 0 0 0 0 0 0
2.7160 -1.4080 1.1080 H 0 0 0 0 0 0 0 0 0 0 0 0
1.1000 -1.0480 -0.7600 H 0 0 0 0 0 0 0 0 0 0 0 0
0.4720 -2.1760 0.4640 H 0 0 0 0 0 0 0 0 0 0 0 0
0.3840 1.1360 -0.8680 H 0 0 0 0 0 0 0 0 0 0 0 0
-0.8200 1.7760 0.2720 H 0 0 0 0 0 0 0 0 0 0 0 0
1.4200 2.5440 0.9120 H 0 0 0 0 0 0 0 0 0 0 0 0
0.7920 1.4200 2.1400 H 0 0 0 0 0 0 0 0 0 0 0 0
3.4320 2.0920 1.9280 H 0 0 0 0 0 0 0 0 0 0 0 0
2.9320 0.7000 2.9160 H 0 0 0 0 0 0 0 0 0 0 0 0
5.3280 0.5280 2.4400 H 0 0 0 0 0 0 0 0 0 0 0 0
4.4640 -0.7520 1.5560 H 0 0 0 0 0 0 0 0 0 0 0 0
7.0720 0.3480 1.0040 H 0 0 0 0 0 0 0 0 0 0 0 0
6.2080 -0.9280 0.1160 H 0 0 0 0 0 0 0 0 0 0 0 0
8.5640 0.4280 -2.3560 H 0 0 0 0 0 0 0 0 0 0 0 0
-0.9480 -0.5440 -1.5400 H 0 0 0 0 0 0 0 0 0 0 0 0
-1.6960 -2.5840 -2.4040 H 0 0 0 0 0 0 0 0 0 0 0 0
-2.4080 -4.9160 -2.0480 H 0 0 0 0 0 0 0 0 0 0 0 0
-2.9400 -5.7080 0.2160 H 0 0 0 0 0 0 0 0 0 0 0 0
-2.7600 -4.1720 2.1320 H 0 0 0 0 0 0 0 0 0 0 0 0
-2.0440 -1.8400 1.7760 H 0 0 0 0 0 0 0 0 0 0 0 0
-2.8120 0.4640 -2.5680 H 0 0 0 0 0 0 0 0 0 0 0 0
-4.7680 1.9480 -2.4040 H 0 0 0 0 0 0 0 0 0 0 0 0
-4.5720 1.7360 1.8480 H 0 0 0 0 0 0 0 0 0 0 0 0
-2.6200 0.2440 1.6840 H 0 0 0 0 0 0 0 0 0 0 0 0
26 52 1 0
25 51 1 0
25 26 1 0
24 27 1 0
24 25 1 0
23 50 1 0
23 24 1 0
22 49 1 0
22 23 1 0
21 22 1 0
21 26 1 0
20 48 1 0
19 47 1 0
19 20 1 0
18 46 1 0
18 19 1 0
17 45 1 0
17 18 1 0
16 44 1 0
16 17 1 0
15 16 1 0
15 20 1 0
14 43 1 0
14 21 1 0
14 15 1 0
13 42 1 0
11 13 1 0
11 12 1 0
10 41 1 0
10 40 1 0
10 11 1 0
9 10 1 0
8 39 1 0
8 38 1 0
8 9 1 0
7 37 1 0
7 36 1 0
7 8 1 0
6 7 1 0
5 35 1 0
5 34 1 0
5 6 1 0
4 33 1 0
4 32 1 0
4 5 1 0
3 14 1 0
3 4 1 0
2 31 1 0
2 30 1 0
2 3 1 0
1 29 1 0
1 28 1 0
1 2 1 0
1 6 1 0
M END</inlineContents>
</jmolApplet>
</jmol>

<jmol>
<jmolApplet>
<title>Cetirizine 3d.MOL</title><color>black</color>
<size>200</size>
<script>zoom 80; cpk -25;frame 1; move 10 -20 10 0 0 0 0 0 3; delay 1;</script>
<uploadedFileContents>Cetirizine 3d.MOL</uploadedFileContents>
</jmolApplet>

<jmolMenu>
<item><text>Start spinning</text><script>spin on</script></item>
<item><text>Stop spinning</text><script>spin off</script></item>
<menuHeight>-1</menuHeight>
</jmolMenu>
<jmolButton>
<script>console</script>
<text>open a console window</text>
</jmolButton>
</jmol>

<jmol>
<jmolAppletButton>
<title>Show Citirizine in popup window</title>
<color>cyan</color>
<uploadedFileContents>Cetirizine 3d.MOL</uploadedFileContents>
</jmolAppletButton>
</jmol>

==General==
'''Cetirizine''', with the chemical name '''''(±) - [2- [4- [ (4-chlorophenyl)phenylmethyl] -1- piperazinyl] ethoxy]acetic acid dihydrochloride''''',a major matabolite of Hydroxyzine,which is an orally active and selective H1-receptor antagonist. The chemical structure is shown below:

[[Image:Cetirizine structure.gif|thumb|Image of Cyclophosphamide]]

This chemical compound is a white, crystalline powder and is water soluble, it is mainly used in medical treatment of allergies, hay fever, angioedema, and urticaria. ZYRTEC tablets(the active component of the chemical compound)are formulated as white, film-coated, rounded-off rectangular shaped tablets for oral administration and are available in 5 and 10 mg strengths.

==Synthesis==

'''(S)-cetirizine.2HCl''' is prepared via the diastereoselective organometallic addition to N-tert-butanesulfnyl adlimines (''scheme 1''). Organometallic reagent addition to imines is advantageous in that either enantiomeric forms of ceterizine (''structure 2'') can be produced by changing the imine/ organometallic partner; the imine of 4-chlorobenzaleldehyde (''structure 4'') with metallobenzene gives the opposite enantiomer to the reaction of benzaldehyde imine (''structure 3'') with the 4-chlorometallobenzene.

==Spectra==

[[Image:HNMR_cetirizine.JPG|Description| Variation of chemical shifts against pD; pD values were obtained when a correction of 0.4 were added to measured pH values[1]]]

==Pharmaceutical Usage==

'''DOSING''': Cetirizine should be taken at doses specifically directed by a physician, it can be taken with food.

'''DRUG INTERACTIONS''': Cetirizine should be taken only in doses prescribed. Increasing the dose can be dangerous. When taking cetirizine with theophylline the dose of theophylline may need to be reduced. Cetirizine occasionally can cause sleepiness . Cetirizine can be taken with erythromycin or ketaconazole without the increased risk of heart irregularities common to other non-sedating antihistamines. Cetirizine also can be used to treat children.
SIDE EFFECTS: Sleepiness occurs in 14% of patients. Dry mouth, nausea, headache, fatigue, jitteriness and sore throat are infrequently reported with cetirizine.
|-
==References==

</noinclude>{| class="toccolours" border="1" style="float: right; clear: right; margin: 0 0 1em 1em; border-collapse: collapse; width: 280px"
! {{chembox header}} | {{PAGENAME}} 
|-
! {{chembox header}} | General
|-
| [http://en.wikipedia.org/wiki/IUPAC Systematic name]
| (±) - [2- [4- [ (4-chlorophenyl)phenylmethyl] -1- piperazinyl] ethoxy]acetic acid dihydrochloride
|-
| [http://en.wikipedia.org/wiki/Chemical_formula Molecular formula]
| C21H25ClN2O3
|-
| [http://en.wikipedia.org/wiki/Chemical_file_format SMILES] 
| C1CN(CCN1CCOCC(=O)O)C(C2=CC=CC=C2)C3=CC=C(C=C3)Cl
|-
| [http://en.wikipedia.org/wiki/Molar_mass Molar mass]
| 461.82g/mol
|-
| [http://en.wikipedia.org/wiki/Percentage_composition Percentage composition]
| C 64.86%, H 6.48%, Cl 9.12%, N 7.20%, O 12.34%
|-
| Appearance
| White Crystalline powder, water soluble
|-
| [http://en.wikipedia.org/wiki/CAS_registry_number CAS number]
| 83881-51-0
|-
| [http://en.wikipedia.org/wiki/Synonyms]
| Alatrol, Cetirizina MERCK, Cetzine Glaxo, Cetirizin, Humex, Letizen, Razene, Reactine, Zyrtec, Zirtec, Zodac, Zirtek, Zynor, Zyrlek
|-
| [http://en.wikipedia.org/wiki/Boiling_point Boiling point]
|
|-
| [http://en.wikipedia.org/wiki/Melting_point Melting point]
|110-115°(for crystals from ethanol)
|-
| [http://en.wikipedia.org/wiki/Refractive_Index Refractive index]
|
|-
| [http://en.wikipedia.org/wiki/Bioavailability]
| Well absorbed
|-
|[http://en.wikipedia.org/wiki/Protein_Binding]
| 93% avg
|-
| [[Material safety data sheet|MSDS]]
| [[{{PAGENAME}} (data page)#Material Safety Data Sheet|External MSDS]] 
|-
| [[Risk and Safety Statements|R/S statement]]
| [[List of R-phrases|R]]: {{{R-S}}} <br /> [[List of S-phrases|S]]: ?
|-
! {{chembox header}} | [[{{PAGENAME}} (data page)|Supplementary data page]]
|-
| [[{{PAGENAME}} (data page)#Structure and properties|Structure and<br />properties]]
| [http://en.wikipedia.org/wiki/Refractive_index ''n''], [http://en.wikipedia.org/wiki/Dielectric_constant ε<sub>r</sub>], etc.
|-
| [[{{PAGENAME}} (data page)#Thermodynamic properties|Thermodynamic<br />data]]
| Phase behaviour<br />Solid, liquid, gas
|-

|-
! {{chembox header}} | Related compounds
|-
| Other [[Ion|anion]]s 
| {{{Other_anion}}} 
|-
| Other [[Ion|cation]]s 
| {{{Ohter_cation}}} 
|-
| Related compounds

| {{{Relative_Compounds}}}
|-
| {{chembox header}} | <small>Except where noted otherwise, data are given for<br /> materials in their [[standard state|standard state (at 25 °C, 100 kPa)]]<br />[[wikipedia:Chemical infobox|Infobox disclaimer and references]]</small>

Cetirizine

2007-11-14T13:51:29Z

Rqn06: HNMR description

=Cetirizine=

<jmol>
<jmolApplet>
<size>200</size>
<color>black</color>
<script>zoom 80; cpk on;frame 1; move 10 -20 10 0 0 0 0 0 3; delay 1;</script>
<inlineContents>Cetirizine_3d.mol
title1
title2
52 54 0 0 1 V2000
1.8720 -0.7280 1.2200 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7520 -1.1400 0.2680 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.4120 -0.2680 0.4680 N 0 0 0 0 0 0 0 0 0 0 0 0
0.0200 1.0960 0.1560 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1400 1.5080 1.1120 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3040 0.6400 0.9120 N 0 0 0 0 0 0 0 0 0 0 0 0
3.2920 1.0120 1.9360 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6240 0.3240 1.6360 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1520 0.8200 0.4040 O 0 0 0 0 0 0 0 0 0 0 0 0
6.3880 0.1400 0.1800 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9960 0.6200 -1.1080 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4320 1.4600 -1.7720 O 0 0 0 0 0 0 0 0 0 0 0 0
8.1720 0.1200 -1.5280 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.3960 -0.6440 -0.5520 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.8320 -2.0680 -0.3360 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.9280 -2.9320 -1.4080 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3280 -4.2400 -1.2080 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6280 -4.6880 0.0600 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5240 -3.8240 1.1360 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1240 -2.5160 0.9360 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5920 0.2640 -0.4520 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.1960 0.7400 -1.6000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.2960 1.5760 -1.5080 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.7880 1.9360 -0.2680 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.1840 1.4560 0.8800 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.0920 0.6160 0.7880 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.1680 2.9840 -0.1520 Cl 0 0 0 0 0 0 0 0 0 0 0 0
1.5080 -0.7680 2.2480 H 0 0 0 0 0 0 0 0 0 0 0 0
2.7160 -1.4080 1.1080 H 0 0 0 0 0 0 0 0 0 0 0 0
1.1000 -1.0480 -0.7600 H 0 0 0 0 0 0 0 0 0 0 0 0
0.4720 -2.1760 0.4640 H 0 0 0 0 0 0 0 0 0 0 0 0
0.3840 1.1360 -0.8680 H 0 0 0 0 0 0 0 0 0 0 0 0
-0.8200 1.7760 0.2720 H 0 0 0 0 0 0 0 0 0 0 0 0
1.4200 2.5440 0.9120 H 0 0 0 0 0 0 0 0 0 0 0 0
0.7920 1.4200 2.1400 H 0 0 0 0 0 0 0 0 0 0 0 0
3.4320 2.0920 1.9280 H 0 0 0 0 0 0 0 0 0 0 0 0
2.9320 0.7000 2.9160 H 0 0 0 0 0 0 0 0 0 0 0 0
5.3280 0.5280 2.4400 H 0 0 0 0 0 0 0 0 0 0 0 0
4.4640 -0.7520 1.5560 H 0 0 0 0 0 0 0 0 0 0 0 0
7.0720 0.3480 1.0040 H 0 0 0 0 0 0 0 0 0 0 0 0
6.2080 -0.9280 0.1160 H 0 0 0 0 0 0 0 0 0 0 0 0
8.5640 0.4280 -2.3560 H 0 0 0 0 0 0 0 0 0 0 0 0
-0.9480 -0.5440 -1.5400 H 0 0 0 0 0 0 0 0 0 0 0 0
-1.6960 -2.5840 -2.4040 H 0 0 0 0 0 0 0 0 0 0 0 0
-2.4080 -4.9160 -2.0480 H 0 0 0 0 0 0 0 0 0 0 0 0
-2.9400 -5.7080 0.2160 H 0 0 0 0 0 0 0 0 0 0 0 0
-2.7600 -4.1720 2.1320 H 0 0 0 0 0 0 0 0 0 0 0 0
-2.0440 -1.8400 1.7760 H 0 0 0 0 0 0 0 0 0 0 0 0
-2.8120 0.4640 -2.5680 H 0 0 0 0 0 0 0 0 0 0 0 0
-4.7680 1.9480 -2.4040 H 0 0 0 0 0 0 0 0 0 0 0 0
-4.5720 1.7360 1.8480 H 0 0 0 0 0 0 0 0 0 0 0 0
-2.6200 0.2440 1.6840 H 0 0 0 0 0 0 0 0 0 0 0 0
26 52 1 0
25 51 1 0
25 26 1 0
24 27 1 0
24 25 1 0
23 50 1 0
23 24 1 0
22 49 1 0
22 23 1 0
21 22 1 0
21 26 1 0
20 48 1 0
19 47 1 0
19 20 1 0
18 46 1 0
18 19 1 0
17 45 1 0
17 18 1 0
16 44 1 0
16 17 1 0
15 16 1 0
15 20 1 0
14 43 1 0
14 21 1 0
14 15 1 0
13 42 1 0
11 13 1 0
11 12 1 0
10 41 1 0
10 40 1 0
10 11 1 0
9 10 1 0
8 39 1 0
8 38 1 0
8 9 1 0
7 37 1 0
7 36 1 0
7 8 1 0
6 7 1 0
5 35 1 0
5 34 1 0
5 6 1 0
4 33 1 0
4 32 1 0
4 5 1 0
3 14 1 0
3 4 1 0
2 31 1 0
2 30 1 0
2 3 1 0
1 29 1 0
1 28 1 0
1 2 1 0
1 6 1 0
M END</inlineContents>
</jmolApplet>
</jmol>

<jmol>
<jmolApplet>
<title>Cetirizine 3d.MOL</title><color>black</color>
<size>200</size>
<script>zoom 80; cpk -25;frame 1; move 10 -20 10 0 0 0 0 0 3; delay 1;</script>
<uploadedFileContents>Cetirizine 3d.MOL</uploadedFileContents>
</jmolApplet>

<jmolMenu>
<item><text>Start spinning</text><script>spin on</script></item>
<item><text>Stop spinning</text><script>spin off</script></item>
<menuHeight>-1</menuHeight>
</jmolMenu>
<jmolButton>
<script>console</script>
<text>open a console window</text>
</jmolButton>
</jmol>

<jmol>
<jmolAppletButton>
<title>Show Citirizine in popup window</title>
<color>cyan</color>
<uploadedFileContents>Cetirizine 3d.MOL</uploadedFileContents>
</jmolAppletButton>
</jmol>

==General==
'''Cetirizine''', with the chemical name '''''(±) - [2- [4- [ (4-chlorophenyl)phenylmethyl] -1- piperazinyl] ethoxy]acetic acid dihydrochloride''''',a major matabolite of Hydroxyzine,which is an orally active and selective H1-receptor antagonist. The chemical structure is shown below:

[[Image:Cetirizine structure.gif|thumb|Image of Cyclophosphamide]]

This chemical compound is a white, crystalline powder and is water soluble, it is mainly used in medical treatment of allergies, hay fever, angioedema, and urticaria. ZYRTEC tablets(the active component of the chemical compound)are formulated as white, film-coated, rounded-off rectangular shaped tablets for oral administration and are available in 5 and 10 mg strengths.

==Synthesis==

'''(S)-cetirizine.2HCl''' is prepared via the diastereoselective organometallic addition to N-tert-butanesulfnyl adlimines (''scheme 1''). Organometallic reagent addition to imines is advantageous in that either enantiomeric forms of ceterizine (''structure 2'') can be produced by changing the imine/ organometallic partner; the imine of 4-chlorobenzaleldehyde (''structure 4'') with metallobenzene gives the opposite enantiomer to the reaction of benzaldehyde imine (''structure 3'') with the 4-chlorometallobenzene.

==Spectra==
[[Image:HNMR_cetirizine.JPG|Variation of chemical shifts against pD; pD values were obtained when a correction of 0.4 were added to measured pH values[1])]]

==Pharmaceutical Usage==

'''DOSING''': Cetirizine should be taken at doses specifically directed by a physician, it can be taken with food.

'''DRUG INTERACTIONS''': Cetirizine should be taken only in doses prescribed. Increasing the dose can be dangerous. When taking cetirizine with theophylline the dose of theophylline may need to be reduced. Cetirizine occasionally can cause sleepiness . Cetirizine can be taken with erythromycin or ketaconazole without the increased risk of heart irregularities common to other non-sedating antihistamines. Cetirizine also can be used to treat children.
SIDE EFFECTS: Sleepiness occurs in 14% of patients. Dry mouth, nausea, headache, fatigue, jitteriness and sore throat are infrequently reported with cetirizine.
|-
==References==

</noinclude>{| class="toccolours" border="1" style="float: right; clear: right; margin: 0 0 1em 1em; border-collapse: collapse; width: 280px"
! {{chembox header}} | {{PAGENAME}} 
|-
! {{chembox header}} | General
|-
| [http://en.wikipedia.org/wiki/IUPAC Systematic name]
| (±) - [2- [4- [ (4-chlorophenyl)phenylmethyl] -1- piperazinyl] ethoxy]acetic acid dihydrochloride
|-
| [http://en.wikipedia.org/wiki/Chemical_formula Molecular formula]
| C21H25ClN2O3
|-
| [http://en.wikipedia.org/wiki/Chemical_file_format SMILES] 
| C1CN(CCN1CCOCC(=O)O)C(C2=CC=CC=C2)C3=CC=C(C=C3)Cl
|-
| [http://en.wikipedia.org/wiki/Molar_mass Molar mass]
| 461.82g/mol
|-
| [http://en.wikipedia.org/wiki/Percentage_composition Percentage composition]
| C 64.86%, H 6.48%, Cl 9.12%, N 7.20%, O 12.34%
|-
| Appearance
| White Crystalline powder, water soluble
|-
| [http://en.wikipedia.org/wiki/CAS_registry_number CAS number]
| 83881-51-0
|-
| [http://en.wikipedia.org/wiki/Synonyms]
| Alatrol, Cetirizina MERCK, Cetzine Glaxo, Cetirizin, Humex, Letizen, Razene, Reactine, Zyrtec, Zirtec, Zodac, Zirtek, Zynor, Zyrlek
|-
| [http://en.wikipedia.org/wiki/Boiling_point Boiling point]
|
|-
| [http://en.wikipedia.org/wiki/Melting_point Melting point]
|110-115°(for crystals from ethanol)
|-
| [http://en.wikipedia.org/wiki/Refractive_Index Refractive index]
|
|-
| [http://en.wikipedia.org/wiki/Bioavailability]
| Well absorbed
|-
|[http://en.wikipedia.org/wiki/Protein_Binding]
| 93% avg
|-
| [[Material safety data sheet|MSDS]]
| [[{{PAGENAME}} (data page)#Material Safety Data Sheet|External MSDS]] 
|-
| [[Risk and Safety Statements|R/S statement]]
| [[List of R-phrases|R]]: {{{R-S}}} <br /> [[List of S-phrases|S]]: ?
|-
! {{chembox header}} | [[{{PAGENAME}} (data page)|Supplementary data page]]
|-
| [[{{PAGENAME}} (data page)#Structure and properties|Structure and<br />properties]]
| [http://en.wikipedia.org/wiki/Refractive_index ''n''], [http://en.wikipedia.org/wiki/Dielectric_constant ε<sub>r</sub>], etc.
|-
| [[{{PAGENAME}} (data page)#Thermodynamic properties|Thermodynamic<br />data]]
| Phase behaviour<br />Solid, liquid, gas
|-

|-
! {{chembox header}} | Related compounds
|-
| Other [[Ion|anion]]s 
| {{{Other_anion}}} 
|-
| Other [[Ion|cation]]s 
| {{{Ohter_cation}}} 
|-
| Related compounds

| {{{Relative_Compounds}}}
|-
| {{chembox header}} | <small>Except where noted otherwise, data are given for<br /> materials in their [[standard state|standard state (at 25 °C, 100 kPa)]]<br />[[wikipedia:Chemical infobox|Infobox disclaimer and references]]</small>

Cetirizine

2007-11-14T13:38:03Z

Rqn06:

=Cetirizine=

<jmol>
<jmolApplet>
<size>200</size>
<color>black</color>
<script>zoom 80; cpk on;frame 1; move 10 -20 10 0 0 0 0 0 3; delay 1;</script>
<inlineContents>Cetirizine_3d.mol
title1
title2
52 54 0 0 1 V2000
1.8720 -0.7280 1.2200 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7520 -1.1400 0.2680 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.4120 -0.2680 0.4680 N 0 0 0 0 0 0 0 0 0 0 0 0
0.0200 1.0960 0.1560 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1400 1.5080 1.1120 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3040 0.6400 0.9120 N 0 0 0 0 0 0 0 0 0 0 0 0
3.2920 1.0120 1.9360 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6240 0.3240 1.6360 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1520 0.8200 0.4040 O 0 0 0 0 0 0 0 0 0 0 0 0
6.3880 0.1400 0.1800 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9960 0.6200 -1.1080 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4320 1.4600 -1.7720 O 0 0 0 0 0 0 0 0 0 0 0 0
8.1720 0.1200 -1.5280 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.3960 -0.6440 -0.5520 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.8320 -2.0680 -0.3360 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.9280 -2.9320 -1.4080 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3280 -4.2400 -1.2080 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6280 -4.6880 0.0600 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5240 -3.8240 1.1360 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1240 -2.5160 0.9360 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5920 0.2640 -0.4520 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.1960 0.7400 -1.6000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.2960 1.5760 -1.5080 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.7880 1.9360 -0.2680 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.1840 1.4560 0.8800 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.0920 0.6160 0.7880 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.1680 2.9840 -0.1520 Cl 0 0 0 0 0 0 0 0 0 0 0 0
1.5080 -0.7680 2.2480 H 0 0 0 0 0 0 0 0 0 0 0 0
2.7160 -1.4080 1.1080 H 0 0 0 0 0 0 0 0 0 0 0 0
1.1000 -1.0480 -0.7600 H 0 0 0 0 0 0 0 0 0 0 0 0
0.4720 -2.1760 0.4640 H 0 0 0 0 0 0 0 0 0 0 0 0
0.3840 1.1360 -0.8680 H 0 0 0 0 0 0 0 0 0 0 0 0
-0.8200 1.7760 0.2720 H 0 0 0 0 0 0 0 0 0 0 0 0
1.4200 2.5440 0.9120 H 0 0 0 0 0 0 0 0 0 0 0 0
0.7920 1.4200 2.1400 H 0 0 0 0 0 0 0 0 0 0 0 0
3.4320 2.0920 1.9280 H 0 0 0 0 0 0 0 0 0 0 0 0
2.9320 0.7000 2.9160 H 0 0 0 0 0 0 0 0 0 0 0 0
5.3280 0.5280 2.4400 H 0 0 0 0 0 0 0 0 0 0 0 0
4.4640 -0.7520 1.5560 H 0 0 0 0 0 0 0 0 0 0 0 0
7.0720 0.3480 1.0040 H 0 0 0 0 0 0 0 0 0 0 0 0
6.2080 -0.9280 0.1160 H 0 0 0 0 0 0 0 0 0 0 0 0
8.5640 0.4280 -2.3560 H 0 0 0 0 0 0 0 0 0 0 0 0
-0.9480 -0.5440 -1.5400 H 0 0 0 0 0 0 0 0 0 0 0 0
-1.6960 -2.5840 -2.4040 H 0 0 0 0 0 0 0 0 0 0 0 0
-2.4080 -4.9160 -2.0480 H 0 0 0 0 0 0 0 0 0 0 0 0
-2.9400 -5.7080 0.2160 H 0 0 0 0 0 0 0 0 0 0 0 0
-2.7600 -4.1720 2.1320 H 0 0 0 0 0 0 0 0 0 0 0 0
-2.0440 -1.8400 1.7760 H 0 0 0 0 0 0 0 0 0 0 0 0
-2.8120 0.4640 -2.5680 H 0 0 0 0 0 0 0 0 0 0 0 0
-4.7680 1.9480 -2.4040 H 0 0 0 0 0 0 0 0 0 0 0 0
-4.5720 1.7360 1.8480 H 0 0 0 0 0 0 0 0 0 0 0 0
-2.6200 0.2440 1.6840 H 0 0 0 0 0 0 0 0 0 0 0 0
26 52 1 0
25 51 1 0
25 26 1 0
24 27 1 0
24 25 1 0
23 50 1 0
23 24 1 0
22 49 1 0
22 23 1 0
21 22 1 0
21 26 1 0
20 48 1 0
19 47 1 0
19 20 1 0
18 46 1 0
18 19 1 0
17 45 1 0
17 18 1 0
16 44 1 0
16 17 1 0
15 16 1 0
15 20 1 0
14 43 1 0
14 21 1 0
14 15 1 0
13 42 1 0
11 13 1 0
11 12 1 0
10 41 1 0
10 40 1 0
10 11 1 0
9 10 1 0
8 39 1 0
8 38 1 0
8 9 1 0
7 37 1 0
7 36 1 0
7 8 1 0
6 7 1 0
5 35 1 0
5 34 1 0
5 6 1 0
4 33 1 0
4 32 1 0
4 5 1 0
3 14 1 0
3 4 1 0
2 31 1 0
2 30 1 0
2 3 1 0
1 29 1 0
1 28 1 0
1 2 1 0
1 6 1 0
M END</inlineContents>
</jmolApplet>
</jmol>

<jmol>
<jmolApplet>
<title>Cetirizine 3d.MOL</title><color>black</color>
<size>200</size>
<script>zoom 80; cpk -25;frame 1; move 10 -20 10 0 0 0 0 0 3; delay 1;</script>
<uploadedFileContents>Cetirizine 3d.MOL</uploadedFileContents>
</jmolApplet>

<jmolMenu>
<item><text>Start spinning</text><script>spin on</script></item>
<item><text>Stop spinning</text><script>spin off</script></item>
<menuHeight>-1</menuHeight>
</jmolMenu>
<jmolButton>
<script>console</script>
<text>open a console window</text>
</jmolButton>
</jmol>

<jmol>
<jmolAppletButton>
<title>Show Citirizine in popup window</title>
<color>cyan</color>
<uploadedFileContents>Cetirizine 3d.MOL</uploadedFileContents>
</jmolAppletButton>
</jmol>

==General==
'''Cetirizine''', with the chemical name '''''(±) - [2- [4- [ (4-chlorophenyl)phenylmethyl] -1- piperazinyl] ethoxy]acetic acid dihydrochloride''''',a major matabolite of Hydroxyzine,which is an orally active and selective H1-receptor antagonist. The chemical structure is shown below:

[[Image:Cetirizine structure.gif|thumb|Image of Cyclophosphamide]]

This chemical compound is a white, crystalline powder and is water soluble, it is mainly used in medical treatment of allergies, hay fever, angioedema, and urticaria. ZYRTEC tablets(the active component of the chemical compound)are formulated as white, film-coated, rounded-off rectangular shaped tablets for oral administration and are available in 5 and 10 mg strengths.

==Synthesis==

'''(S)-cetirizine.2HCl''' is prepared via the diastereoselective organometallic addition to N-tert-butanesulfnyl adlimines (''scheme 1''). Organometallic reagent addition to imines is advantageous in that either enantiomeric forms of ceterizine (''structure 2'') can be produced by changing the imine/ organometallic partner; the imine of 4-chlorobenzaleldehyde (''structure 4'') with metallobenzene gives the opposite enantiomer to the reaction of benzaldehyde imine (''structure 3'') with the 4-chlorometallobenzene.

==Spectra==
[[Image:HNMR_cetirizine.JPG|Description]]

==Pharmaceutical Usage==

'''DOSING''': Cetirizine should be taken at doses specifically directed by a physician, it can be taken with food.

'''DRUG INTERACTIONS''': Cetirizine should be taken only in doses prescribed. Increasing the dose can be dangerous. When taking cetirizine with theophylline the dose of theophylline may need to be reduced. Cetirizine occasionally can cause sleepiness . Cetirizine can be taken with erythromycin or ketaconazole without the increased risk of heart irregularities common to other non-sedating antihistamines. Cetirizine also can be used to treat children.
SIDE EFFECTS: Sleepiness occurs in 14% of patients. Dry mouth, nausea, headache, fatigue, jitteriness and sore throat are infrequently reported with cetirizine.
|-
==References==

</noinclude>{| class="toccolours" border="1" style="float: right; clear: right; margin: 0 0 1em 1em; border-collapse: collapse; width: 280px"
! {{chembox header}} | {{PAGENAME}} 
|-
! {{chembox header}} | General
|-
| [http://en.wikipedia.org/wiki/IUPAC Systematic name]
| (±) - [2- [4- [ (4-chlorophenyl)phenylmethyl] -1- piperazinyl] ethoxy]acetic acid dihydrochloride
|-
| [http://en.wikipedia.org/wiki/Chemical_formula Molecular formula]
| C21H25ClN2O3
|-
| [http://en.wikipedia.org/wiki/Chemical_file_format SMILES] 
| C1CN(CCN1CCOCC(=O)O)C(C2=CC=CC=C2)C3=CC=C(C=C3)Cl
|-
| [http://en.wikipedia.org/wiki/Molar_mass Molar mass]
| 461.82g/mol
|-
| [http://en.wikipedia.org/wiki/Percentage_composition Percentage composition]
| C 64.86%, H 6.48%, Cl 9.12%, N 7.20%, O 12.34%
|-
| Appearance
| White Crystalline powder, water soluble
|-
| [http://en.wikipedia.org/wiki/CAS_registry_number CAS number]
| 83881-51-0
|-
| [http://en.wikipedia.org/wiki/Synonyms]
| Alatrol, Cetirizina MERCK, Cetzine Glaxo, Cetirizin, Humex, Letizen, Razene, Reactine, Zyrtec, Zirtec, Zodac, Zirtek, Zynor, Zyrlek
|-
| [http://en.wikipedia.org/wiki/Boiling_point Boiling point]
|
|-
| [http://en.wikipedia.org/wiki/Melting_point Melting point]
|110-115°(for crystals from ethanol)
|-
| [http://en.wikipedia.org/wiki/Refractive_Index Refractive index]
|
|-
| [http://en.wikipedia.org/wiki/Bioavailability]
| Well absorbed
|-
|[http://en.wikipedia.org/wiki/Protein_Binding]
| 93% avg
|-
| [[Material safety data sheet|MSDS]]
| [[{{PAGENAME}} (data page)#Material Safety Data Sheet|External MSDS]] 
|-
| [[Risk and Safety Statements|R/S statement]]
| [[List of R-phrases|R]]: {{{R-S}}} <br /> [[List of S-phrases|S]]: ?
|-
! {{chembox header}} | [[{{PAGENAME}} (data page)|Supplementary data page]]
|-
| [[{{PAGENAME}} (data page)#Structure and properties|Structure and<br />properties]]
| [http://en.wikipedia.org/wiki/Refractive_index ''n''], [http://en.wikipedia.org/wiki/Dielectric_constant ε<sub>r</sub>], etc.
|-
| [[{{PAGENAME}} (data page)#Thermodynamic properties|Thermodynamic<br />data]]
| Phase behaviour<br />Solid, liquid, gas
|-

|-
! {{chembox header}} | Related compounds
|-
| Other [[Ion|anion]]s 
| {{{Other_anion}}} 
|-
| Other [[Ion|cation]]s 
| {{{Ohter_cation}}} 
|-
| Related compounds

| {{{Relative_Compounds}}}
|-
| {{chembox header}} | <small>Except where noted otherwise, data are given for<br /> materials in their [[standard state|standard state (at 25 °C, 100 kPa)]]<br />[[wikipedia:Chemical infobox|Infobox disclaimer and references]]</small>

Cetirizine

2007-11-14T13:37:21Z

Rqn06: HNMR_cetirizine spectra uploaded

=Cetirizine=

<jmol>
<jmolApplet>
<size>200</size>
<color>black</color>
<script>zoom 80; cpk on;frame 1; move 10 -20 10 0 0 0 0 0 3; delay 1;</script>
<inlineContents>Cetirizine_3d.mol
title1
title2
52 54 0 0 1 V2000
1.8720 -0.7280 1.2200 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7520 -1.1400 0.2680 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.4120 -0.2680 0.4680 N 0 0 0 0 0 0 0 0 0 0 0 0
0.0200 1.0960 0.1560 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1400 1.5080 1.1120 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3040 0.6400 0.9120 N 0 0 0 0 0 0 0 0 0 0 0 0
3.2920 1.0120 1.9360 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6240 0.3240 1.6360 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1520 0.8200 0.4040 O 0 0 0 0 0 0 0 0 0 0 0 0
6.3880 0.1400 0.1800 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9960 0.6200 -1.1080 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4320 1.4600 -1.7720 O 0 0 0 0 0 0 0 0 0 0 0 0
8.1720 0.1200 -1.5280 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.3960 -0.6440 -0.5520 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.8320 -2.0680 -0.3360 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.9280 -2.9320 -1.4080 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3280 -4.2400 -1.2080 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6280 -4.6880 0.0600 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5240 -3.8240 1.1360 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1240 -2.5160 0.9360 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5920 0.2640 -0.4520 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.1960 0.7400 -1.6000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.2960 1.5760 -1.5080 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.7880 1.9360 -0.2680 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.1840 1.4560 0.8800 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.0920 0.6160 0.7880 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.1680 2.9840 -0.1520 Cl 0 0 0 0 0 0 0 0 0 0 0 0
1.5080 -0.7680 2.2480 H 0 0 0 0 0 0 0 0 0 0 0 0
2.7160 -1.4080 1.1080 H 0 0 0 0 0 0 0 0 0 0 0 0
1.1000 -1.0480 -0.7600 H 0 0 0 0 0 0 0 0 0 0 0 0
0.4720 -2.1760 0.4640 H 0 0 0 0 0 0 0 0 0 0 0 0
0.3840 1.1360 -0.8680 H 0 0 0 0 0 0 0 0 0 0 0 0
-0.8200 1.7760 0.2720 H 0 0 0 0 0 0 0 0 0 0 0 0
1.4200 2.5440 0.9120 H 0 0 0 0 0 0 0 0 0 0 0 0
0.7920 1.4200 2.1400 H 0 0 0 0 0 0 0 0 0 0 0 0
3.4320 2.0920 1.9280 H 0 0 0 0 0 0 0 0 0 0 0 0
2.9320 0.7000 2.9160 H 0 0 0 0 0 0 0 0 0 0 0 0
5.3280 0.5280 2.4400 H 0 0 0 0 0 0 0 0 0 0 0 0
4.4640 -0.7520 1.5560 H 0 0 0 0 0 0 0 0 0 0 0 0
7.0720 0.3480 1.0040 H 0 0 0 0 0 0 0 0 0 0 0 0
6.2080 -0.9280 0.1160 H 0 0 0 0 0 0 0 0 0 0 0 0
8.5640 0.4280 -2.3560 H 0 0 0 0 0 0 0 0 0 0 0 0
-0.9480 -0.5440 -1.5400 H 0 0 0 0 0 0 0 0 0 0 0 0
-1.6960 -2.5840 -2.4040 H 0 0 0 0 0 0 0 0 0 0 0 0
-2.4080 -4.9160 -2.0480 H 0 0 0 0 0 0 0 0 0 0 0 0
-2.9400 -5.7080 0.2160 H 0 0 0 0 0 0 0 0 0 0 0 0
-2.7600 -4.1720 2.1320 H 0 0 0 0 0 0 0 0 0 0 0 0
-2.0440 -1.8400 1.7760 H 0 0 0 0 0 0 0 0 0 0 0 0
-2.8120 0.4640 -2.5680 H 0 0 0 0 0 0 0 0 0 0 0 0
-4.7680 1.9480 -2.4040 H 0 0 0 0 0 0 0 0 0 0 0 0
-4.5720 1.7360 1.8480 H 0 0 0 0 0 0 0 0 0 0 0 0
-2.6200 0.2440 1.6840 H 0 0 0 0 0 0 0 0 0 0 0 0
26 52 1 0
25 51 1 0
25 26 1 0
24 27 1 0
24 25 1 0
23 50 1 0
23 24 1 0
22 49 1 0
22 23 1 0
21 22 1 0
21 26 1 0
20 48 1 0
19 47 1 0
19 20 1 0
18 46 1 0
18 19 1 0
17 45 1 0
17 18 1 0
16 44 1 0
16 17 1 0
15 16 1 0
15 20 1 0
14 43 1 0
14 21 1 0
14 15 1 0
13 42 1 0
11 13 1 0
11 12 1 0
10 41 1 0
10 40 1 0
10 11 1 0
9 10 1 0
8 39 1 0
8 38 1 0
8 9 1 0
7 37 1 0
7 36 1 0
7 8 1 0
6 7 1 0
5 35 1 0
5 34 1 0
5 6 1 0
4 33 1 0
4 32 1 0
4 5 1 0
3 14 1 0
3 4 1 0
2 31 1 0
2 30 1 0
2 3 1 0
1 29 1 0
1 28 1 0
1 2 1 0
1 6 1 0
M END</inlineContents>
</jmolApplet>
</jmol>

<jmol>
<jmolApplet>
<title>Cetirizine 3d.MOL</title><color>black</color>
<size>200</size>
<script>zoom 80; cpk -25;frame 1; move 10 -20 10 0 0 0 0 0 3; delay 1;</script>
<uploadedFileContents>Cetirizine 3d.MOL</uploadedFileContents>
</jmolApplet>

<jmolMenu>
<item><text>Start spinning</text><script>spin on</script></item>
<item><text>Stop spinning</text><script>spin off</script></item>
<menuHeight>-1</menuHeight>
</jmolMenu>
<jmolButton>
<script>console</script>
<text>open a console window</text>
</jmolButton>
</jmol>

<jmol>
<jmolAppletButton>
<title>Show Citirizine in popup window</title>
<color>cyan</color>
<uploadedFileContents>Cetirizine 3d.MOL</uploadedFileContents>
</jmolAppletButton>
</jmol>

==General==
'''Cetirizine''', with the chemical name '''''(±) - [2- [4- [ (4-chlorophenyl)phenylmethyl] -1- piperazinyl] ethoxy]acetic acid dihydrochloride''''',a major matabolite of Hydroxyzine,which is an orally active and selective H1-receptor antagonist. The chemical structure is shown below:

[[Image:Cetirizine structure.gif|thumb|Image of Cyclophosphamide]]

This chemical compound is a white, crystalline powder and is water soluble, it is mainly used in medical treatment of allergies, hay fever, angioedema, and urticaria. ZYRTEC tablets(the active component of the chemical compound)are formulated as white, film-coated, rounded-off rectangular shaped tablets for oral administration and are available in 5 and 10 mg strengths.

==Synthesis==

'''(S)-cetirizine.2HCl''' is prepared via the diastereoselective organometallic addition to N-tert-butanesulfnyl adlimines (''scheme 1''). Organometallic reagent addition to imines is advantageous in that either enantiomeric forms of ceterizine (''structure 2'') can be produced by changing the imine/ organometallic partner; the imine of 4-chlorobenzaleldehyde (''structure 4'') with metallobenzene gives the opposite enantiomer to the reaction of benzaldehyde imine (''structure 3'') with the 4-chlorometallobenzene.

[[Image:HNMR_cetirizine.JPG|Description]]

==Pharmaceutical Usage==

'''DOSING''': Cetirizine should be taken at doses specifically directed by a physician, it can be taken with food.

'''DRUG INTERACTIONS''': Cetirizine should be taken only in doses prescribed. Increasing the dose can be dangerous. When taking cetirizine with theophylline the dose of theophylline may need to be reduced. Cetirizine occasionally can cause sleepiness . Cetirizine can be taken with erythromycin or ketaconazole without the increased risk of heart irregularities common to other non-sedating antihistamines. Cetirizine also can be used to treat children.
SIDE EFFECTS: Sleepiness occurs in 14% of patients. Dry mouth, nausea, headache, fatigue, jitteriness and sore throat are infrequently reported with cetirizine.
|-
==References==

</noinclude>{| class="toccolours" border="1" style="float: right; clear: right; margin: 0 0 1em 1em; border-collapse: collapse; width: 280px"
! {{chembox header}} | {{PAGENAME}} 
|-
! {{chembox header}} | General
|-
| [http://en.wikipedia.org/wiki/IUPAC Systematic name]
| (±) - [2- [4- [ (4-chlorophenyl)phenylmethyl] -1- piperazinyl] ethoxy]acetic acid dihydrochloride
|-
| [http://en.wikipedia.org/wiki/Chemical_formula Molecular formula]
| C21H25ClN2O3
|-
| [http://en.wikipedia.org/wiki/Chemical_file_format SMILES] 
| C1CN(CCN1CCOCC(=O)O)C(C2=CC=CC=C2)C3=CC=C(C=C3)Cl
|-
| [http://en.wikipedia.org/wiki/Molar_mass Molar mass]
| 461.82g/mol
|-
| [http://en.wikipedia.org/wiki/Percentage_composition Percentage composition]
| C 64.86%, H 6.48%, Cl 9.12%, N 7.20%, O 12.34%
|-
| Appearance
| White Crystalline powder, water soluble
|-
| [http://en.wikipedia.org/wiki/CAS_registry_number CAS number]
| 83881-51-0
|-
| [http://en.wikipedia.org/wiki/Synonyms]
| Alatrol, Cetirizina MERCK, Cetzine Glaxo, Cetirizin, Humex, Letizen, Razene, Reactine, Zyrtec, Zirtec, Zodac, Zirtek, Zynor, Zyrlek
|-
| [http://en.wikipedia.org/wiki/Boiling_point Boiling point]
|
|-
| [http://en.wikipedia.org/wiki/Melting_point Melting point]
|110-115°(for crystals from ethanol)
|-
| [http://en.wikipedia.org/wiki/Refractive_Index Refractive index]
|
|-
| [http://en.wikipedia.org/wiki/Bioavailability]
| Well absorbed
|-
|[http://en.wikipedia.org/wiki/Protein_Binding]
| 93% avg
|-
| [[Material safety data sheet|MSDS]]
| [[{{PAGENAME}} (data page)#Material Safety Data Sheet|External MSDS]] 
|-
| [[Risk and Safety Statements|R/S statement]]
| [[List of R-phrases|R]]: {{{R-S}}} <br /> [[List of S-phrases|S]]: ?
|-
! {{chembox header}} | [[{{PAGENAME}} (data page)|Supplementary data page]]
|-
| [[{{PAGENAME}} (data page)#Structure and properties|Structure and<br />properties]]
| [http://en.wikipedia.org/wiki/Refractive_index ''n''], [http://en.wikipedia.org/wiki/Dielectric_constant ε<sub>r</sub>], etc.
|-
| [[{{PAGENAME}} (data page)#Thermodynamic properties|Thermodynamic<br />data]]
| Phase behaviour<br />Solid, liquid, gas
|-

|-
! {{chembox header}} | Related compounds
|-
| Other [[Ion|anion]]s 
| {{{Other_anion}}} 
|-
| Other [[Ion|cation]]s 
| {{{Ohter_cation}}} 
|-
| Related compounds

| {{{Relative_Compounds}}}
|-
| {{chembox header}} | <small>Except where noted otherwise, data are given for<br /> materials in their [[standard state|standard state (at 25 °C, 100 kPa)]]<br />[[wikipedia:Chemical infobox|Infobox disclaimer and references]]</small>

File:HNMR cetirizine.JPG

2007-11-14T13:29:58Z

Rqn06:

Cetirizine

2007-11-14T13:25:15Z

Rqn06: HNMR_cetirizine

=Cetirizine=

<jmol>
<jmolApplet>
<size>200</size>
<color>black</color>
<script>zoom 80; cpk on;frame 1; move 10 -20 10 0 0 0 0 0 3; delay 1;</script>
<inlineContents>Cetirizine_3d.mol
title1
title2
52 54 0 0 1 V2000
1.8720 -0.7280 1.2200 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7520 -1.1400 0.2680 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.4120 -0.2680 0.4680 N 0 0 0 0 0 0 0 0 0 0 0 0
0.0200 1.0960 0.1560 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1400 1.5080 1.1120 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3040 0.6400 0.9120 N 0 0 0 0 0 0 0 0 0 0 0 0
3.2920 1.0120 1.9360 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6240 0.3240 1.6360 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1520 0.8200 0.4040 O 0 0 0 0 0 0 0 0 0 0 0 0
6.3880 0.1400 0.1800 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9960 0.6200 -1.1080 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4320 1.4600 -1.7720 O 0 0 0 0 0 0 0 0 0 0 0 0
8.1720 0.1200 -1.5280 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.3960 -0.6440 -0.5520 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.8320 -2.0680 -0.3360 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.9280 -2.9320 -1.4080 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3280 -4.2400 -1.2080 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6280 -4.6880 0.0600 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5240 -3.8240 1.1360 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1240 -2.5160 0.9360 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5920 0.2640 -0.4520 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.1960 0.7400 -1.6000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.2960 1.5760 -1.5080 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.7880 1.9360 -0.2680 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.1840 1.4560 0.8800 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.0920 0.6160 0.7880 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.1680 2.9840 -0.1520 Cl 0 0 0 0 0 0 0 0 0 0 0 0
1.5080 -0.7680 2.2480 H 0 0 0 0 0 0 0 0 0 0 0 0
2.7160 -1.4080 1.1080 H 0 0 0 0 0 0 0 0 0 0 0 0
1.1000 -1.0480 -0.7600 H 0 0 0 0 0 0 0 0 0 0 0 0
0.4720 -2.1760 0.4640 H 0 0 0 0 0 0 0 0 0 0 0 0
0.3840 1.1360 -0.8680 H 0 0 0 0 0 0 0 0 0 0 0 0
-0.8200 1.7760 0.2720 H 0 0 0 0 0 0 0 0 0 0 0 0
1.4200 2.5440 0.9120 H 0 0 0 0 0 0 0 0 0 0 0 0
0.7920 1.4200 2.1400 H 0 0 0 0 0 0 0 0 0 0 0 0
3.4320 2.0920 1.9280 H 0 0 0 0 0 0 0 0 0 0 0 0
2.9320 0.7000 2.9160 H 0 0 0 0 0 0 0 0 0 0 0 0
5.3280 0.5280 2.4400 H 0 0 0 0 0 0 0 0 0 0 0 0
4.4640 -0.7520 1.5560 H 0 0 0 0 0 0 0 0 0 0 0 0
7.0720 0.3480 1.0040 H 0 0 0 0 0 0 0 0 0 0 0 0
6.2080 -0.9280 0.1160 H 0 0 0 0 0 0 0 0 0 0 0 0
8.5640 0.4280 -2.3560 H 0 0 0 0 0 0 0 0 0 0 0 0
-0.9480 -0.5440 -1.5400 H 0 0 0 0 0 0 0 0 0 0 0 0
-1.6960 -2.5840 -2.4040 H 0 0 0 0 0 0 0 0 0 0 0 0
-2.4080 -4.9160 -2.0480 H 0 0 0 0 0 0 0 0 0 0 0 0
-2.9400 -5.7080 0.2160 H 0 0 0 0 0 0 0 0 0 0 0 0
-2.7600 -4.1720 2.1320 H 0 0 0 0 0 0 0 0 0 0 0 0
-2.0440 -1.8400 1.7760 H 0 0 0 0 0 0 0 0 0 0 0 0
-2.8120 0.4640 -2.5680 H 0 0 0 0 0 0 0 0 0 0 0 0
-4.7680 1.9480 -2.4040 H 0 0 0 0 0 0 0 0 0 0 0 0
-4.5720 1.7360 1.8480 H 0 0 0 0 0 0 0 0 0 0 0 0
-2.6200 0.2440 1.6840 H 0 0 0 0 0 0 0 0 0 0 0 0
26 52 1 0
25 51 1 0
25 26 1 0
24 27 1 0
24 25 1 0
23 50 1 0
23 24 1 0
22 49 1 0
22 23 1 0
21 22 1 0
21 26 1 0
20 48 1 0
19 47 1 0
19 20 1 0
18 46 1 0
18 19 1 0
17 45 1 0
17 18 1 0
16 44 1 0
16 17 1 0
15 16 1 0
15 20 1 0
14 43 1 0
14 21 1 0
14 15 1 0
13 42 1 0
11 13 1 0
11 12 1 0
10 41 1 0
10 40 1 0
10 11 1 0
9 10 1 0
8 39 1 0
8 38 1 0
8 9 1 0
7 37 1 0
7 36 1 0
7 8 1 0
6 7 1 0
5 35 1 0
5 34 1 0
5 6 1 0
4 33 1 0
4 32 1 0
4 5 1 0
3 14 1 0
3 4 1 0
2 31 1 0
2 30 1 0
2 3 1 0
1 29 1 0
1 28 1 0
1 2 1 0
1 6 1 0
M END</inlineContents>
</jmolApplet>
</jmol>

<jmol>
<jmolApplet>
<title>Cetirizine_3D.PDB</title><color>yellow</color>
<size>200</size>
<script>zoom 80; cpk -25;frame 1; move 10 -20 10 0 0 0 0 0 3; delay 1;</script>
<uploadedFileContents>Cetirizine_3D.PDB</uploadedFileContents>
</jmolApplet>

<jmolMenu>
<item><text>Start spinning</text><script>spin on</script></item>
<item><text>Stop spinning</text><script>spin off</script></item>
<menuHeight>-1</menuHeight>
</jmolMenu>
<jmolButton>
<script>console</script>
<text>open a console window</text>
</jmolButton>
</jmol>

<jmol>
<jmolAppletButton>
<title>Show Citirizine in popup window</title>
<color>cyan</color>
<uploadedFileContents>Cetirizine_3D.PDB</uploadedFileContents>
</jmolAppletButton>
</jmol>

==General==
'''Cetirizine''', with the chemical name '''''(±) - [2- [4- [ (4-chlorophenyl)phenylmethyl] -1- piperazinyl] ethoxy]acetic acid dihydrochloride''''',a major matabolite of Hydroxyzine,which is an orally active and selective H1-receptor antagonist. The chemical structure is shown below:

[[Image:Cetirizine structure.gif|thumb|Image of Cyclophosphamide]]

This chemical compound is a white, crystalline powder and is water soluble, it is mainly used in medical treatment of allergies, hay fever, angioedema, and urticaria. ZYRTEC tablets(the active component of the chemical compound)are formulated as white, film-coated, rounded-off rectangular shaped tablets for oral administration and are available in 5 and 10 mg strengths.

==Synthesis==

'''(S)-cetirizine.2HCl''' is prepared via the diastereoselective organometallic addition to N-tert-butanesulfnyl adlimines (''scheme 1''). Organometallic reagent addition to imines is advantageous in that either enantiomeric forms of ceterizine (''structure 2'') can be produced by changing the imine/ organometallic partner; the imine of 4-chlorobenzaleldehyde (''structure 4'') with metallobenzene gives the opposite enantiomer to the reaction of benzaldehyde imine (''structure 3'') with the 4-chlorometallobenzene.

[[Image:(s)-cetirizine route 2.jpg|Description]]

==Pharmaceutical Usage==

'''DOSING''': Cetirizine should be taken at doses specifically directed by a physician, it can be taken with food.

'''DRUG INTERACTIONS''': Cetirizine should be taken only in doses prescribed. Increasing the dose can be dangerous. When taking cetirizine with theophylline the dose of theophylline may need to be reduced. Cetirizine occasionally can cause sleepiness . Cetirizine can be taken with erythromycin or ketaconazole without the increased risk of heart irregularities common to other non-sedating antihistamines. Cetirizine also can be used to treat children.
SIDE EFFECTS: Sleepiness occurs in 14% of patients. Dry mouth, nausea, headache, fatigue, jitteriness and sore throat are infrequently reported with cetirizine.
|-
==References==

</noinclude>{| class="toccolours" border="1" style="float: right; clear: right; margin: 0 0 1em 1em; border-collapse: collapse; width: 280px"
! {{chembox header}} | {{PAGENAME}} 
|-
! {{chembox header}} | General
|-
| [http://en.wikipedia.org/wiki/IUPAC Systematic name]
| (±) - [2- [4- [ (4-chlorophenyl)phenylmethyl] -1- piperazinyl] ethoxy]acetic acid dihydrochloride
|-
| [http://en.wikipedia.org/wiki/Chemical_formula Molecular formula]
| C21H25ClN2O3
|-
| [http://en.wikipedia.org/wiki/Chemical_file_format SMILES] 
| C1CN(CCN1CCOCC(=O)O)C(C2=CC=CC=C2)C3=CC=C(C=C3)Cl
|-
| [http://en.wikipedia.org/wiki/Molar_mass Molar mass]
| 461.82g/mol
|-
| [http://en.wikipedia.org/wiki/Percentage_composition Percentage composition]
| C 64.86%, H 6.48%, Cl 9.12%, N 7.20%, O 12.34%
|-
| Appearance
| White Crystalline powder, water soluble
|-
| [http://en.wikipedia.org/wiki/CAS_registry_number CAS number]
| 83881-51-0
|-
| [http://en.wikipedia.org/wiki/Synonyms]
| Alatrol, Cetirizina MERCK, Cetzine Glaxo, Cetirizin, Humex, Letizen, Razene, Reactine, Zyrtec, Zirtec, Zodac, Zirtek, Zynor, Zyrlek
|-
| [http://en.wikipedia.org/wiki/Boiling_point Boiling point]
|
|-
| [http://en.wikipedia.org/wiki/Melting_point Melting point]
|110-115°(for crystals from ethanol)
|-
| [http://en.wikipedia.org/wiki/Refractive_Index Refractive index]
|
|-
| [http://en.wikipedia.org/wiki/Bioavailability]
| Well absorbed
|-
|[http://en.wikipedia.org/wiki/Protein_Binding]
| 93% avg
|-
| [[Material safety data sheet|MSDS]]
| [[{{PAGENAME}} (data page)#Material Safety Data Sheet|External MSDS]] 
|-
| [[Risk and Safety Statements|R/S statement]]
| [[List of R-phrases|R]]: {{{R-S}}} <br /> [[List of S-phrases|S]]: ?
|-
! {{chembox header}} | [[{{PAGENAME}} (data page)|Supplementary data page]]
|-
| [[{{PAGENAME}} (data page)#Structure and properties|Structure and<br />properties]]
| [http://en.wikipedia.org/wiki/Refractive_index ''n''], [http://en.wikipedia.org/wiki/Dielectric_constant ε<sub>r</sub>], etc.
|-
| [[{{PAGENAME}} (data page)#Thermodynamic properties|Thermodynamic<br />data]]
| Phase behaviour<br />Solid, liquid, gas
|-

|-
! {{chembox header}} | Related compounds
|-
| Other [[Ion|anion]]s 
| {{{Other_anion}}} 
|-
| Other [[Ion|cation]]s 
| {{{Ohter_cation}}} 
|-
| Related compounds

| {{{Relative_Compounds}}}
|-
| {{chembox header}} | <small>Except where noted otherwise, data are given for<br /> materials in their [[standard state|standard state (at 25 °C, 100 kPa)]]<br />[[wikipedia:Chemical infobox|Infobox disclaimer and references]]</small>

==spectra==
[[Image:HNMR_cetirizine.bmp|Description]]
Image:

File:HNMR cetirizine.bmp

2007-11-02T15:01:08Z

Rqn06:

File:HNMR ceterizine.bmp

2007-11-02T14:58:47Z

Rqn06:

Cetirizine

2007-11-02T14:25:25Z

Rqn06:

=Cetirizine=

==General==
'''Cetirizine''', with the chemical name '''''(±) - [2- [4- [ (4-chlorophenyl)phenylmethyl] -1- piperazinyl] ethoxy]acetic acid dihydrochloride''''',a major matabolite of Hydroxyzine,which is an orally active and selective H1-receptor antagonist. The chemical structure is shown below:

[[Image:Cetirizine structure.gif|thumb|Image of Cyclophosphamide]]

This chemical compound is a white, crystalline powder and is water soluble, it is mainly used in medical treatment of allergies, hay fever, angioedema, and urticaria. ZYRTEC tablets(the active component of the chemical compound)are formulated as white, film-coated, rounded-off rectangular shaped tablets for oral administration and are available in 5 and 10 mg strengths.

==Synthesis==

'''(S)-cetirizine.2HCl''' is prepared via the diastereoselective organometallic addition to N-tert-butanesulfnyl adlimines (''scheme 1''). Organometallic reagent addition to imines is advantageous in that either enantiomeric forms of ceterizine (''structure 2'') can be produced by changing the imine/ organometallic partner; the imine of 4-chlorobenzaleldehyde (''structure 4'') with metallobenzene gives the opposite enantiomer to the reaction of benzaldehyde imine (''structure 3'') with the 4-chlorometallobenzene.

[[Image:(s)-cetirizine route 2.jpg|Description]]

==Pharmaceutical Usage==
</noinclude>{| class="toccolours" border="1" style="float: right; clear: right; margin: 0 0 1em 1em; border-collapse: collapse; width: 280px"
! {{chembox header}} | {{PAGENAME}} 
|-
! {{chembox header}} | General
|-
| [http://en.wikipedia.org/wiki/IUPAC Systematic name]
| (±) - [2- [4- [ (4-chlorophenyl)phenylmethyl] -1- piperazinyl] ethoxy]acetic acid dihydrochloride
|-
| [http://en.wikipedia.org/wiki/Chemical_formula Molecular formula]
| C21H25ClN2O3
|-
| [http://en.wikipedia.org/wiki/Chemical_file_format SMILES] 
| C1CN(CCN1CCOCC(=O)O)C(C2=CC=CC=C2)C3=CC=C(C=C3)Cl
|-
| [http://en.wikipedia.org/wiki/Molar_mass Molar mass]
| 461.82g/mol
|-
| [http://en.wikipedia.org/wiki/Percentage_composition Percentage composition]
| C 64.86%, H 6.48%, Cl 9.12%, N 7.20%, O 12.34%
|-
| Appearance
| White Crystalline powder, water soluble
|-
| [http://en.wikipedia.org/wiki/CAS_registry_number CAS number]
| 83881-51-0
|-
| [http://en.wikipedia.org/wiki/Synonyms]
| Alatrol, Cetirizina MERCK, Cetzine Glaxo, Cetirizin, Humex, Letizen, Razene, Reactine, Zyrtec, Zirtec, Zodac, Zirtek, Zynor, Zyrlek
|-
| [http://en.wikipedia.org/wiki/Boiling_point Boiling point]
|
|-
| [http://en.wikipedia.org/wiki/Melting_point Melting point]
|110-115°(for crystals from ethanol)
|-
| [http://en.wikipedia.org/wiki/Refractive_Index Refractive index]
|
|-
| [http://en.wikipedia.org/wiki/Bioavailability]
| Well absorbed
|-
|[http://en.wikipedia.org/wiki/Protein_Binding]
| 93% avg
|-
| [[Material safety data sheet|MSDS]]
| [[{{PAGENAME}} (data page)#Material Safety Data Sheet|External MSDS]] 
|-
| [[Risk and Safety Statements|R/S statement]]
| [[List of R-phrases|R]]: {{{R-S}}} <br /> [[List of S-phrases|S]]: ?
|-
! {{chembox header}} | [[{{PAGENAME}} (data page)|Supplementary data page]]
|-
| [[{{PAGENAME}} (data page)#Structure and properties|Structure and<br />properties]]
| [http://en.wikipedia.org/wiki/Refractive_index ''n''], [http://en.wikipedia.org/wiki/Dielectric_constant ε<sub>r</sub>], etc.
|-
| [[{{PAGENAME}} (data page)#Thermodynamic properties|Thermodynamic<br />data]]
| Phase behaviour<br />Solid, liquid, gas
|-

|-
! {{chembox header}} | Related compounds
|-
| Other [[Ion|anion]]s 
| {{{Other_anion}}} 
|-
| Other [[Ion|cation]]s 
| {{{Ohter_cation}}} 
|-
| Related compounds

| {{{Relative_Compounds}}}
|-
| {{chembox header}} | <small>Except where noted otherwise, data are given for<br /> materials in their [[standard state|standard state (at 25 °C, 100 kPa)]]<br />[[wikipedia:Chemical infobox|Infobox disclaimer and references]]</small>
|-
<jmol>
<jmolApplet>
<size>200</size>
<color>white</color>
<script>zoom 80; cpk on;frame 1; move 10 -20 10 0 0 0 0 0 3; delay 1;</script>
<inlineContents>Cetirizine_3d.mol
title1
title2
52 54 0 0 1 V2000
1.8720 -0.7280 1.2200 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7520 -1.1400 0.2680 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.4120 -0.2680 0.4680 N 0 0 0 0 0 0 0 0 0 0 0 0
0.0200 1.0960 0.1560 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1400 1.5080 1.1120 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3040 0.6400 0.9120 N 0 0 0 0 0 0 0 0 0 0 0 0
3.2920 1.0120 1.9360 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6240 0.3240 1.6360 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1520 0.8200 0.4040 O 0 0 0 0 0 0 0 0 0 0 0 0
6.3880 0.1400 0.1800 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9960 0.6200 -1.1080 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4320 1.4600 -1.7720 O 0 0 0 0 0 0 0 0 0 0 0 0
8.1720 0.1200 -1.5280 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.3960 -0.6440 -0.5520 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.8320 -2.0680 -0.3360 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.9280 -2.9320 -1.4080 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3280 -4.2400 -1.2080 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6280 -4.6880 0.0600 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5240 -3.8240 1.1360 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1240 -2.5160 0.9360 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5920 0.2640 -0.4520 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.1960 0.7400 -1.6000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.2960 1.5760 -1.5080 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.7880 1.9360 -0.2680 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.1840 1.4560 0.8800 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.0920 0.6160 0.7880 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.1680 2.9840 -0.1520 Cl 0 0 0 0 0 0 0 0 0 0 0 0
1.5080 -0.7680 2.2480 H 0 0 0 0 0 0 0 0 0 0 0 0
2.7160 -1.4080 1.1080 H 0 0 0 0 0 0 0 0 0 0 0 0
1.1000 -1.0480 -0.7600 H 0 0 0 0 0 0 0 0 0 0 0 0
0.4720 -2.1760 0.4640 H 0 0 0 0 0 0 0 0 0 0 0 0
0.3840 1.1360 -0.8680 H 0 0 0 0 0 0 0 0 0 0 0 0
-0.8200 1.7760 0.2720 H 0 0 0 0 0 0 0 0 0 0 0 0
1.4200 2.5440 0.9120 H 0 0 0 0 0 0 0 0 0 0 0 0
0.7920 1.4200 2.1400 H 0 0 0 0 0 0 0 0 0 0 0 0
3.4320 2.0920 1.9280 H 0 0 0 0 0 0 0 0 0 0 0 0
2.9320 0.7000 2.9160 H 0 0 0 0 0 0 0 0 0 0 0 0
5.3280 0.5280 2.4400 H 0 0 0 0 0 0 0 0 0 0 0 0
4.4640 -0.7520 1.5560 H 0 0 0 0 0 0 0 0 0 0 0 0
7.0720 0.3480 1.0040 H 0 0 0 0 0 0 0 0 0 0 0 0
6.2080 -0.9280 0.1160 H 0 0 0 0 0 0 0 0 0 0 0 0
8.5640 0.4280 -2.3560 H 0 0 0 0 0 0 0 0 0 0 0 0
-0.9480 -0.5440 -1.5400 H 0 0 0 0 0 0 0 0 0 0 0 0
-1.6960 -2.5840 -2.4040 H 0 0 0 0 0 0 0 0 0 0 0 0
-2.4080 -4.9160 -2.0480 H 0 0 0 0 0 0 0 0 0 0 0 0
-2.9400 -5.7080 0.2160 H 0 0 0 0 0 0 0 0 0 0 0 0
-2.7600 -4.1720 2.1320 H 0 0 0 0 0 0 0 0 0 0 0 0
-2.0440 -1.8400 1.7760 H 0 0 0 0 0 0 0 0 0 0 0 0
-2.8120 0.4640 -2.5680 H 0 0 0 0 0 0 0 0 0 0 0 0
-4.7680 1.9480 -2.4040 H 0 0 0 0 0 0 0 0 0 0 0 0
-4.5720 1.7360 1.8480 H 0 0 0 0 0 0 0 0 0 0 0 0
-2.6200 0.2440 1.6840 H 0 0 0 0 0 0 0 0 0 0 0 0
26 52 1 0
25 51 1 0
25 26 1 0
24 27 1 0
24 25 1 0
23 50 1 0
23 24 1 0
22 49 1 0
22 23 1 0
21 22 1 0
21 26 1 0
20 48 1 0
19 47 1 0
19 20 1 0
18 46 1 0
18 19 1 0
17 45 1 0
17 18 1 0
16 44 1 0
16 17 1 0
15 16 1 0
15 20 1 0
14 43 1 0
14 21 1 0
14 15 1 0
13 42 1 0
11 13 1 0
11 12 1 0
10 41 1 0
10 40 1 0
10 11 1 0
9 10 1 0
8 39 1 0
8 38 1 0
8 9 1 0
7 37 1 0
7 36 1 0
7 8 1 0
6 7 1 0
5 35 1 0
5 34 1 0
5 6 1 0
4 33 1 0
4 32 1 0
4 5 1 0
3 14 1 0
3 4 1 0
2 31 1 0
2 30 1 0
2 3 1 0
1 29 1 0
1 28 1 0
1 2 1 0
1 6 1 0
M END</inlineContents>
</jmolApplet>
</jmol>

Cetirizine

2007-10-31T17:17:54Z

Rqn06:

=Cetirizine=

==General==
'''Cetirizine''', with the chemical name '''''(±) - [2- [4- [ (4-chlorophenyl)phenylmethyl] -1- piperazinyl] ethoxy]acetic acid dihydrochloride''''',a major matabolite of Hydroxyzine,which is an orally active and selective H1-receptor antagonist. The chemical structure is shown below:

[[Image:Cetirizine structure.gif|centre|]]

This chemical compound is a white, crystalline powder and is water soluble, it is mainly used in medical treatment of allergies, hay fever, angioedema, and urticaria. ZYRTEC tablets(the active component of the chemical compound)are formulated as white, film-coated, rounded-off rectangular shaped tablets for oral administration and are available in 5 and 10 mg strengths.

==Synthesis==

'''(S)-cetirizine.2HCl''' is prepared via the diastereoselective organometallic addition to N-tert-butanesulfnyl adlimines (''scheme 1''). Organometallic reagent addition to imines is advantageous in that either enantiomeric forms of ceterizine (''structure 2'') can be produced by changing the imine/ organometallic partner; the imine of 4-chlorobenzaleldehyde (''structure 4'') with metallobenzene gives the opposite enantiomer to the reaction of benzaldehyde imine (''structure 3'') with the 4-chlorometallobenzene.

[[Image:(s)-cetirizine route 2.jpg|Description]]

</noinclude>{| class="toccolours" border="1" style="float: right; clear: right; margin: 0 0 1em 1em; border-collapse: collapse; width: 280px"
! {{chembox header}} | {{PAGENAME}} 
|-
! {{chembox header}} | General
|-
| [http://en.wikipedia.org/wiki/IUPAC Systematic name]
| (±) - [2- [4- [ (4-chlorophenyl)phenylmethyl] -1- piperazinyl] ethoxy]acetic acid dihydrochloride
|-
| [http://en.wikipedia.org/wiki/Chemical_formula Molecular formula]
| C21H25ClN2O3
|-
| [http://en.wikipedia.org/wiki/Chemical_file_format SMILES] 
| C1CN(CCN1CCOCC(=O)O)C(C2=CC=CC=C2)C3=CC=C(C=C3)Cl
|-
| [http://en.wikipedia.org/wiki/Molar_mass Molar mass]
| 461.82g/mol
|-
| [http://en.wikipedia.org/wiki/Percentage_composition Percentage composition]
| C 64.86%, H 6.48%, Cl 9.12%, N 7.20%, O 12.34%
|-
| Appearance
| White Crystalline powder, water soluble
|-
| [http://en.wikipedia.org/wiki/CAS_registry_number CAS number]
| 83881-51-0
|-
| [http://en.wikipedia.org/wiki/Synonyms]
| Alatrol, Cetirizina MERCK, Cetzine Glaxo, Cetirizin, Humex, Letizen, Razene, Reactine, Zyrtec, Zirtec, Zodac, Zirtek, Zynor, Zyrlek
|-
| [http://en.wikipedia.org/wiki/Boiling_point Boiling point]
|
|-
| [http://en.wikipedia.org/wiki/Melting_point Melting point]
|110-115°(for crystals from ethanol)
|-
| [http://en.wikipedia.org/wiki/Refractive_Index Refractive index]
|
|-
| [http://en.wikipedia.org/wiki/Bioavailability]
| Well absorbed
|-
|[http://en.wikipedia.org/wiki/Protein_Binding]
| 93% avg
|-
| [[Material safety data sheet|MSDS]]
| [[{{PAGENAME}} (data page)#Material Safety Data Sheet|External MSDS]] 
|-
| [[Risk and Safety Statements|R/S statement]]
| [[List of R-phrases|R]]: {{{R-S}}} <br /> [[List of S-phrases|S]]: ?
|-
! {{chembox header}} | [[{{PAGENAME}} (data page)|Supplementary data page]]
|-
| [[{{PAGENAME}} (data page)#Structure and properties|Structure and<br />properties]]
| [http://en.wikipedia.org/wiki/Refractive_index ''n''], [http://en.wikipedia.org/wiki/Dielectric_constant ε<sub>r</sub>], etc.
|-
| [[{{PAGENAME}} (data page)#Thermodynamic properties|Thermodynamic<br />data]]
| Phase behaviour<br />Solid, liquid, gas
|-

|-
! {{chembox header}} | Related compounds
|-
| Other [[Ion|anion]]s 
| {{{Other_anion}}} 
|-
| Other [[Ion|cation]]s 
| {{{Ohter_cation}}} 
|-
| Related compounds

| {{{Relative_Compounds}}}
|-
| {{chembox header}} | <small>Except where noted otherwise, data are given for<br /> materials in their [[standard state|standard state (at 25 °C, 100 kPa)]]<br />[[wikipedia:Chemical infobox|Infobox disclaimer and references]]</small>
|-
<jmol>
<jmolApplet>
<size>200</size>
<color>white</color>
<script>zoom 80; cpk on;frame 1; move 10 -20 10 0 0 0 0 0 3; delay 1;</script>
<inlineContents>Cetirizine_3d.mol
title1
title2
52 54 0 0 1 V2000
1.8720 -0.7280 1.2200 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7520 -1.1400 0.2680 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.4120 -0.2680 0.4680 N 0 0 0 0 0 0 0 0 0 0 0 0
0.0200 1.0960 0.1560 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1400 1.5080 1.1120 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3040 0.6400 0.9120 N 0 0 0 0 0 0 0 0 0 0 0 0
3.2920 1.0120 1.9360 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6240 0.3240 1.6360 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1520 0.8200 0.4040 O 0 0 0 0 0 0 0 0 0 0 0 0
6.3880 0.1400 0.1800 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9960 0.6200 -1.1080 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4320 1.4600 -1.7720 O 0 0 0 0 0 0 0 0 0 0 0 0
8.1720 0.1200 -1.5280 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.3960 -0.6440 -0.5520 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.8320 -2.0680 -0.3360 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.9280 -2.9320 -1.4080 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3280 -4.2400 -1.2080 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6280 -4.6880 0.0600 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5240 -3.8240 1.1360 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1240 -2.5160 0.9360 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5920 0.2640 -0.4520 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.1960 0.7400 -1.6000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.2960 1.5760 -1.5080 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.7880 1.9360 -0.2680 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.1840 1.4560 0.8800 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.0920 0.6160 0.7880 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.1680 2.9840 -0.1520 Cl 0 0 0 0 0 0 0 0 0 0 0 0
1.5080 -0.7680 2.2480 H 0 0 0 0 0 0 0 0 0 0 0 0
2.7160 -1.4080 1.1080 H 0 0 0 0 0 0 0 0 0 0 0 0
1.1000 -1.0480 -0.7600 H 0 0 0 0 0 0 0 0 0 0 0 0
0.4720 -2.1760 0.4640 H 0 0 0 0 0 0 0 0 0 0 0 0
0.3840 1.1360 -0.8680 H 0 0 0 0 0 0 0 0 0 0 0 0
-0.8200 1.7760 0.2720 H 0 0 0 0 0 0 0 0 0 0 0 0
1.4200 2.5440 0.9120 H 0 0 0 0 0 0 0 0 0 0 0 0
0.7920 1.4200 2.1400 H 0 0 0 0 0 0 0 0 0 0 0 0
3.4320 2.0920 1.9280 H 0 0 0 0 0 0 0 0 0 0 0 0
2.9320 0.7000 2.9160 H 0 0 0 0 0 0 0 0 0 0 0 0
5.3280 0.5280 2.4400 H 0 0 0 0 0 0 0 0 0 0 0 0
4.4640 -0.7520 1.5560 H 0 0 0 0 0 0 0 0 0 0 0 0
7.0720 0.3480 1.0040 H 0 0 0 0 0 0 0 0 0 0 0 0
6.2080 -0.9280 0.1160 H 0 0 0 0 0 0 0 0 0 0 0 0
8.5640 0.4280 -2.3560 H 0 0 0 0 0 0 0 0 0 0 0 0
-0.9480 -0.5440 -1.5400 H 0 0 0 0 0 0 0 0 0 0 0 0
-1.6960 -2.5840 -2.4040 H 0 0 0 0 0 0 0 0 0 0 0 0
-2.4080 -4.9160 -2.0480 H 0 0 0 0 0 0 0 0 0 0 0 0
-2.9400 -5.7080 0.2160 H 0 0 0 0 0 0 0 0 0 0 0 0
-2.7600 -4.1720 2.1320 H 0 0 0 0 0 0 0 0 0 0 0 0
-2.0440 -1.8400 1.7760 H 0 0 0 0 0 0 0 0 0 0 0 0
-2.8120 0.4640 -2.5680 H 0 0 0 0 0 0 0 0 0 0 0 0
-4.7680 1.9480 -2.4040 H 0 0 0 0 0 0 0 0 0 0 0 0
-4.5720 1.7360 1.8480 H 0 0 0 0 0 0 0 0 0 0 0 0
-2.6200 0.2440 1.6840 H 0 0 0 0 0 0 0 0 0 0 0 0
26 52 1 0
25 51 1 0
25 26 1 0
24 27 1 0
24 25 1 0
23 50 1 0
23 24 1 0
22 49 1 0
22 23 1 0
21 22 1 0
21 26 1 0
20 48 1 0
19 47 1 0
19 20 1 0
18 46 1 0
18 19 1 0
17 45 1 0
17 18 1 0
16 44 1 0
16 17 1 0
15 16 1 0
15 20 1 0
14 43 1 0
14 21 1 0
14 15 1 0
13 42 1 0
11 13 1 0
11 12 1 0
10 41 1 0
10 40 1 0
10 11 1 0
9 10 1 0
8 39 1 0
8 38 1 0
8 9 1 0
7 37 1 0
7 36 1 0
7 8 1 0
6 7 1 0
5 35 1 0
5 34 1 0
5 6 1 0
4 33 1 0
4 32 1 0
4 5 1 0
3 14 1 0
3 4 1 0
2 31 1 0
2 30 1 0
2 3 1 0
1 29 1 0
1 28 1 0
1 2 1 0
1 6 1 0
M END</inlineContents>
</jmolApplet>
</jmol>

Cetirizine

2007-10-31T17:09:55Z

Rqn06: /* Synthesis */

=Cetirizine=

==General==
'''Cetirizine''', with the chemical name '''''(±) - [2- [4- [ (4-chlorophenyl)phenylmethyl] -1- piperazinyl] ethoxy]acetic acid dihydrochloride''''',a major matabolite of Hydroxyzine,which is an orally active and selective H1-receptor antagonist. The chemical structure is shown below:

[[Image:Cetirizine structure.gif]]

This chemical compound is a white, crystalline powder and is water soluble, it is mainly used in medical treatment of allergies, hay fever, angioedema, and urticaria. ZYRTEC tablets(the active component of the chemical compound)are formulated as white, film-coated, rounded-off rectangular shaped tablets for oral administration and are available in 5 and 10 mg strengths.

==Synthesis==

'''(S)-cetirizine.2HCl''' is prepared via the diastereoselective organometallic addition to N-tert-butanesulfnyl adlimines (''scheme 1''). Organometallic reagent addition to imines is advantageous in that either enantiomeric forms of ceterizine (''structure 2'') can be produced by changing the imine/ organometallic partner; the imine of 4-chlorobenzaleldehyde (''structure 4'') with metallobenzene gives the opposite enantiomer to the reaction of benzaldehyde imine (''structure 3'') with the 4-chlorometallobenzene.

[[Image:(s)-cetirizine route 2.jpg|Description]]

</noinclude>{| class="toccolours" border="1" style="float: right; clear: right; margin: 0 0 1em 1em; border-collapse: collapse; width: 280px"
! {{chembox header}} | {{PAGENAME}} 
|-
! {{chembox header}} | General
|-
| [http://en.wikipedia.org/wiki/IUPAC Systematic name]
| (±) - [2- [4- [ (4-chlorophenyl)phenylmethyl] -1- piperazinyl] ethoxy]acetic acid dihydrochloride
|-
| [http://en.wikipedia.org/wiki/Chemical_formula Molecular formula]
| C21H25ClN2O3
|-
| [http://en.wikipedia.org/wiki/Chemical_file_format SMILES] 
| C1CN(CCN1CCOCC(=O)O)C(C2=CC=CC=C2)C3=CC=C(C=C3)Cl
|-
| [http://en.wikipedia.org/wiki/Molar_mass Molar mass]
| 388.89g/mol
|-
| [http://en.wikipedia.org/wiki/Percentage_composition Percentage composition]
| C 64.86%, H 6.48%, Cl 9.12%, N 7.20%, O 12.34%
|-
| Appearance
| White Crystalline powder, water soluble
|-
| [http://en.wikipedia.org/wiki/CAS_registry_number CAS number]
| 83881-51-0
|-
| [http://en.wikipedia.org/wiki/Synonyms]
| Alatrol, Cetirizina MERCK, Cetzine Glaxo, Cetirizin, Humex, Letizen, Razene, Reactine, Zyrtec, Zirtec, Zodac, Zirtek, Zynor, Zyrlek
|-
| [http://en.wikipedia.org/wiki/Boiling_point Boiling point]
|
|-
| [http://en.wikipedia.org/wiki/Melting_point Melting point]
|110-115°(for crystals from ethanol)
|-
| [http://en.wikipedia.org/wiki/Refractive_Index Refractive index]
|
|-
| [http://en.wikipedia.org/wiki/Bioavailability]
| Well absorbed
|-
|[http://en.wikipedia.org/wiki/Protein_Binding]
| 93% avg
|-
| [[Material safety data sheet|MSDS]]
| [[{{PAGENAME}} (data page)#Material Safety Data Sheet|External MSDS]] 
|-
| [[Risk and Safety Statements|R/S statement]]
| [[List of R-phrases|R]]: {{{R-S}}} <br /> [[List of S-phrases|S]]: ?
|-
! {{chembox header}} | [[{{PAGENAME}} (data page)|Supplementary data page]]
|-
| [[{{PAGENAME}} (data page)#Structure and properties|Structure and<br />properties]]
| [http://en.wikipedia.org/wiki/Refractive_index ''n''], [http://en.wikipedia.org/wiki/Dielectric_constant ε<sub>r</sub>], etc.
|-
| [[{{PAGENAME}} (data page)#Thermodynamic properties|Thermodynamic<br />data]]
| Phase behaviour<br />Solid, liquid, gas
|-

|-
! {{chembox header}} | Related compounds
|-
| Other [[Ion|anion]]s 
| {{{Other_anion}}} 
|-
| Other [[Ion|cation]]s 
| {{{Ohter_cation}}} 
|-
| Related compounds

| {{{Relative_Compounds}}}
|-
| {{chembox header}} | <small>Except where noted otherwise, data are given for<br /> materials in their [[standard state|standard state (at 25 °C, 100 kPa)]]<br />[[wikipedia:Chemical infobox|Infobox disclaimer and references]]</small>
|-
<jmol>
<jmolApplet>
<size>200</size>
<color>white</color>
<script>zoom 80; cpk on;frame 1; move 10 -20 10 0 0 0 0 0 3; delay 1;</script>
<inlineContents>Cetirizine_3d.mol
title1
title2
52 54 0 0 1 V2000
1.8720 -0.7280 1.2200 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7520 -1.1400 0.2680 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.4120 -0.2680 0.4680 N 0 0 0 0 0 0 0 0 0 0 0 0
0.0200 1.0960 0.1560 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1400 1.5080 1.1120 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3040 0.6400 0.9120 N 0 0 0 0 0 0 0 0 0 0 0 0
3.2920 1.0120 1.9360 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6240 0.3240 1.6360 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1520 0.8200 0.4040 O 0 0 0 0 0 0 0 0 0 0 0 0
6.3880 0.1400 0.1800 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9960 0.6200 -1.1080 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4320 1.4600 -1.7720 O 0 0 0 0 0 0 0 0 0 0 0 0
8.1720 0.1200 -1.5280 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.3960 -0.6440 -0.5520 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.8320 -2.0680 -0.3360 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.9280 -2.9320 -1.4080 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3280 -4.2400 -1.2080 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6280 -4.6880 0.0600 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5240 -3.8240 1.1360 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1240 -2.5160 0.9360 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5920 0.2640 -0.4520 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.1960 0.7400 -1.6000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.2960 1.5760 -1.5080 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.7880 1.9360 -0.2680 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.1840 1.4560 0.8800 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.0920 0.6160 0.7880 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.1680 2.9840 -0.1520 Cl 0 0 0 0 0 0 0 0 0 0 0 0
1.5080 -0.7680 2.2480 H 0 0 0 0 0 0 0 0 0 0 0 0
2.7160 -1.4080 1.1080 H 0 0 0 0 0 0 0 0 0 0 0 0
1.1000 -1.0480 -0.7600 H 0 0 0 0 0 0 0 0 0 0 0 0
0.4720 -2.1760 0.4640 H 0 0 0 0 0 0 0 0 0 0 0 0
0.3840 1.1360 -0.8680 H 0 0 0 0 0 0 0 0 0 0 0 0
-0.8200 1.7760 0.2720 H 0 0 0 0 0 0 0 0 0 0 0 0
1.4200 2.5440 0.9120 H 0 0 0 0 0 0 0 0 0 0 0 0
0.7920 1.4200 2.1400 H 0 0 0 0 0 0 0 0 0 0 0 0
3.4320 2.0920 1.9280 H 0 0 0 0 0 0 0 0 0 0 0 0
2.9320 0.7000 2.9160 H 0 0 0 0 0 0 0 0 0 0 0 0
5.3280 0.5280 2.4400 H 0 0 0 0 0 0 0 0 0 0 0 0
4.4640 -0.7520 1.5560 H 0 0 0 0 0 0 0 0 0 0 0 0
7.0720 0.3480 1.0040 H 0 0 0 0 0 0 0 0 0 0 0 0
6.2080 -0.9280 0.1160 H 0 0 0 0 0 0 0 0 0 0 0 0
8.5640 0.4280 -2.3560 H 0 0 0 0 0 0 0 0 0 0 0 0
-0.9480 -0.5440 -1.5400 H 0 0 0 0 0 0 0 0 0 0 0 0
-1.6960 -2.5840 -2.4040 H 0 0 0 0 0 0 0 0 0 0 0 0
-2.4080 -4.9160 -2.0480 H 0 0 0 0 0 0 0 0 0 0 0 0
-2.9400 -5.7080 0.2160 H 0 0 0 0 0 0 0 0 0 0 0 0
-2.7600 -4.1720 2.1320 H 0 0 0 0 0 0 0 0 0 0 0 0
-2.0440 -1.8400 1.7760 H 0 0 0 0 0 0 0 0 0 0 0 0
-2.8120 0.4640 -2.5680 H 0 0 0 0 0 0 0 0 0 0 0 0
-4.7680 1.9480 -2.4040 H 0 0 0 0 0 0 0 0 0 0 0 0
-4.5720 1.7360 1.8480 H 0 0 0 0 0 0 0 0 0 0 0 0
-2.6200 0.2440 1.6840 H 0 0 0 0 0 0 0 0 0 0 0 0
26 52 1 0
25 51 1 0
25 26 1 0
24 27 1 0
24 25 1 0
23 50 1 0
23 24 1 0
22 49 1 0
22 23 1 0
21 22 1 0
21 26 1 0
20 48 1 0
19 47 1 0
19 20 1 0
18 46 1 0
18 19 1 0
17 45 1 0
17 18 1 0
16 44 1 0
16 17 1 0
15 16 1 0
15 20 1 0
14 43 1 0
14 21 1 0
14 15 1 0
13 42 1 0
11 13 1 0
11 12 1 0
10 41 1 0
10 40 1 0
10 11 1 0
9 10 1 0
8 39 1 0
8 38 1 0
8 9 1 0
7 37 1 0
7 36 1 0
7 8 1 0
6 7 1 0
5 35 1 0
5 34 1 0
5 6 1 0
4 33 1 0
4 32 1 0
4 5 1 0
3 14 1 0
3 4 1 0
2 31 1 0
2 30 1 0
2 3 1 0
1 29 1 0
1 28 1 0
1 2 1 0
1 6 1 0
M END</inlineContents>
</jmolApplet>
</jmol>

File:(s)-cetirizine route 2.jpg

2007-10-31T17:06:20Z

Rqn06:

Cetirizine

2007-10-31T17:05:38Z

Rqn06: synthesis method

=Cetirizine=

==General==
'''Cetirizine''', with the chemical name '''''(±) - [2- [4- [ (4-chlorophenyl)phenylmethyl] -1- piperazinyl] ethoxy]acetic acid dihydrochloride''''',a major matabolite of Hydroxyzine,which is an orally active and selective H1-receptor antagonist. The chemical structure is shown below:

[[Image:Cetirizine structure.gif]]

This chemical compound is a white, crystalline powder and is water soluble, it is mainly used in medical treatment of allergies, hay fever, angioedema, and urticaria. ZYRTEC tablets(the active component of the chemical compound)are formulated as white, film-coated, rounded-off rectangular shaped tablets for oral administration and are available in 5 and 10 mg strengths.

==Synthesis==

'''(S)-cetirizine.2HCl''' is prepared via the diastereoselective organometallic addition to N-tert-butanesulfnyl adlimines (''scheme 1''). Organometallic reagent addition to imines is advantageous in that either enantiomeric forms of ceterizine (''structure 2'') can be produced by changing the imine/ organometallic partner; the imine of 4-chlorobenzaleldehyde (''structure 4'') with metallobenzene gives the opposite enantiomer to the reaction of benzaldehyde imine (''structure 3'') with the 4-chlorometallobenzene.

</noinclude>{| class="toccolours" border="1" style="float: right; clear: right; margin: 0 0 1em 1em; border-collapse: collapse; width: 280px"
! {{chembox header}} | {{PAGENAME}} 
|-
! {{chembox header}} | General
|-
| [http://en.wikipedia.org/wiki/IUPAC Systematic name]
| (±) - [2- [4- [ (4-chlorophenyl)phenylmethyl] -1- piperazinyl] ethoxy]acetic acid dihydrochloride
|-
| [http://en.wikipedia.org/wiki/Chemical_formula Molecular formula]
| C21H25ClN2O3
|-
| [http://en.wikipedia.org/wiki/Chemical_file_format SMILES] 
| C1CN(CCN1CCOCC(=O)O)C(C2=CC=CC=C2)C3=CC=C(C=C3)Cl
|-
| [http://en.wikipedia.org/wiki/Molar_mass Molar mass]
| 388.89g/mol
|-
| [http://en.wikipedia.org/wiki/Percentage_composition Percentage composition]
| C 64.86%, H 6.48%, Cl 9.12%, N 7.20%, O 12.34%
|-
| Appearance
| White Crystalline powder, water soluble
|-
| [http://en.wikipedia.org/wiki/CAS_registry_number CAS number]
| 83881-51-0
|-
| [http://en.wikipedia.org/wiki/Synonyms]
| Alatrol, Cetirizina MERCK, Cetzine Glaxo, Cetirizin, Humex, Letizen, Razene, Reactine, Zyrtec, Zirtec, Zodac, Zirtek, Zynor, Zyrlek
|-
| [http://en.wikipedia.org/wiki/Boiling_point Boiling point]
|
|-
| [http://en.wikipedia.org/wiki/Melting_point Melting point]
|110-115°(for crystals from ethanol)
|-
| [http://en.wikipedia.org/wiki/Refractive_Index Refractive index]
|
|-
| [http://en.wikipedia.org/wiki/Bioavailability]
| Well absorbed
|-
|[http://en.wikipedia.org/wiki/Protein_Binding]
| 93% avg
|-
| [[Material safety data sheet|MSDS]]
| [[{{PAGENAME}} (data page)#Material Safety Data Sheet|External MSDS]] 
|-
| [[Risk and Safety Statements|R/S statement]]
| [[List of R-phrases|R]]: {{{R-S}}} <br /> [[List of S-phrases|S]]: ?
|-
! {{chembox header}} | [[{{PAGENAME}} (data page)|Supplementary data page]]
|-
| [[{{PAGENAME}} (data page)#Structure and properties|Structure and<br />properties]]
| [http://en.wikipedia.org/wiki/Refractive_index ''n''], [http://en.wikipedia.org/wiki/Dielectric_constant ε<sub>r</sub>], etc.
|-
| [[{{PAGENAME}} (data page)#Thermodynamic properties|Thermodynamic<br />data]]
| Phase behaviour<br />Solid, liquid, gas
|-

|-
! {{chembox header}} | Related compounds
|-
| Other [[Ion|anion]]s 
| {{{Other_anion}}} 
|-
| Other [[Ion|cation]]s 
| {{{Ohter_cation}}} 
|-
| Related compounds

| {{{Relative_Compounds}}}
|-
| {{chembox header}} | <small>Except where noted otherwise, data are given for<br /> materials in their [[standard state|standard state (at 25 °C, 100 kPa)]]<br />[[wikipedia:Chemical infobox|Infobox disclaimer and references]]</small>
|-
<jmol>
<jmolApplet>
<size>200</size>
<color>white</color>
<script>zoom 80; cpk on;frame 1; move 10 -20 10 0 0 0 0 0 3; delay 1;</script>
<inlineContents>Cetirizine_3d.mol
title1
title2
52 54 0 0 1 V2000
1.8720 -0.7280 1.2200 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7520 -1.1400 0.2680 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.4120 -0.2680 0.4680 N 0 0 0 0 0 0 0 0 0 0 0 0
0.0200 1.0960 0.1560 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1400 1.5080 1.1120 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3040 0.6400 0.9120 N 0 0 0 0 0 0 0 0 0 0 0 0
3.2920 1.0120 1.9360 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6240 0.3240 1.6360 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1520 0.8200 0.4040 O 0 0 0 0 0 0 0 0 0 0 0 0
6.3880 0.1400 0.1800 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9960 0.6200 -1.1080 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4320 1.4600 -1.7720 O 0 0 0 0 0 0 0 0 0 0 0 0
8.1720 0.1200 -1.5280 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.3960 -0.6440 -0.5520 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.8320 -2.0680 -0.3360 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.9280 -2.9320 -1.4080 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3280 -4.2400 -1.2080 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6280 -4.6880 0.0600 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5240 -3.8240 1.1360 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1240 -2.5160 0.9360 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5920 0.2640 -0.4520 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.1960 0.7400 -1.6000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.2960 1.5760 -1.5080 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.7880 1.9360 -0.2680 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.1840 1.4560 0.8800 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.0920 0.6160 0.7880 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.1680 2.9840 -0.1520 Cl 0 0 0 0 0 0 0 0 0 0 0 0
1.5080 -0.7680 2.2480 H 0 0 0 0 0 0 0 0 0 0 0 0
2.7160 -1.4080 1.1080 H 0 0 0 0 0 0 0 0 0 0 0 0
1.1000 -1.0480 -0.7600 H 0 0 0 0 0 0 0 0 0 0 0 0
0.4720 -2.1760 0.4640 H 0 0 0 0 0 0 0 0 0 0 0 0
0.3840 1.1360 -0.8680 H 0 0 0 0 0 0 0 0 0 0 0 0
-0.8200 1.7760 0.2720 H 0 0 0 0 0 0 0 0 0 0 0 0
1.4200 2.5440 0.9120 H 0 0 0 0 0 0 0 0 0 0 0 0
0.7920 1.4200 2.1400 H 0 0 0 0 0 0 0 0 0 0 0 0
3.4320 2.0920 1.9280 H 0 0 0 0 0 0 0 0 0 0 0 0
2.9320 0.7000 2.9160 H 0 0 0 0 0 0 0 0 0 0 0 0
5.3280 0.5280 2.4400 H 0 0 0 0 0 0 0 0 0 0 0 0
4.4640 -0.7520 1.5560 H 0 0 0 0 0 0 0 0 0 0 0 0
7.0720 0.3480 1.0040 H 0 0 0 0 0 0 0 0 0 0 0 0
6.2080 -0.9280 0.1160 H 0 0 0 0 0 0 0 0 0 0 0 0
8.5640 0.4280 -2.3560 H 0 0 0 0 0 0 0 0 0 0 0 0
-0.9480 -0.5440 -1.5400 H 0 0 0 0 0 0 0 0 0 0 0 0
-1.6960 -2.5840 -2.4040 H 0 0 0 0 0 0 0 0 0 0 0 0
-2.4080 -4.9160 -2.0480 H 0 0 0 0 0 0 0 0 0 0 0 0
-2.9400 -5.7080 0.2160 H 0 0 0 0 0 0 0 0 0 0 0 0
-2.7600 -4.1720 2.1320 H 0 0 0 0 0 0 0 0 0 0 0 0
-2.0440 -1.8400 1.7760 H 0 0 0 0 0 0 0 0 0 0 0 0
-2.8120 0.4640 -2.5680 H 0 0 0 0 0 0 0 0 0 0 0 0
-4.7680 1.9480 -2.4040 H 0 0 0 0 0 0 0 0 0 0 0 0
-4.5720 1.7360 1.8480 H 0 0 0 0 0 0 0 0 0 0 0 0
-2.6200 0.2440 1.6840 H 0 0 0 0 0 0 0 0 0 0 0 0
26 52 1 0
25 51 1 0
25 26 1 0
24 27 1 0
24 25 1 0
23 50 1 0
23 24 1 0
22 49 1 0
22 23 1 0
21 22 1 0
21 26 1 0
20 48 1 0
19 47 1 0
19 20 1 0
18 46 1 0
18 19 1 0
17 45 1 0
17 18 1 0
16 44 1 0
16 17 1 0
15 16 1 0
15 20 1 0
14 43 1 0
14 21 1 0
14 15 1 0
13 42 1 0
11 13 1 0
11 12 1 0
10 41 1 0
10 40 1 0
10 11 1 0
9 10 1 0
8 39 1 0
8 38 1 0
8 9 1 0
7 37 1 0
7 36 1 0
7 8 1 0
6 7 1 0
5 35 1 0
5 34 1 0
5 6 1 0
4 33 1 0
4 32 1 0
4 5 1 0
3 14 1 0
3 4 1 0
2 31 1 0
2 30 1 0
2 3 1 0
1 29 1 0
1 28 1 0
1 2 1 0
1 6 1 0
M END</inlineContents>
</jmolApplet>
</jmol>

Cetirizine

2007-10-31T16:09:35Z

Rqn06: editted the table (mp, molecular mass etc)

=Cetirizine=

'''Cetirizine''', with the chemical name '''''(±) - [2- [4- [ (4-chlorophenyl)phenylmethyl] -1- piperazinyl] ethoxy]acetic acid dihydrochloride''''',a major matabolite of Hydroxyzine,which is an orally active and selective H1-receptor antagonist. The chemical structure is shown below:

[[Image:Cetirizine structure.gif]]

This chemical compound is a white, crystalline powder and is water soluble, it is mainly used in medical treatment of allergies, hay fever, angioedema, and urticaria. ZYRTEC tablets(the active component of the chemical compound)are formulated as white, film-coated, rounded-off rectangular shaped tablets for oral administration and are available in 5 and 10 mg strengths.

</noinclude>{| class="toccolours" border="1" style="float: right; clear: right; margin: 0 0 1em 1em; border-collapse: collapse; width: 280px"
! {{chembox header}} | {{PAGENAME}} 
|-
! {{chembox header}} | General
|-
| [http://en.wikipedia.org/wiki/IUPAC Systematic name]
| (±) - [2- [4- [ (4-chlorophenyl)phenylmethyl] -1- piperazinyl] ethoxy]acetic acid dihydrochloride
|-
| [http://en.wikipedia.org/wiki/Chemical_formula Molecular formula]
| C21H25ClN2O3
|-
| [http://en.wikipedia.org/wiki/Chemical_file_format SMILES] 
| C1CN(CCN1CCOCC(=O)O)C(C2=CC=CC=C2)C3=CC=C(C=C3)Cl
|-
| [http://en.wikipedia.org/wiki/Molar_mass Molar mass]
| 388.89g/mol
|-
| [http://en.wikipedia.org/wiki/Percentage_composition Percentage composition]
| C 64.86%, H 6.48%, Cl 9.12%, N 7.20%, O 12.34%
|-
| Appearance
| White Crystalline powder, water soluble
|-
| [http://en.wikipedia.org/wiki/CAS_registry_number CAS number]
| 83881-51-0
|-
| [http://en.wikipedia.org/wiki/Synonyms]
| Alatrol, Cetirizina MERCK, Cetzine Glaxo, Cetirizin, Humex, Letizen, Razene, Reactine, Zyrtec, Zirtec, Zodac, Zirtek, Zynor, Zyrlek
|-
| [http://en.wikipedia.org/wiki/Boiling_point Boiling point]
|
|-
| [http://en.wikipedia.org/wiki/Melting_point Melting point]
|110-115°(for crystals from ethanol)
|-
| [http://en.wikipedia.org/wiki/Refractive_Index Refractive index]
|
|-
| [http://en.wikipedia.org/wiki/Bioavailability]
| Well absorbed
|-
|[http://en.wikipedia.org/wiki/Protein_Binding]
| 93% avg
|-
| [[Material safety data sheet|MSDS]]
| [[{{PAGENAME}} (data page)#Material Safety Data Sheet|External MSDS]] 
|-
| [[Risk and Safety Statements|R/S statement]]
| [[List of R-phrases|R]]: {{{R-S}}} <br /> [[List of S-phrases|S]]: ?
|-
! {{chembox header}} | [[{{PAGENAME}} (data page)|Supplementary data page]]
|-
| [[{{PAGENAME}} (data page)#Structure and properties|Structure and<br />properties]]
| [http://en.wikipedia.org/wiki/Refractive_index ''n''], [http://en.wikipedia.org/wiki/Dielectric_constant ε<sub>r</sub>], etc.
|-
| [[{{PAGENAME}} (data page)#Thermodynamic properties|Thermodynamic<br />data]]
| Phase behaviour<br />Solid, liquid, gas
|-

|-
! {{chembox header}} | Related compounds
|-
| Other [[Ion|anion]]s 
| {{{Other_anion}}} 
|-
| Other [[Ion|cation]]s 
| {{{Ohter_cation}}} 
|-
| Related compounds

| {{{Relative_Compounds}}}
|-
| {{chembox header}} | <small>Except where noted otherwise, data are given for<br /> materials in their [[standard state|standard state (at 25 °C, 100 kPa)]]<br />[[wikipedia:Chemical infobox|Infobox disclaimer and references]]</small>
|-
<jmol>
<jmolApplet>
<size>200</size>
<color>white</color>
<script>zoom 80; cpk on;frame 1; move 10 -20 10 0 0 0 0 0 3; delay 1;</script>
<inlineContents>Cetirizine_3d.mol
title1
title2
52 54 0 0 1 V2000
1.8720 -0.7280 1.2200 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7520 -1.1400 0.2680 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.4120 -0.2680 0.4680 N 0 0 0 0 0 0 0 0 0 0 0 0
0.0200 1.0960 0.1560 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1400 1.5080 1.1120 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3040 0.6400 0.9120 N 0 0 0 0 0 0 0 0 0 0 0 0
3.2920 1.0120 1.9360 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6240 0.3240 1.6360 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1520 0.8200 0.4040 O 0 0 0 0 0 0 0 0 0 0 0 0
6.3880 0.1400 0.1800 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9960 0.6200 -1.1080 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4320 1.4600 -1.7720 O 0 0 0 0 0 0 0 0 0 0 0 0
8.1720 0.1200 -1.5280 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.3960 -0.6440 -0.5520 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.8320 -2.0680 -0.3360 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.9280 -2.9320 -1.4080 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3280 -4.2400 -1.2080 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6280 -4.6880 0.0600 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5240 -3.8240 1.1360 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1240 -2.5160 0.9360 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5920 0.2640 -0.4520 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.1960 0.7400 -1.6000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.2960 1.5760 -1.5080 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.7880 1.9360 -0.2680 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.1840 1.4560 0.8800 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.0920 0.6160 0.7880 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.1680 2.9840 -0.1520 Cl 0 0 0 0 0 0 0 0 0 0 0 0
1.5080 -0.7680 2.2480 H 0 0 0 0 0 0 0 0 0 0 0 0
2.7160 -1.4080 1.1080 H 0 0 0 0 0 0 0 0 0 0 0 0
1.1000 -1.0480 -0.7600 H 0 0 0 0 0 0 0 0 0 0 0 0
0.4720 -2.1760 0.4640 H 0 0 0 0 0 0 0 0 0 0 0 0
0.3840 1.1360 -0.8680 H 0 0 0 0 0 0 0 0 0 0 0 0
-0.8200 1.7760 0.2720 H 0 0 0 0 0 0 0 0 0 0 0 0
1.4200 2.5440 0.9120 H 0 0 0 0 0 0 0 0 0 0 0 0
0.7920 1.4200 2.1400 H 0 0 0 0 0 0 0 0 0 0 0 0
3.4320 2.0920 1.9280 H 0 0 0 0 0 0 0 0 0 0 0 0
2.9320 0.7000 2.9160 H 0 0 0 0 0 0 0 0 0 0 0 0
5.3280 0.5280 2.4400 H 0 0 0 0 0 0 0 0 0 0 0 0
4.4640 -0.7520 1.5560 H 0 0 0 0 0 0 0 0 0 0 0 0
7.0720 0.3480 1.0040 H 0 0 0 0 0 0 0 0 0 0 0 0
6.2080 -0.9280 0.1160 H 0 0 0 0 0 0 0 0 0 0 0 0
8.5640 0.4280 -2.3560 H 0 0 0 0 0 0 0 0 0 0 0 0
-0.9480 -0.5440 -1.5400 H 0 0 0 0 0 0 0 0 0 0 0 0
-1.6960 -2.5840 -2.4040 H 0 0 0 0 0 0 0 0 0 0 0 0
-2.4080 -4.9160 -2.0480 H 0 0 0 0 0 0 0 0 0 0 0 0
-2.9400 -5.7080 0.2160 H 0 0 0 0 0 0 0 0 0 0 0 0
-2.7600 -4.1720 2.1320 H 0 0 0 0 0 0 0 0 0 0 0 0
-2.0440 -1.8400 1.7760 H 0 0 0 0 0 0 0 0 0 0 0 0
-2.8120 0.4640 -2.5680 H 0 0 0 0 0 0 0 0 0 0 0 0
-4.7680 1.9480 -2.4040 H 0 0 0 0 0 0 0 0 0 0 0 0
-4.5720 1.7360 1.8480 H 0 0 0 0 0 0 0 0 0 0 0 0
-2.6200 0.2440 1.6840 H 0 0 0 0 0 0 0 0 0 0 0 0
26 52 1 0
25 51 1 0
25 26 1 0
24 27 1 0
24 25 1 0
23 50 1 0
23 24 1 0
22 49 1 0
22 23 1 0
21 22 1 0
21 26 1 0
20 48 1 0
19 47 1 0
19 20 1 0
18 46 1 0
18 19 1 0
17 45 1 0
17 18 1 0
16 44 1 0
16 17 1 0
15 16 1 0
15 20 1 0
14 43 1 0
14 21 1 0
14 15 1 0
13 42 1 0
11 13 1 0
11 12 1 0
10 41 1 0
10 40 1 0
10 11 1 0
9 10 1 0
8 39 1 0
8 38 1 0
8 9 1 0
7 37 1 0
7 36 1 0
7 8 1 0
6 7 1 0
5 35 1 0
5 34 1 0
5 6 1 0
4 33 1 0
4 32 1 0
4 5 1 0
3 14 1 0
3 4 1 0
2 31 1 0
2 30 1 0
2 3 1 0
1 29 1 0
1 28 1 0
1 2 1 0
1 6 1 0
M END</inlineContents>
</jmolApplet>
</jmol>