ChemWiki - User contributions [en]

It:methylpentynol

2006-10-24T13:05:14Z

Ls105: /* References */

==Methyl pentynol==

'''Methyl pentynol''', otherwise known by its trade name Oblivon, is a central nervous system suppressant. It is used as a tranquilliser though not recommended as an animal anaesthetic due to the strength of the drug.
<br>[[image:methylpentynol.gif|thumb|left|400]]
<jmol>
<jmolApplet>
<size>400</size>
<color>white</color>
<script>zoom 80; cpk on;frame 1; move 10 -20 10 0 0 0 0 0 3; delay 1;</script>
<inlineContents>7465.pdb
HEADER NONAME 24-Oct-06 NONE 1
TITLE NONE 2
AUTHOR WWW daemon apache NONE 3
REVDAT 1 24-Oct-06 0 NONE 4
ATOM 1 C 0 2.309 0.556 0.088 0.00 0.00 C+0
ATOM 2 C 0 0.850 1.011 0.164 0.00 0.00 C+0
ATOM 3 C 0 -0.071 -0.197 -0.021 0.00 0.00 C+0
ATOM 4 C 0 0.203 -1.221 1.082 0.00 0.00 C+0
ATOM 5 C 0 -1.475 0.240 0.053 0.00 0.00 C+0
ATOM 6 C 0 -2.594 0.589 0.111 0.00 0.00 C+0
ATOM 7 O 0 0.176 -0.793 -1.296 0.00 0.00 O+0
ATOM 8 H 0 2.504 -0.174 0.874 0.00 0.00 H+0
ATOM 9 H 0 2.497 0.101 -0.885 0.00 0.00 H+0
ATOM 10 H 0 2.965 1.416 0.220 0.00 0.00 H+0
ATOM 11 H 0 0.662 1.465 1.137 0.00 0.00 H+0
ATOM 12 H 0 0.655 1.740 -0.622 0.00 0.00 H+0
ATOM 13 H 0 0.014 -0.766 2.055 0.00 0.00 H+0
ATOM 14 H 0 -0.454 -2.082 0.950 0.00 0.00 H+0
ATOM 15 H 0 1.242 -1.545 1.028 0.00 0.00 H+0
ATOM 16 H 0 -3.595 0.901 0.164 0.00 0.00 H+0
ATOM 17 H 0 -0.008 -0.116 -1.961 0.00 0.00 H+0
CONECT 1 2 8 9 10 NONE 22
CONECT 2 1 3 11 12 NONE 23
CONECT 3 2 4 5 7 NONE 24
CONECT 4 3 13 14 15 NONE 25
CONECT 5 3 6 0 0 NONE 26
CONECT 6 5 16 0 0 NONE 27
CONECT 7 3 17 0 0 NONE 28
END NONE 29
</inlineContents>
</jmolApplet>
</jmol>
{| class="toccolours" border="1" style="float: center; clear: center; margin: 0 0 1em 1em; border-collapse: collapse;"
! {{chembox header}} colspan="3" |Synthesis of methyl pentynol
|-
| align="center" colspan="3" bgcolor="#ffffff" | [[Image:reactions2.gif]]
|}
==Physical Properties==
<div align="left"><br>
{| border="1"
|-
! Iupac name
| ''3-Methyl-1-pentyn-3-ol''
|-
! Molecular Formula
| C<sub>6</sub>H<sub>10</sub>O
|-
! Molecular Weight
| 98.14g mol<sup>-1</sup>
|-
! Density
| 0.866 g/mL at 25 °C
|-
! Boiling Point
| 121-122 °C
|-
|}
==References==
*Stuart Warren, Organic Synthesis - The Disconnection Approach, page 127
*http://www.sigmaaldrich.com
*http://www.nature.com

It:methylpentynol

2006-10-24T13:04:57Z

Ls105:

It:methylpentynol

2006-10-24T13:02:39Z

Ls105:

==Methyl pentynol==

Methyl pentynol, otherwise known by its trade name Oblivon, is a central nervous system suppressant. It is used as a tranquilliser though not recommended as an animal anaesthetic due to the strength of the drug.
<br>[[image:methylpentynol.gif|thumb|left|400]]
<jmol>
<jmolApplet>
<size>400</size>
<color>white</color>
<script>zoom 80; cpk on;frame 1; move 10 -20 10 0 0 0 0 0 3; delay 1;</script>
<inlineContents>7465.pdb
HEADER NONAME 24-Oct-06 NONE 1
TITLE NONE 2
AUTHOR WWW daemon apache NONE 3
REVDAT 1 24-Oct-06 0 NONE 4
ATOM 1 C 0 2.309 0.556 0.088 0.00 0.00 C+0
ATOM 2 C 0 0.850 1.011 0.164 0.00 0.00 C+0
ATOM 3 C 0 -0.071 -0.197 -0.021 0.00 0.00 C+0
ATOM 4 C 0 0.203 -1.221 1.082 0.00 0.00 C+0
ATOM 5 C 0 -1.475 0.240 0.053 0.00 0.00 C+0
ATOM 6 C 0 -2.594 0.589 0.111 0.00 0.00 C+0
ATOM 7 O 0 0.176 -0.793 -1.296 0.00 0.00 O+0
ATOM 8 H 0 2.504 -0.174 0.874 0.00 0.00 H+0
ATOM 9 H 0 2.497 0.101 -0.885 0.00 0.00 H+0
ATOM 10 H 0 2.965 1.416 0.220 0.00 0.00 H+0
ATOM 11 H 0 0.662 1.465 1.137 0.00 0.00 H+0
ATOM 12 H 0 0.655 1.740 -0.622 0.00 0.00 H+0
ATOM 13 H 0 0.014 -0.766 2.055 0.00 0.00 H+0
ATOM 14 H 0 -0.454 -2.082 0.950 0.00 0.00 H+0
ATOM 15 H 0 1.242 -1.545 1.028 0.00 0.00 H+0
ATOM 16 H 0 -3.595 0.901 0.164 0.00 0.00 H+0
ATOM 17 H 0 -0.008 -0.116 -1.961 0.00 0.00 H+0
CONECT 1 2 8 9 10 NONE 22
CONECT 2 1 3 11 12 NONE 23
CONECT 3 2 4 5 7 NONE 24
CONECT 4 3 13 14 15 NONE 25
CONECT 5 3 6 0 0 NONE 26
CONECT 6 5 16 0 0 NONE 27
CONECT 7 3 17 0 0 NONE 28
END NONE 29
</inlineContents>
</jmolApplet>
</jmol>
{| class="toccolours" border="1" style="float: center; clear: center; margin: 0 0 1em 1em; border-collapse: collapse;"
! {{chembox header}} colspan="3" |Synthesis of methyl pentynol
|-
| align="center" colspan="3" bgcolor="#ffffff" | [[Image:reactions2.gif]]
|}
==Physical Properties==
<div align="left"><br>
{| border="1"
|-
! Iupac name
| 3-Methyl-1-pentyn-3-ol
|-
! Molecular Formula
| C<sub>6</sub>H<sub>10</sub>O
|-
! Molecular Weight
| 98.14g mol<sup>-1</sup>
|-
! Density
| 0.866 g/mL at 25 °C
|-
! Boiling Point
| 121-122 °C
|-
|}

It:methylpentynol

2006-10-24T12:45:52Z

Ls105:

==PENISOL==

Methyl pentynol, otherwise known by its trade name Oblivon, is a central nervous system suppressant. It is used as a tranquilliser though not recommended as an animal anaesthetic due to the strength of the drug.
<br>[[image:methylpentynol.gif|thumb|left|400]]
<jmol>
<jmolApplet>
<size>400</size>
<color>white</color>
<script>zoom 80; cpk on;frame 1; move 10 -20 10 0 0 0 0 0 3; delay 1;</script>
<inlineContents>7465.pdb
HEADER NONAME 24-Oct-06 NONE 1
TITLE NONE 2
AUTHOR WWW daemon apache NONE 3
REVDAT 1 24-Oct-06 0 NONE 4
ATOM 1 C 0 2.309 0.556 0.088 0.00 0.00 C+0
ATOM 2 C 0 0.850 1.011 0.164 0.00 0.00 C+0
ATOM 3 C 0 -0.071 -0.197 -0.021 0.00 0.00 C+0
ATOM 4 C 0 0.203 -1.221 1.082 0.00 0.00 C+0
ATOM 5 C 0 -1.475 0.240 0.053 0.00 0.00 C+0
ATOM 6 C 0 -2.594 0.589 0.111 0.00 0.00 C+0
ATOM 7 O 0 0.176 -0.793 -1.296 0.00 0.00 O+0
ATOM 8 H 0 2.504 -0.174 0.874 0.00 0.00 H+0
ATOM 9 H 0 2.497 0.101 -0.885 0.00 0.00 H+0
ATOM 10 H 0 2.965 1.416 0.220 0.00 0.00 H+0
ATOM 11 H 0 0.662 1.465 1.137 0.00 0.00 H+0
ATOM 12 H 0 0.655 1.740 -0.622 0.00 0.00 H+0
ATOM 13 H 0 0.014 -0.766 2.055 0.00 0.00 H+0
ATOM 14 H 0 -0.454 -2.082 0.950 0.00 0.00 H+0
ATOM 15 H 0 1.242 -1.545 1.028 0.00 0.00 H+0
ATOM 16 H 0 -3.595 0.901 0.164 0.00 0.00 H+0
ATOM 17 H 0 -0.008 -0.116 -1.961 0.00 0.00 H+0
CONECT 1 2 8 9 10 NONE 22
CONECT 2 1 3 11 12 NONE 23
CONECT 3 2 4 5 7 NONE 24
CONECT 4 3 13 14 15 NONE 25
CONECT 5 3 6 0 0 NONE 26
CONECT 6 5 16 0 0 NONE 27
CONECT 7 3 17 0 0 NONE 28
END NONE 29
</inlineContents>
</jmolApplet>
</jmol>
{| class="toccolours" border="1" style="float: center; clear: center; margin: 0 0 1em 1em; border-collapse: collapse;"
! {{chembox header}} colspan="3" |Synthesis of methyl pentynol
|-
| align="center" colspan="3" bgcolor="#ffffff" | [[Image:reactions2.gif]]
|}
==Physical Properties==
<div align="left"><br>
{| border="1"
|-
! Iupac name
| 3-Methyl-1-pentyn-3-ol
|-
! Molecular Formula
| C<sub>6</sub>H<sub>10</sub>O
|-
! Molecular Weight
| 98.14g mol<sup>-1</sup>
|-
! Density
| 0.866 g/mL at 25 °C
|-
! Boiling Point
| 121-122 °C
|-
|}

It:methylpentynol

2006-10-24T12:41:16Z

Ls105: /* Physical Properties */

==PENISOL==

Methyl pentynol, otherwise known by its trade name Oblivon, is a central nervous system suppressant. It is used as a tranquilliser though not recommended as an animal anaesthetic due to the strength of the drug.
<br>[[image:methylpentynol.gif|thumb|left|400]]
<jmol>
<jmolApplet>
<size>400</size>
<color>white</color>
<script>zoom 80; cpk on;frame 1; move 10 -20 10 0 0 0 0 0 3; delay 1;</script>
<inlineContents>7465.pdb
HEADER NONAME 24-Oct-06 NONE 1
TITLE NONE 2
AUTHOR WWW daemon apache NONE 3
REVDAT 1 24-Oct-06 0 NONE 4
ATOM 1 C 0 2.309 0.556 0.088 0.00 0.00 C+0
ATOM 2 C 0 0.850 1.011 0.164 0.00 0.00 C+0
ATOM 3 C 0 -0.071 -0.197 -0.021 0.00 0.00 C+0
ATOM 4 C 0 0.203 -1.221 1.082 0.00 0.00 C+0
ATOM 5 C 0 -1.475 0.240 0.053 0.00 0.00 C+0
ATOM 6 C 0 -2.594 0.589 0.111 0.00 0.00 C+0
ATOM 7 O 0 0.176 -0.793 -1.296 0.00 0.00 O+0
ATOM 8 H 0 2.504 -0.174 0.874 0.00 0.00 H+0
ATOM 9 H 0 2.497 0.101 -0.885 0.00 0.00 H+0
ATOM 10 H 0 2.965 1.416 0.220 0.00 0.00 H+0
ATOM 11 H 0 0.662 1.465 1.137 0.00 0.00 H+0
ATOM 12 H 0 0.655 1.740 -0.622 0.00 0.00 H+0
ATOM 13 H 0 0.014 -0.766 2.055 0.00 0.00 H+0
ATOM 14 H 0 -0.454 -2.082 0.950 0.00 0.00 H+0
ATOM 15 H 0 1.242 -1.545 1.028 0.00 0.00 H+0
ATOM 16 H 0 -3.595 0.901 0.164 0.00 0.00 H+0
ATOM 17 H 0 -0.008 -0.116 -1.961 0.00 0.00 H+0
CONECT 1 2 8 9 10 NONE 22
CONECT 2 1 3 11 12 NONE 23
CONECT 3 2 4 5 7 NONE 24
CONECT 4 3 13 14 15 NONE 25
CONECT 5 3 6 0 0 NONE 26
CONECT 6 5 16 0 0 NONE 27
CONECT 7 3 17 0 0 NONE 28
END NONE 29
</inlineContents>
</jmolApplet>
</jmol>
{| class="toccolours" border="1" style="float: center; clear: center; margin: 0 0 1em 1em; border-collapse: collapse;"
! {{chembox header}} colspan="3" |Synthesis of methyl pentynol
|-
| align="center" colspan="3" bgcolor="#ffffff" | [[Image:reactions2.gif]]
|}
==Physical Properties==
<div align="left"><br>
{| border="1"
|-
! Iupac name
| 3-Methyl-1-pentyn-3-ol
|-
! Molecular Formula
| C<sub>6</sub>H<sub>10</sub>O
|-
! Molecular Weight
| 756.93
|-
! Stereo or non-stereo
| Stereo compound
|-
! Class of substance
| Heterocyclic
|-
|}

It:methylpentynol

2006-10-24T12:34:02Z

Ls105:

==PENISOL==

Methyl pentynol, otherwise known by its trade name Oblivon, is a central nervous system suppressant. It is used as a tranquilliser though not recommended as an animal anaesthetic due to the strength of the drug.
<br>[[image:methylpentynol.gif|thumb|left|400]]
<jmol>
<jmolApplet>
<size>400</size>
<color>white</color>
<script>zoom 80; cpk on;frame 1; move 10 -20 10 0 0 0 0 0 3; delay 1;</script>
<inlineContents>7465.pdb
HEADER NONAME 24-Oct-06 NONE 1
TITLE NONE 2
AUTHOR WWW daemon apache NONE 3
REVDAT 1 24-Oct-06 0 NONE 4
ATOM 1 C 0 2.309 0.556 0.088 0.00 0.00 C+0
ATOM 2 C 0 0.850 1.011 0.164 0.00 0.00 C+0
ATOM 3 C 0 -0.071 -0.197 -0.021 0.00 0.00 C+0
ATOM 4 C 0 0.203 -1.221 1.082 0.00 0.00 C+0
ATOM 5 C 0 -1.475 0.240 0.053 0.00 0.00 C+0
ATOM 6 C 0 -2.594 0.589 0.111 0.00 0.00 C+0
ATOM 7 O 0 0.176 -0.793 -1.296 0.00 0.00 O+0
ATOM 8 H 0 2.504 -0.174 0.874 0.00 0.00 H+0
ATOM 9 H 0 2.497 0.101 -0.885 0.00 0.00 H+0
ATOM 10 H 0 2.965 1.416 0.220 0.00 0.00 H+0
ATOM 11 H 0 0.662 1.465 1.137 0.00 0.00 H+0
ATOM 12 H 0 0.655 1.740 -0.622 0.00 0.00 H+0
ATOM 13 H 0 0.014 -0.766 2.055 0.00 0.00 H+0
ATOM 14 H 0 -0.454 -2.082 0.950 0.00 0.00 H+0
ATOM 15 H 0 1.242 -1.545 1.028 0.00 0.00 H+0
ATOM 16 H 0 -3.595 0.901 0.164 0.00 0.00 H+0
ATOM 17 H 0 -0.008 -0.116 -1.961 0.00 0.00 H+0
CONECT 1 2 8 9 10 NONE 22
CONECT 2 1 3 11 12 NONE 23
CONECT 3 2 4 5 7 NONE 24
CONECT 4 3 13 14 15 NONE 25
CONECT 5 3 6 0 0 NONE 26
CONECT 6 5 16 0 0 NONE 27
CONECT 7 3 17 0 0 NONE 28
END NONE 29
</inlineContents>
</jmolApplet>
</jmol>
{| class="toccolours" border="1" style="float: center; clear: center; margin: 0 0 1em 1em; border-collapse: collapse;"
! {{chembox header}} colspan="3" |Synthesis of methyl pentynol
|-
| align="center" colspan="3" bgcolor="#ffffff" | [[Image:reactions2.gif]]
|}
==Physical Properties==
<div align="left"><br>
{| border="1"
|-
! Chemical name
| Bufotalin-3-suberoylargininester
|-
! Autoname/Iupac name
| 7-(1-carboxy-4-guanidino-butylcarbamoyl)-heptanoic acid 16-acetoxy-14-hydroxy-10,13-dimethyl-17-(6-oxo-6H-pyran-3-yl)-hexadecahydro-cyclopenta[a]phenanthren-3-yl ester
|-
! Molecular Formula
| C<sub>40</sub>H<sub>60</sub>N<sub>4</sub>O<sub>10</sub>
|-
! Molecular Weight
| 756.93
|-
! Stereo or non-stereo
| Stereo compound
|-
! Class of substance
| Heterocyclic
|-
|}

It:methylpentynol

2006-10-24T12:15:54Z

Ls105:

It:methylpentynol

2006-10-24T12:13:45Z

Ls105:

==PENISOL==

Methyl pentynol, otherwise known by its trade name Oblivon, is a central nervous system suppressant. It is used as a tranquilliser though not recommended as an animal anaesthetic due to the strength of the drug.
<br>[[image:methylpentynol.gif|thumb|left|200]]
<jmol>
<jmolApplet>
<size>200</size>
<color>white</color>
<script>zoom 80; cpk on;frame 1; move 10 -20 10 0 0 0 0 0 3; delay 1;</script>
<inlineContents>7465.pdb
HEADER NONAME 24-Oct-06 NONE 1
TITLE NONE 2
AUTHOR WWW daemon apache NONE 3
REVDAT 1 24-Oct-06 0 NONE 4
ATOM 1 C 0 2.309 0.556 0.088 0.00 0.00 C+0
ATOM 2 C 0 0.850 1.011 0.164 0.00 0.00 C+0
ATOM 3 C 0 -0.071 -0.197 -0.021 0.00 0.00 C+0
ATOM 4 C 0 0.203 -1.221 1.082 0.00 0.00 C+0
ATOM 5 C 0 -1.475 0.240 0.053 0.00 0.00 C+0
ATOM 6 C 0 -2.594 0.589 0.111 0.00 0.00 C+0
ATOM 7 O 0 0.176 -0.793 -1.296 0.00 0.00 O+0
ATOM 8 H 0 2.504 -0.174 0.874 0.00 0.00 H+0
ATOM 9 H 0 2.497 0.101 -0.885 0.00 0.00 H+0
ATOM 10 H 0 2.965 1.416 0.220 0.00 0.00 H+0
ATOM 11 H 0 0.662 1.465 1.137 0.00 0.00 H+0
ATOM 12 H 0 0.655 1.740 -0.622 0.00 0.00 H+0
ATOM 13 H 0 0.014 -0.766 2.055 0.00 0.00 H+0
ATOM 14 H 0 -0.454 -2.082 0.950 0.00 0.00 H+0
ATOM 15 H 0 1.242 -1.545 1.028 0.00 0.00 H+0
ATOM 16 H 0 -3.595 0.901 0.164 0.00 0.00 H+0
ATOM 17 H 0 -0.008 -0.116 -1.961 0.00 0.00 H+0
CONECT 1 2 8 9 10 NONE 22
CONECT 2 1 3 11 12 NONE 23
CONECT 3 2 4 5 7 NONE 24
CONECT 4 3 13 14 15 NONE 25
CONECT 5 3 6 0 0 NONE 26
CONECT 6 5 16 0 0 NONE 27
CONECT 7 3 17 0 0 NONE 28
END NONE 29
</inlineContents>
</jmolApplet>
</jmol>
{| class="toccolours" border="1" style="float: center; clear: center; margin: 0 0 1em 1em; border-collapse: collapse;"
! {{chembox header}} colspan="3" |Synthesis of methyl pentynol
|-
| align="center" colspan="3" bgcolor="#ffffff" | [[Image:reactions2.gif]]

File:Reactions2.gif

2006-10-24T12:12:47Z

Ls105:

It:methylpentynol

2006-10-24T12:12:37Z

Ls105:

==PENISOL==

Methyl pentynol, otherwise known by its trade name Oblivon, is a central nervous system suppressant. It is used as a tranquilliser though not recommended as an animal anaesthetic due to the strength of the drug.
<br>[[image:methylpentynol.gif|thumb|left|200]]
<jmol>
<jmolApplet>
<size>200</size>
<color>white</color>
<script>zoom 80; cpk on;frame 1; move 10 -20 10 0 0 0 0 0 3; delay 1;</script>
<inlineContents>7465.pdb
HEADER NONAME 24-Oct-06 NONE 1
TITLE NONE 2
AUTHOR WWW daemon apache NONE 3
REVDAT 1 24-Oct-06 0 NONE 4
ATOM 1 C 0 2.309 0.556 0.088 0.00 0.00 C+0
ATOM 2 C 0 0.850 1.011 0.164 0.00 0.00 C+0
ATOM 3 C 0 -0.071 -0.197 -0.021 0.00 0.00 C+0
ATOM 4 C 0 0.203 -1.221 1.082 0.00 0.00 C+0
ATOM 5 C 0 -1.475 0.240 0.053 0.00 0.00 C+0
ATOM 6 C 0 -2.594 0.589 0.111 0.00 0.00 C+0
ATOM 7 O 0 0.176 -0.793 -1.296 0.00 0.00 O+0
ATOM 8 H 0 2.504 -0.174 0.874 0.00 0.00 H+0
ATOM 9 H 0 2.497 0.101 -0.885 0.00 0.00 H+0
ATOM 10 H 0 2.965 1.416 0.220 0.00 0.00 H+0
ATOM 11 H 0 0.662 1.465 1.137 0.00 0.00 H+0
ATOM 12 H 0 0.655 1.740 -0.622 0.00 0.00 H+0
ATOM 13 H 0 0.014 -0.766 2.055 0.00 0.00 H+0
ATOM 14 H 0 -0.454 -2.082 0.950 0.00 0.00 H+0
ATOM 15 H 0 1.242 -1.545 1.028 0.00 0.00 H+0
ATOM 16 H 0 -3.595 0.901 0.164 0.00 0.00 H+0
ATOM 17 H 0 -0.008 -0.116 -1.961 0.00 0.00 H+0
CONECT 1 2 8 9 10 NONE 22
CONECT 2 1 3 11 12 NONE 23
CONECT 3 2 4 5 7 NONE 24
CONECT 4 3 13 14 15 NONE 25
CONECT 5 3 6 0 0 NONE 26
CONECT 6 5 16 0 0 NONE 27
CONECT 7 3 17 0 0 NONE 28
END NONE 29
</inlineContents>
</jmolApplet>
</jmol>
{| class="toccolours" border="1" style="float: right; clear: right; margin: 0 0 1em 1em; border-collapse: collapse;"
! {{chembox header}} colspan="3" |Synthesis of methyl pentynol
|-
| align="center" colspan="3" bgcolor="#ffffff" | [[Image:reactions2.gif]]
|-
! {{chembox header}} colspan="3" |3D structure of Rapamycin
|-
| align="center" colspan="3" bgcolor="#ffffff" |

It:methylpentynol

2006-10-24T12:11:34Z

Ls105:

==PENISOL==

Methyl pentynol, otherwise known by its trade name Oblivon, is a central nervous system suppressant. It is used as a tranquilliser though not recommended as an animal anaesthetic due to the strength of the drug.
<br>[[image:methylpentynol.gif|thumb|left|200]]
<jmol>
<jmolApplet>
<size>200</size>
<color>white</color>
<script>zoom 80; cpk on;frame 1; move 10 -20 10 0 0 0 0 0 3; delay 1;</script>
<inlineContents>7465.pdb
HEADER NONAME 24-Oct-06 NONE 1
TITLE NONE 2
AUTHOR WWW daemon apache NONE 3
REVDAT 1 24-Oct-06 0 NONE 4
ATOM 1 C 0 2.309 0.556 0.088 0.00 0.00 C+0
ATOM 2 C 0 0.850 1.011 0.164 0.00 0.00 C+0
ATOM 3 C 0 -0.071 -0.197 -0.021 0.00 0.00 C+0
ATOM 4 C 0 0.203 -1.221 1.082 0.00 0.00 C+0
ATOM 5 C 0 -1.475 0.240 0.053 0.00 0.00 C+0
ATOM 6 C 0 -2.594 0.589 0.111 0.00 0.00 C+0
ATOM 7 O 0 0.176 -0.793 -1.296 0.00 0.00 O+0
ATOM 8 H 0 2.504 -0.174 0.874 0.00 0.00 H+0
ATOM 9 H 0 2.497 0.101 -0.885 0.00 0.00 H+0
ATOM 10 H 0 2.965 1.416 0.220 0.00 0.00 H+0
ATOM 11 H 0 0.662 1.465 1.137 0.00 0.00 H+0
ATOM 12 H 0 0.655 1.740 -0.622 0.00 0.00 H+0
ATOM 13 H 0 0.014 -0.766 2.055 0.00 0.00 H+0
ATOM 14 H 0 -0.454 -2.082 0.950 0.00 0.00 H+0
ATOM 15 H 0 1.242 -1.545 1.028 0.00 0.00 H+0
ATOM 16 H 0 -3.595 0.901 0.164 0.00 0.00 H+0
ATOM 17 H 0 -0.008 -0.116 -1.961 0.00 0.00 H+0
CONECT 1 2 8 9 10 NONE 22
CONECT 2 1 3 11 12 NONE 23
CONECT 3 2 4 5 7 NONE 24
CONECT 4 3 13 14 15 NONE 25
CONECT 5 3 6 0 0 NONE 26
CONECT 6 5 16 0 0 NONE 27
CONECT 7 3 17 0 0 NONE 28
END NONE 29
</inlineContents>
</jmolApplet>
</jmol>
{| class="toccolours" border="1" style="float: right; clear: right; margin: 0 0 1em 1em; border-collapse: collapse;"
! {{chembox header}} colspan="3" |2D Structure of Rapamycin
|-
| align="center" colspan="3" bgcolor="#ffffff" | [[Image:rapa2d.JPG|200|2D structure of Rapamycin|200|2D structure of Rapamycin]]
|-
! {{chembox header}} colspan="3" |3D structure of Rapamycin
|-
| align="center" colspan="3" bgcolor="#ffffff" | <jmol></jmol>

File:Reaction2.gif

2006-10-24T12:10:05Z

Ls105:

It:methylpentynol

2006-10-24T12:09:52Z

Ls105:

==PENISOL==

Methyl pentynol, otherwise known by its trade name Oblivon, is a central nervous system suppressant. It is used as a tranquilliser though not recommended as an animal anaesthetic due to the strength of the drug.
<br>[[image:methylpentynol.gif|thumb|left|200]]
<jmol>
<jmolApplet>
<size>200</size>
<color>white</color>
<script>zoom 80; cpk on;frame 1; move 10 -20 10 0 0 0 0 0 3; delay 1;</script>
<inlineContents>7465.pdb
HEADER NONAME 24-Oct-06 NONE 1
TITLE NONE 2
AUTHOR WWW daemon apache NONE 3
REVDAT 1 24-Oct-06 0 NONE 4
ATOM 1 C 0 2.309 0.556 0.088 0.00 0.00 C+0
ATOM 2 C 0 0.850 1.011 0.164 0.00 0.00 C+0
ATOM 3 C 0 -0.071 -0.197 -0.021 0.00 0.00 C+0
ATOM 4 C 0 0.203 -1.221 1.082 0.00 0.00 C+0
ATOM 5 C 0 -1.475 0.240 0.053 0.00 0.00 C+0
ATOM 6 C 0 -2.594 0.589 0.111 0.00 0.00 C+0
ATOM 7 O 0 0.176 -0.793 -1.296 0.00 0.00 O+0
ATOM 8 H 0 2.504 -0.174 0.874 0.00 0.00 H+0
ATOM 9 H 0 2.497 0.101 -0.885 0.00 0.00 H+0
ATOM 10 H 0 2.965 1.416 0.220 0.00 0.00 H+0
ATOM 11 H 0 0.662 1.465 1.137 0.00 0.00 H+0
ATOM 12 H 0 0.655 1.740 -0.622 0.00 0.00 H+0
ATOM 13 H 0 0.014 -0.766 2.055 0.00 0.00 H+0
ATOM 14 H 0 -0.454 -2.082 0.950 0.00 0.00 H+0
ATOM 15 H 0 1.242 -1.545 1.028 0.00 0.00 H+0
ATOM 16 H 0 -3.595 0.901 0.164 0.00 0.00 H+0
ATOM 17 H 0 -0.008 -0.116 -1.961 0.00 0.00 H+0
CONECT 1 2 8 9 10 NONE 22
CONECT 2 1 3 11 12 NONE 23
CONECT 3 2 4 5 7 NONE 24
CONECT 4 3 13 14 15 NONE 25
CONECT 5 3 6 0 0 NONE 26
CONECT 6 5 16 0 0 NONE 27
CONECT 7 3 17 0 0 NONE 28
END NONE 29
</inlineContents>
</jmolApplet>
</jmol>
<{| class="toccolours" border="1" style="float: right; clear: right; margin: 0 0 1em 1em; border-collapse: collapse;"
! {{chembox header}} colspan="3" |Synthesis of Methyl pentynol
|-
| align="center" colspan="3" bgcolor="#ffffff" | [[Image:reaction2.gif|200]]
|-

It:methylpentynol

2006-10-24T12:00:18Z

Ls105:

It:methylpentynol

2006-10-24T11:56:41Z

Ls105:

==Methyl pentynol==

Methyl pentynol, otherwise known by its trade name Oblivon, is a central nervous system suppressant. It is used as a tranquilliser though not recommended as an animal anaesthetic due to the strength of the drug.
<br>[[image:methylpentynol.gif|thumb|left|200]]
<jmol>
<jmolApplet>
<size>200</size>
<color>white</color>
<script>zoom 80; cpk on;frame 1; move 10 -20 10 0 0 0 0 0 3; delay 1;</script>
<inlineContents>7465.pdb
HEADER NONAME 24-Oct-06 NONE 1
TITLE NONE 2
AUTHOR WWW daemon apache NONE 3
REVDAT 1 24-Oct-06 0 NONE 4
ATOM 1 C 0 2.309 0.556 0.088 0.00 0.00 C+0
ATOM 2 C 0 0.850 1.011 0.164 0.00 0.00 C+0
ATOM 3 C 0 -0.071 -0.197 -0.021 0.00 0.00 C+0
ATOM 4 C 0 0.203 -1.221 1.082 0.00 0.00 C+0
ATOM 5 C 0 -1.475 0.240 0.053 0.00 0.00 C+0
ATOM 6 C 0 -2.594 0.589 0.111 0.00 0.00 C+0
ATOM 7 O 0 0.176 -0.793 -1.296 0.00 0.00 O+0
ATOM 8 H 0 2.504 -0.174 0.874 0.00 0.00 H+0
ATOM 9 H 0 2.497 0.101 -0.885 0.00 0.00 H+0
ATOM 10 H 0 2.965 1.416 0.220 0.00 0.00 H+0
ATOM 11 H 0 0.662 1.465 1.137 0.00 0.00 H+0
ATOM 12 H 0 0.655 1.740 -0.622 0.00 0.00 H+0
ATOM 13 H 0 0.014 -0.766 2.055 0.00 0.00 H+0
ATOM 14 H 0 -0.454 -2.082 0.950 0.00 0.00 H+0
ATOM 15 H 0 1.242 -1.545 1.028 0.00 0.00 H+0
ATOM 16 H 0 -3.595 0.901 0.164 0.00 0.00 H+0
ATOM 17 H 0 -0.008 -0.116 -1.961 0.00 0.00 H+0
CONECT 1 2 8 9 10 NONE 22
CONECT 2 1 3 11 12 NONE 23
CONECT 3 2 4 5 7 NONE 24
CONECT 4 3 13 14 15 NONE 25
CONECT 5 3 6 0 0 NONE 26
CONECT 6 5 16 0 0 NONE 27
CONECT 7 3 17 0 0 NONE 28
END NONE 29
</inlineContents>
</jmolApplet>
</jmol>

It:methylpentynol

2006-10-24T11:19:32Z

Ls105: /* Methyl pentynol */

It:methylpentynol

2006-10-24T11:19:18Z

Ls105: /* Methyl pentynol */

It:methylpentynol

2006-10-24T11:18:56Z

Ls105: /* Methyl pentynol */

File:Methylpentynol.gif

2006-10-24T10:55:09Z

Ls105:

It:methylpentynol

2006-10-24T10:54:53Z

Ls105: /* Methyl pentynol */

It:methylpentynol

2006-10-24T10:54:44Z

Ls105: /* Methyl pentynol */

It:methylpentynol

2006-10-24T10:53:19Z

Ls105:

It:chlorphentermine

2006-10-24T10:20:52Z

Ls105:

==Chlorphentermine==
'''Chlorphentermine''' is an anorectic (appetite suppressant) implicated in lipid storage disorders and pulmonary hypertension.
===Structure===

{| class="toccolours" border="1" style="float: right; clear: right; margin: 0 0 1em 1em; border-collapse: collapse;"
! {{chembox header}}| '''Chlorphentermine'''
|-
| [[IUPAC nomenclature|Chemical name]]
| ''1-(4-chlorophenyl)-2-methyl-propan-2-amine hydrochloride''
|-
| [[CAS nummber]]
| 151-06-4
|-
| [[Chemical formula]]
| {{{formula|C<sub>10</sub>H<sub>15</sub>Cl<sub>2</sub>N
|-
| [[Molecular mass]]
| {{{mol_mass|220.14g mol<sup>-1</sup>
|-
| [[Simplified molecular input line entry specification|SMILES]]
| CC(N)(C)CC1=CC=C(Cl)C=C1.[H]Cl
|-
|}

[[image:chlorphentermine.png|left]]
<jmol>
<jmolApplet>
<size>200</size>
<color>white</color>
<script>zoom 100; cpk on;frame 1; move 10 -20 10 0 0 0 0 0 3; delay 1;</script>
<inlineContents>32446.mol
3433
Chime 10230614293D
26 26 0 0 1 V2000
4.2640 -0.1120 0.1560 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7800 0.0080 -0.2040 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5520 1.3200 -0.9560 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3920 -1.1160 -1.0560 N 0 0 0 0 0 0 0 0 0 0 0 0
1.9400 0.0000 1.0720 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4760 0.0000 0.7080 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.1880 -1.1960 0.5320 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.5280 -1.2000 0.2000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.2040 0.0000 0.0440 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8880 -0.0040 -0.3680 Cl 0 0 0 0 0 0 0 0 0 0 0 0
-1.5360 1.1920 0.2200 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.1960 1.1920 0.5560 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5520 0.7200 0.7920 H 0 0 0 0 0 0 0 0 0 0 0 0
4.4280 -1.0480 0.6920 H 0 0 0 0 0 0 0 0 0 0 0 0
4.8640 -0.1040 -0.7480 H 0 0 0 0 0 0 0 0 0 0 0 0
3.1480 1.3280 -1.8640 H 0 0 0 0 0 0 0 0 0 0 0 0
1.4960 1.4120 -1.2120 H 0 0 0 0 0 0 0 0 0 0 0 0
2.8400 2.1600 -0.3200 H 0 0 0 0 0 0 0 0 0 0 0 0
3.0360 -1.1320 -1.8320 H 0 0 0 0 0 0 0 0 0 0 0 0
2.5600 -1.9560 -0.5240 H 0 0 0 0 0 0 0 0 0 0 0 0
2.1720 -0.8920 1.6520 H 0 0 0 0 0 0 0 0 0 0 0 0
2.1680 0.8840 1.6640 H 0 0 0 0 0 0 0 0 0 0 0 0
0.3360 -2.1320 0.6560 H 0 0 0 0 0 0 0 0 0 0 0 0
-2.0520 -2.1360 0.0640 H 0 0 0 0 0 0 0 0 0 0 0 0
-2.0600 2.1280 0.0960 H 0 0 0 0 0 0 0 0 0 0 0 0
0.3240 2.1280 0.6960 H 0 0 0 0 0 0 0 0 0 0 0 0
12 26 1 0
11 25 1 0
11 12 1 0
9 11 1 0
9 10 1 0
8 24 1 0
8 9 1 0
7 23 1 0
7 8 1 0
6 7 1 0
6 12 1 0
5 22 1 0
5 21 1 0
5 6 1 0
4 20 1 0
4 19 1 0
3 18 1 0
3 17 1 0
3 16 1 0
2 5 1 0
2 4 1 0
2 3 1 0
1 15 1 0
1 14 1 0
1 13 1 0
1 2 1 0
M END</inlineContents>
</jmolApplet>
</jmol>
<br>
<br>
<br>
<br>
==Synthesis==
The first step is performed under basic conditions. The second step is a catalysed reduction reaction.
[[image:reactions1.gif]]
==IR Spectrum==
[[image:IR1.gif]]

==Effects==
The effects of chlorphentermine on rats have been extensively studied. Chronic administration of chlorphentermine to rats resulted in a reduction of body weight compared to a normal control group. The weight of the heart, liver, kidney, and spleen was less in the treated group while the weight of the lungs was increased significantly.

==References==
* Stuart Warren, Organic Synthesis - The Disconnection Approach, page 180
* http://webbook.nist.gov/chemistry/

It:chlorphentermine

2006-10-24T10:15:38Z

Ls105: /* References */

It:chlorphentermine

2006-10-24T10:10:35Z

Ls105: /* Effects */

It:chlorphentermine

2006-10-23T15:29:49Z

Ls105:

It:chlorphentermine

2006-10-23T15:24:39Z

Ls105:

==Chlorphentermine==
'''Chlorphentermine''' is an anorectic (appetite suppressant) implicated in lipid storage disorders and pulmonary hypertension.
===Structure===

{| class="toccolours" border="1" style="float: right; clear: right; margin: 0 0 1em 1em; border-collapse: collapse;"
! {{chembox header}}| '''Chlorphentermine'''
|-
| [[IUPAC nomenclature|Chemical name]]
| ''1-(4-chlorophenyl)-2-methyl-propan-2-amine hydrochloride''
|-
| [[CAS nummber]]
| 151-06-4
|-
| [[Chemical formula]]
| {{{formula|C<sub>10</sub>H<sub>15</sub>Cl<sub>2</sub>N
|-
| [[Molecular mass]]
| {{{mol_mass|220.14g mol<sup>-1</sup>
|-
| [[Simplified molecular input line entry specification|SMILES]]
| CC(N)(C)CC1=CC=C(Cl)C=C1.[H]Cl
|-
|}

[[image:chlorphentermine.png|left]]
<jmol>
<jmolApplet>
<size>200</size>
<color>white</color>
<script>zoom 100; cpk on;frame 1; move 10 -20 10 0 0 0 0 0 3; delay 1;</script>
<inlineContents>32446.mol
3433
Chime 10230614293D
26 26 0 0 1 V2000
4.2640 -0.1120 0.1560 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7800 0.0080 -0.2040 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5520 1.3200 -0.9560 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3920 -1.1160 -1.0560 N 0 0 0 0 0 0 0 0 0 0 0 0
1.9400 0.0000 1.0720 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4760 0.0000 0.7080 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.1880 -1.1960 0.5320 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.5280 -1.2000 0.2000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.2040 0.0000 0.0440 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8880 -0.0040 -0.3680 Cl 0 0 0 0 0 0 0 0 0 0 0 0
-1.5360 1.1920 0.2200 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.1960 1.1920 0.5560 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5520 0.7200 0.7920 H 0 0 0 0 0 0 0 0 0 0 0 0
4.4280 -1.0480 0.6920 H 0 0 0 0 0 0 0 0 0 0 0 0
4.8640 -0.1040 -0.7480 H 0 0 0 0 0 0 0 0 0 0 0 0
3.1480 1.3280 -1.8640 H 0 0 0 0 0 0 0 0 0 0 0 0
1.4960 1.4120 -1.2120 H 0 0 0 0 0 0 0 0 0 0 0 0
2.8400 2.1600 -0.3200 H 0 0 0 0 0 0 0 0 0 0 0 0
3.0360 -1.1320 -1.8320 H 0 0 0 0 0 0 0 0 0 0 0 0
2.5600 -1.9560 -0.5240 H 0 0 0 0 0 0 0 0 0 0 0 0
2.1720 -0.8920 1.6520 H 0 0 0 0 0 0 0 0 0 0 0 0
2.1680 0.8840 1.6640 H 0 0 0 0 0 0 0 0 0 0 0 0
0.3360 -2.1320 0.6560 H 0 0 0 0 0 0 0 0 0 0 0 0
-2.0520 -2.1360 0.0640 H 0 0 0 0 0 0 0 0 0 0 0 0
-2.0600 2.1280 0.0960 H 0 0 0 0 0 0 0 0 0 0 0 0
0.3240 2.1280 0.6960 H 0 0 0 0 0 0 0 0 0 0 0 0
12 26 1 0
11 25 1 0
11 12 1 0
9 11 1 0
9 10 1 0
8 24 1 0
8 9 1 0
7 23 1 0
7 8 1 0
6 7 1 0
6 12 1 0
5 22 1 0
5 21 1 0
5 6 1 0
4 20 1 0
4 19 1 0
3 18 1 0
3 17 1 0
3 16 1 0
2 5 1 0
2 4 1 0
2 3 1 0
1 15 1 0
1 14 1 0
1 13 1 0
1 2 1 0
M END</inlineContents>
</jmolApplet>
</jmol>

==Synthesis Mechanism==
<br>
[[image:reaction1.gif|200]]<br>
The first reaction is done under basic conditions. The second step is a reduction process.

==IR spectrum==
[[image:IR1.gif|200]]
==Effects==

==Reference==

It:chlorphentermine

2006-10-23T15:23:56Z

Ls105:

==Chlorphentermine==
'''Chlorphentermine''' is an anorectic (appetite suppressant) implicated in lipid storage disorders and pulmonary hypertension.
===Structure===

{| class="toccolours" border="1" style="float: right; clear: right; margin: 0 0 1em 1em; border-collapse: collapse;"
! {{chembox header}}| '''Chlorphentermine'''
|-
| [[IUPAC nomenclature|Chemical name]]
| ''1-(4-chlorophenyl)-2-methyl-propan-2-amine hydrochloride''
|-
| [[CAS nummber]]
| 151-06-4
|-
| [[Chemical formula]]
| {{{formula|C<sub>10</sub>H<sub>15</sub>Cl<sub>2</sub>N
|-
| [[Molecular mass]]
| {{{mol_mass|220.14g mol<sup>-1</sup>
|-
| [[Simplified molecular input line entry specification|SMILES]]
| CC(N)(C)CC1=CC=C(Cl)C=C1.[H]Cl
|-
|}

[[image:chlorphentermine.png|left]]
<jmol>
<jmolApplet>
<size>200</size>
<color>white</color>
<script>zoom 100; cpk on;frame 1; move 10 -20 10 0 0 0 0 0 3; delay 1;</script>
<inlineContents>32446.mol
3433
Chime 10230614293D
26 26 0 0 1 V2000
4.2640 -0.1120 0.1560 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7800 0.0080 -0.2040 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5520 1.3200 -0.9560 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3920 -1.1160 -1.0560 N 0 0 0 0 0 0 0 0 0 0 0 0
1.9400 0.0000 1.0720 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4760 0.0000 0.7080 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.1880 -1.1960 0.5320 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.5280 -1.2000 0.2000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.2040 0.0000 0.0440 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8880 -0.0040 -0.3680 Cl 0 0 0 0 0 0 0 0 0 0 0 0
-1.5360 1.1920 0.2200 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.1960 1.1920 0.5560 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5520 0.7200 0.7920 H 0 0 0 0 0 0 0 0 0 0 0 0
4.4280 -1.0480 0.6920 H 0 0 0 0 0 0 0 0 0 0 0 0
4.8640 -0.1040 -0.7480 H 0 0 0 0 0 0 0 0 0 0 0 0
3.1480 1.3280 -1.8640 H 0 0 0 0 0 0 0 0 0 0 0 0
1.4960 1.4120 -1.2120 H 0 0 0 0 0 0 0 0 0 0 0 0
2.8400 2.1600 -0.3200 H 0 0 0 0 0 0 0 0 0 0 0 0
3.0360 -1.1320 -1.8320 H 0 0 0 0 0 0 0 0 0 0 0 0
2.5600 -1.9560 -0.5240 H 0 0 0 0 0 0 0 0 0 0 0 0
2.1720 -0.8920 1.6520 H 0 0 0 0 0 0 0 0 0 0 0 0
2.1680 0.8840 1.6640 H 0 0 0 0 0 0 0 0 0 0 0 0
0.3360 -2.1320 0.6560 H 0 0 0 0 0 0 0 0 0 0 0 0
-2.0520 -2.1360 0.0640 H 0 0 0 0 0 0 0 0 0 0 0 0
-2.0600 2.1280 0.0960 H 0 0 0 0 0 0 0 0 0 0 0 0
0.3240 2.1280 0.6960 H 0 0 0 0 0 0 0 0 0 0 0 0
12 26 1 0
11 25 1 0
11 12 1 0
9 11 1 0
9 10 1 0
8 24 1 0
8 9 1 0
7 23 1 0
7 8 1 0
6 7 1 0
6 12 1 0
5 22 1 0
5 21 1 0
5 6 1 0
4 20 1 0
4 19 1 0
3 18 1 0
3 17 1 0
3 16 1 0
2 5 1 0
2 4 1 0
2 3 1 0
1 15 1 0
1 14 1 0
1 13 1 0
1 2 1 0
M END</inlineContents>
</jmolApplet>
</jmol>

<br>
==Synthesis Mechanism==
[[image:reaction1.gif|200]]<br>
The first reaction is done under basic conditions. The second step is a reduction process.

==IR spectrum==
[[image:IR1.gif|200]]
==Effects==

==Reference==

It:chlorphentermine

2006-10-23T15:13:15Z

Ls105:

==Chlorphentermine==
'''Chlorphentermine''' is an anorectic (appetite suppressant) implicated in lipid storage disorders and pulmonary hypertension.
===Structure===

{| class="toccolours" border="1" style="float: right; clear: right; margin: 0 0 1em 1em; border-collapse: collapse;"
! {{chembox header}}| '''Chlorphentermine'''
|-
| [[IUPAC nomenclature|Chemical name]]
| ''1-(4-chlorophenyl)-2-methyl-propan-2-amine hydrochloride''
|-
| [[CAS nummber]]
| 151-06-4
|-
| [[Chemical formula]]
| {{{formula|C<sub>10</sub>H<sub>15</sub>Cl<sub>2</sub>N
|-
| [[Molecular mass]]
| {{{mol_mass|220.14g mol<sup>-1</sup>
|-
| [[Simplified molecular input line entry specification|SMILES]]
| CC(N)(C)CC1=CC=C(Cl)C=C1.[H]Cl
|-
|}

[[image:chlorphentermine.png|left]]
<jmol>
<jmolApplet>
<size>200</size>
<color>white</color>
<script>zoom 100; cpk on;frame 1; move 10 -20 10 0 0 0 0 0 3; delay 1;</script>
<inlineContents>32446.mol
3433
Chime 10230614293D
26 26 0 0 1 V2000
4.2640 -0.1120 0.1560 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7800 0.0080 -0.2040 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5520 1.3200 -0.9560 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3920 -1.1160 -1.0560 N 0 0 0 0 0 0 0 0 0 0 0 0
1.9400 0.0000 1.0720 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4760 0.0000 0.7080 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.1880 -1.1960 0.5320 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.5280 -1.2000 0.2000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.2040 0.0000 0.0440 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8880 -0.0040 -0.3680 Cl 0 0 0 0 0 0 0 0 0 0 0 0
-1.5360 1.1920 0.2200 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.1960 1.1920 0.5560 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5520 0.7200 0.7920 H 0 0 0 0 0 0 0 0 0 0 0 0
4.4280 -1.0480 0.6920 H 0 0 0 0 0 0 0 0 0 0 0 0
4.8640 -0.1040 -0.7480 H 0 0 0 0 0 0 0 0 0 0 0 0
3.1480 1.3280 -1.8640 H 0 0 0 0 0 0 0 0 0 0 0 0
1.4960 1.4120 -1.2120 H 0 0 0 0 0 0 0 0 0 0 0 0
2.8400 2.1600 -0.3200 H 0 0 0 0 0 0 0 0 0 0 0 0
3.0360 -1.1320 -1.8320 H 0 0 0 0 0 0 0 0 0 0 0 0
2.5600 -1.9560 -0.5240 H 0 0 0 0 0 0 0 0 0 0 0 0
2.1720 -0.8920 1.6520 H 0 0 0 0 0 0 0 0 0 0 0 0
2.1680 0.8840 1.6640 H 0 0 0 0 0 0 0 0 0 0 0 0
0.3360 -2.1320 0.6560 H 0 0 0 0 0 0 0 0 0 0 0 0
-2.0520 -2.1360 0.0640 H 0 0 0 0 0 0 0 0 0 0 0 0
-2.0600 2.1280 0.0960 H 0 0 0 0 0 0 0 0 0 0 0 0
0.3240 2.1280 0.6960 H 0 0 0 0 0 0 0 0 0 0 0 0
12 26 1 0
11 25 1 0
11 12 1 0
9 11 1 0
9 10 1 0
8 24 1 0
8 9 1 0
7 23 1 0
7 8 1 0
6 7 1 0
6 12 1 0
5 22 1 0
5 21 1 0
5 6 1 0
4 20 1 0
4 19 1 0
3 18 1 0
3 17 1 0
3 16 1 0
2 5 1 0
2 4 1 0
2 3 1 0
1 15 1 0
1 14 1 0
1 13 1 0
1 2 1 0
M END</inlineContents>
</jmolApplet>
</jmol>

<br>
==Synthesis Mechanism==
[[image:reaction1.gif|200]]<br>
The first reaction is done under basic conditions. The second step is a reduction process.

==IR spectrum==
[[image:IR1.gif|200]]

It:chlorphentermine

2006-10-23T15:11:07Z

Ls105: /* Synthesis Mechanism */

==Chlorphentermine==
===Structure===

{| class="toccolours" border="1" style="float: right; clear: right; margin: 0 0 1em 1em; border-collapse: collapse;"
! {{chembox header}}| '''Chlorphentermine'''
|-
| [[IUPAC nomenclature|Chemical name]]
| ''1-(4-chlorophenyl)-2-methyl-propan-2-amine hydrochloride''
|-
| [[CAS nummber]]
| 151-06-4
|-
| [[Chemical formula]]
| {{{formula|C<sub>10</sub>H<sub>15</sub>Cl<sub>2</sub>N
|-
| [[Molecular mass]]
| {{{mol_mass|220.14g mol<sup>-1</sup>
|-
| [[Simplified molecular input line entry specification|SMILES]]
| CC(N)(C)CC1=CC=C(Cl)C=C1.[H]Cl
|-
|}

[[image:chlorphentermine.png|left]]
<jmol>
<jmolApplet>
<size>200</size>
<color>white</color>
<script>zoom 100; cpk on;frame 1; move 10 -20 10 0 0 0 0 0 3; delay 1;</script>
<inlineContents>32446.mol
3433
Chime 10230614293D
26 26 0 0 1 V2000
4.2640 -0.1120 0.1560 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7800 0.0080 -0.2040 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5520 1.3200 -0.9560 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3920 -1.1160 -1.0560 N 0 0 0 0 0 0 0 0 0 0 0 0
1.9400 0.0000 1.0720 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4760 0.0000 0.7080 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.1880 -1.1960 0.5320 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.5280 -1.2000 0.2000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.2040 0.0000 0.0440 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8880 -0.0040 -0.3680 Cl 0 0 0 0 0 0 0 0 0 0 0 0
-1.5360 1.1920 0.2200 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.1960 1.1920 0.5560 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5520 0.7200 0.7920 H 0 0 0 0 0 0 0 0 0 0 0 0
4.4280 -1.0480 0.6920 H 0 0 0 0 0 0 0 0 0 0 0 0
4.8640 -0.1040 -0.7480 H 0 0 0 0 0 0 0 0 0 0 0 0
3.1480 1.3280 -1.8640 H 0 0 0 0 0 0 0 0 0 0 0 0
1.4960 1.4120 -1.2120 H 0 0 0 0 0 0 0 0 0 0 0 0
2.8400 2.1600 -0.3200 H 0 0 0 0 0 0 0 0 0 0 0 0
3.0360 -1.1320 -1.8320 H 0 0 0 0 0 0 0 0 0 0 0 0
2.5600 -1.9560 -0.5240 H 0 0 0 0 0 0 0 0 0 0 0 0
2.1720 -0.8920 1.6520 H 0 0 0 0 0 0 0 0 0 0 0 0
2.1680 0.8840 1.6640 H 0 0 0 0 0 0 0 0 0 0 0 0
0.3360 -2.1320 0.6560 H 0 0 0 0 0 0 0 0 0 0 0 0
-2.0520 -2.1360 0.0640 H 0 0 0 0 0 0 0 0 0 0 0 0
-2.0600 2.1280 0.0960 H 0 0 0 0 0 0 0 0 0 0 0 0
0.3240 2.1280 0.6960 H 0 0 0 0 0 0 0 0 0 0 0 0
12 26 1 0
11 25 1 0
11 12 1 0
9 11 1 0
9 10 1 0
8 24 1 0
8 9 1 0
7 23 1 0
7 8 1 0
6 7 1 0
6 12 1 0
5 22 1 0
5 21 1 0
5 6 1 0
4 20 1 0
4 19 1 0
3 18 1 0
3 17 1 0
3 16 1 0
2 5 1 0
2 4 1 0
2 3 1 0
1 15 1 0
1 14 1 0
1 13 1 0
1 2 1 0
M END</inlineContents>
</jmolApplet>
</jmol>

<br>
==Synthesis Mechanism==
[[image:reaction1.gif|200]]<br>
The first reaction is done under basic conditions. The second step is a reduction process.

==IR spectrum==
[[image:IR1.gif|200]]

File:IR1.gif

2006-10-23T15:10:29Z

Ls105:

It:chlorphentermine

2006-10-23T15:09:51Z

Ls105:

==Chlorphentermine==
===Structure===

{| class="toccolours" border="1" style="float: right; clear: right; margin: 0 0 1em 1em; border-collapse: collapse;"
! {{chembox header}}| '''Chlorphentermine'''
|-
| [[IUPAC nomenclature|Chemical name]]
| ''1-(4-chlorophenyl)-2-methyl-propan-2-amine hydrochloride''
|-
| [[CAS nummber]]
| 151-06-4
|-
| [[Chemical formula]]
| {{{formula|C<sub>10</sub>H<sub>15</sub>Cl<sub>2</sub>N
|-
| [[Molecular mass]]
| {{{mol_mass|220.14g mol<sup>-1</sup>
|-
| [[Simplified molecular input line entry specification|SMILES]]
| CC(N)(C)CC1=CC=C(Cl)C=C1.[H]Cl
|-
|}

[[image:chlorphentermine.png|left]]
<jmol>
<jmolApplet>
<size>200</size>
<color>white</color>
<script>zoom 100; cpk on;frame 1; move 10 -20 10 0 0 0 0 0 3; delay 1;</script>
<inlineContents>32446.mol
3433
Chime 10230614293D
26 26 0 0 1 V2000
4.2640 -0.1120 0.1560 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7800 0.0080 -0.2040 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5520 1.3200 -0.9560 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3920 -1.1160 -1.0560 N 0 0 0 0 0 0 0 0 0 0 0 0
1.9400 0.0000 1.0720 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4760 0.0000 0.7080 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.1880 -1.1960 0.5320 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.5280 -1.2000 0.2000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.2040 0.0000 0.0440 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8880 -0.0040 -0.3680 Cl 0 0 0 0 0 0 0 0 0 0 0 0
-1.5360 1.1920 0.2200 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.1960 1.1920 0.5560 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5520 0.7200 0.7920 H 0 0 0 0 0 0 0 0 0 0 0 0
4.4280 -1.0480 0.6920 H 0 0 0 0 0 0 0 0 0 0 0 0
4.8640 -0.1040 -0.7480 H 0 0 0 0 0 0 0 0 0 0 0 0
3.1480 1.3280 -1.8640 H 0 0 0 0 0 0 0 0 0 0 0 0
1.4960 1.4120 -1.2120 H 0 0 0 0 0 0 0 0 0 0 0 0
2.8400 2.1600 -0.3200 H 0 0 0 0 0 0 0 0 0 0 0 0
3.0360 -1.1320 -1.8320 H 0 0 0 0 0 0 0 0 0 0 0 0
2.5600 -1.9560 -0.5240 H 0 0 0 0 0 0 0 0 0 0 0 0
2.1720 -0.8920 1.6520 H 0 0 0 0 0 0 0 0 0 0 0 0
2.1680 0.8840 1.6640 H 0 0 0 0 0 0 0 0 0 0 0 0
0.3360 -2.1320 0.6560 H 0 0 0 0 0 0 0 0 0 0 0 0
-2.0520 -2.1360 0.0640 H 0 0 0 0 0 0 0 0 0 0 0 0
-2.0600 2.1280 0.0960 H 0 0 0 0 0 0 0 0 0 0 0 0
0.3240 2.1280 0.6960 H 0 0 0 0 0 0 0 0 0 0 0 0
12 26 1 0
11 25 1 0
11 12 1 0
9 11 1 0
9 10 1 0
8 24 1 0
8 9 1 0
7 23 1 0
7 8 1 0
6 7 1 0
6 12 1 0
5 22 1 0
5 21 1 0
5 6 1 0
4 20 1 0
4 19 1 0
3 18 1 0
3 17 1 0
3 16 1 0
2 5 1 0
2 4 1 0
2 3 1 0
1 15 1 0
1 14 1 0
1 13 1 0
1 2 1 0
M END</inlineContents>
</jmolApplet>
</jmol>

==Synthesis Mechanism==
[[image:reaction1.gif|200]]<br>
The first reaction is done under basic conditions. The second step is a reduction process.

==IR spectrum==
[[image:IR1.gif|200]]

It:chlorphentermine

2006-10-23T14:58:54Z

Ls105:

==Chlorphentermine==
===Structure===

{| class="toccolours" border="1" style="float: right; clear: right; margin: 0 0 1em 1em; border-collapse: collapse;"
! {{chembox header}}| '''Chlorphentermine'''
|-
| [[IUPAC nomenclature|Chemical name]]
| ''1-(4-chlorophenyl)-2-methyl-propan-2-amine hydrochloride''
|-
| [[CAS nummber]]
| 151-06-4
|-
| [[Chemical formula]]
| {{{formula|C<sub>10</sub>H<sub>15</sub>Cl<sub>2</sub>N
|-
| [[Molecular mass]]
| {{{mol_mass|220.14g mol<sup>-1</sup>
|-
| [[Simplified molecular input line entry specification|SMILES]]
| CC(N)(C)CC1=CC=C(Cl)C=C1.[H]Cl
|-
|}

[[image:chlorphentermine.png|left]]
<jmol>
<jmolApplet>
<size>200</size>
<color>white</color>
<script>zoom 100; cpk on;frame 1; move 10 -20 10 0 0 0 0 0 3; delay 1;</script>
<inlineContents>32446.mol
3433
Chime 10230614293D
26 26 0 0 1 V2000
4.2640 -0.1120 0.1560 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7800 0.0080 -0.2040 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5520 1.3200 -0.9560 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3920 -1.1160 -1.0560 N 0 0 0 0 0 0 0 0 0 0 0 0
1.9400 0.0000 1.0720 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4760 0.0000 0.7080 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.1880 -1.1960 0.5320 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.5280 -1.2000 0.2000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.2040 0.0000 0.0440 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8880 -0.0040 -0.3680 Cl 0 0 0 0 0 0 0 0 0 0 0 0
-1.5360 1.1920 0.2200 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.1960 1.1920 0.5560 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5520 0.7200 0.7920 H 0 0 0 0 0 0 0 0 0 0 0 0
4.4280 -1.0480 0.6920 H 0 0 0 0 0 0 0 0 0 0 0 0
4.8640 -0.1040 -0.7480 H 0 0 0 0 0 0 0 0 0 0 0 0
3.1480 1.3280 -1.8640 H 0 0 0 0 0 0 0 0 0 0 0 0
1.4960 1.4120 -1.2120 H 0 0 0 0 0 0 0 0 0 0 0 0
2.8400 2.1600 -0.3200 H 0 0 0 0 0 0 0 0 0 0 0 0
3.0360 -1.1320 -1.8320 H 0 0 0 0 0 0 0 0 0 0 0 0
2.5600 -1.9560 -0.5240 H 0 0 0 0 0 0 0 0 0 0 0 0
2.1720 -0.8920 1.6520 H 0 0 0 0 0 0 0 0 0 0 0 0
2.1680 0.8840 1.6640 H 0 0 0 0 0 0 0 0 0 0 0 0
0.3360 -2.1320 0.6560 H 0 0 0 0 0 0 0 0 0 0 0 0
-2.0520 -2.1360 0.0640 H 0 0 0 0 0 0 0 0 0 0 0 0
-2.0600 2.1280 0.0960 H 0 0 0 0 0 0 0 0 0 0 0 0
0.3240 2.1280 0.6960 H 0 0 0 0 0 0 0 0 0 0 0 0
12 26 1 0
11 25 1 0
11 12 1 0
9 11 1 0
9 10 1 0
8 24 1 0
8 9 1 0
7 23 1 0
7 8 1 0
6 7 1 0
6 12 1 0
5 22 1 0
5 21 1 0
5 6 1 0
4 20 1 0
4 19 1 0
3 18 1 0
3 17 1 0
3 16 1 0
2 5 1 0
2 4 1 0
2 3 1 0
1 15 1 0
1 14 1 0
1 13 1 0
1 2 1 0
M END</inlineContents>
</jmolApplet>
</jmol>

==Synthesis Mechanism==
[[image:reaction1.gif|200]]
The first reaction is done under basic conditions. The second step is a reduction process.

File:Reaction1.gif

2006-10-23T14:50:20Z

Ls105:

It:chlorphentermine

2006-10-23T14:50:02Z

Ls105:

==Chlorphentermine==
===Structure===

{| class="toccolours" border="1" style="float: right; clear: right; margin: 0 0 1em 1em; border-collapse: collapse;"
! {{chembox header}}| '''Chlorphentermine'''
|-
| [[IUPAC nomenclature|Chemical name]]
| ''1-(4-chlorophenyl)-2-methyl-propan-2-amine hydrochloride''
|-
| [[CAS nummber]]
| 151-06-4
|-
| [[Chemical formula]]
| {{{formula|C<sub>10</sub>H<sub>15</sub>Cl<sub>2</sub>N
|-
| [[Molecular mass]]
| {{{mol_mass|220.14g mol<sup>-1</sup>
|-
| [[Simplified molecular input line entry specification|SMILES]]
| CC(N)(C)CC1=CC=C(Cl)C=C1.[H]Cl
|-
|}

[[image:chlorphentermine.png|left]]
<jmol>
<jmolApplet>
<size>200</size>
<color>white</color>
<script>zoom 100; cpk on;frame 1; move 10 -20 10 0 0 0 0 0 3; delay 1;</script>
<inlineContents>32446.mol
3433
Chime 10230614293D
26 26 0 0 1 V2000
4.2640 -0.1120 0.1560 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7800 0.0080 -0.2040 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5520 1.3200 -0.9560 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3920 -1.1160 -1.0560 N 0 0 0 0 0 0 0 0 0 0 0 0
1.9400 0.0000 1.0720 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4760 0.0000 0.7080 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.1880 -1.1960 0.5320 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.5280 -1.2000 0.2000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.2040 0.0000 0.0440 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8880 -0.0040 -0.3680 Cl 0 0 0 0 0 0 0 0 0 0 0 0
-1.5360 1.1920 0.2200 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.1960 1.1920 0.5560 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5520 0.7200 0.7920 H 0 0 0 0 0 0 0 0 0 0 0 0
4.4280 -1.0480 0.6920 H 0 0 0 0 0 0 0 0 0 0 0 0
4.8640 -0.1040 -0.7480 H 0 0 0 0 0 0 0 0 0 0 0 0
3.1480 1.3280 -1.8640 H 0 0 0 0 0 0 0 0 0 0 0 0
1.4960 1.4120 -1.2120 H 0 0 0 0 0 0 0 0 0 0 0 0
2.8400 2.1600 -0.3200 H 0 0 0 0 0 0 0 0 0 0 0 0
3.0360 -1.1320 -1.8320 H 0 0 0 0 0 0 0 0 0 0 0 0
2.5600 -1.9560 -0.5240 H 0 0 0 0 0 0 0 0 0 0 0 0
2.1720 -0.8920 1.6520 H 0 0 0 0 0 0 0 0 0 0 0 0
2.1680 0.8840 1.6640 H 0 0 0 0 0 0 0 0 0 0 0 0
0.3360 -2.1320 0.6560 H 0 0 0 0 0 0 0 0 0 0 0 0
-2.0520 -2.1360 0.0640 H 0 0 0 0 0 0 0 0 0 0 0 0
-2.0600 2.1280 0.0960 H 0 0 0 0 0 0 0 0 0 0 0 0
0.3240 2.1280 0.6960 H 0 0 0 0 0 0 0 0 0 0 0 0
12 26 1 0
11 25 1 0
11 12 1 0
9 11 1 0
9 10 1 0
8 24 1 0
8 9 1 0
7 23 1 0
7 8 1 0
6 7 1 0
6 12 1 0
5 22 1 0
5 21 1 0
5 6 1 0
4 20 1 0
4 19 1 0
3 18 1 0
3 17 1 0
3 16 1 0
2 5 1 0
2 4 1 0
2 3 1 0
1 15 1 0
1 14 1 0
1 13 1 0
1 2 1 0
M END</inlineContents>
</jmolApplet>
</jmol>

==Synthesis Mechanism==
[[image:reaction1.gif|200]]

File:Reactions1.gif

2006-10-23T14:37:59Z

Ls105:

It:chlorphentermine

2006-10-23T14:30:00Z

Ls105:

File:Chlorphentermine.png

2006-10-23T14:29:20Z

Ls105:

It:chlorphentermine

2006-10-23T14:28:04Z

Ls105: /* Structure */

==Chlorphentermine==
===Structure===

{| class="toccolours" border="1" style="float: right; clear: right; margin: 0 0 1em 1em; border-collapse: collapse;"
! {{chembox header}}| '''Chlorphentermine'''
|-
| [[IUPAC nomenclature|Chemical name]]
| ''1-(4-chlorophenyl)-2-methyl-propan-2-amine hydrochloride''
|-
| [[CAS nummber]]
| 151-06-4
|-
| [[Chemical formula]]
| {{{formula|C<sub>10</sub>H<sub>15</sub>Cl<sub>2</sub>N
|-
| [[Molecular mass]]
| {{{mol_mass|220.14g mol<sup>-1</sup>
|-
| [[Simplified molecular input line entry specification|SMILES]]
| CC(N)(C)CC1=CC=C(Cl)C=C1.[H]Cl
|-
|}

[[image:chlorphentermine.gif|left]]
<jmol>
<jmolApplet>
<size>200</size>
<color>white</color>
<script>zoom 100; cpk on;frame 1; move 10 -20 10 0 0 0 0 0 3; delay 1;</script>
<inlineContents>32446.mol
3433
Chime 10230614293D
26 26 0 0 1 V2000
4.2640 -0.1120 0.1560 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7800 0.0080 -0.2040 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5520 1.3200 -0.9560 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3920 -1.1160 -1.0560 N 0 0 0 0 0 0 0 0 0 0 0 0
1.9400 0.0000 1.0720 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4760 0.0000 0.7080 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.1880 -1.1960 0.5320 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.5280 -1.2000 0.2000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.2040 0.0000 0.0440 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8880 -0.0040 -0.3680 Cl 0 0 0 0 0 0 0 0 0 0 0 0
-1.5360 1.1920 0.2200 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.1960 1.1920 0.5560 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5520 0.7200 0.7920 H 0 0 0 0 0 0 0 0 0 0 0 0
4.4280 -1.0480 0.6920 H 0 0 0 0 0 0 0 0 0 0 0 0
4.8640 -0.1040 -0.7480 H 0 0 0 0 0 0 0 0 0 0 0 0
3.1480 1.3280 -1.8640 H 0 0 0 0 0 0 0 0 0 0 0 0
1.4960 1.4120 -1.2120 H 0 0 0 0 0 0 0 0 0 0 0 0
2.8400 2.1600 -0.3200 H 0 0 0 0 0 0 0 0 0 0 0 0
3.0360 -1.1320 -1.8320 H 0 0 0 0 0 0 0 0 0 0 0 0
2.5600 -1.9560 -0.5240 H 0 0 0 0 0 0 0 0 0 0 0 0
2.1720 -0.8920 1.6520 H 0 0 0 0 0 0 0 0 0 0 0 0
2.1680 0.8840 1.6640 H 0 0 0 0 0 0 0 0 0 0 0 0
0.3360 -2.1320 0.6560 H 0 0 0 0 0 0 0 0 0 0 0 0
-2.0520 -2.1360 0.0640 H 0 0 0 0 0 0 0 0 0 0 0 0
-2.0600 2.1280 0.0960 H 0 0 0 0 0 0 0 0 0 0 0 0
0.3240 2.1280 0.6960 H 0 0 0 0 0 0 0 0 0 0 0 0
12 26 1 0
11 25 1 0
11 12 1 0
9 11 1 0
9 10 1 0
8 24 1 0
8 9 1 0
7 23 1 0
7 8 1 0
6 7 1 0
6 12 1 0
5 22 1 0
5 21 1 0
5 6 1 0
4 20 1 0
4 19 1 0
3 18 1 0
3 17 1 0
3 16 1 0
2 5 1 0
2 4 1 0
2 3 1 0
1 15 1 0
1 14 1 0
1 13 1 0
1 2 1 0
M END</inlineContents>
</jmolApplet>
</jmol>

It:chlorphentermine

2006-10-23T14:27:31Z

Ls105:

==Chlorphentermine==
===Structure===

{| class="toccolours" border="1" style="float: right; clear: right; margin: 0 0 1em 1em; border-collapse: collapse;"
! {{chembox header}}| '''Jacobsen Catalyst'''
|-
| align="center" colspan="2" bgcolor="#ffffff" | [[Image:Jacobsen_catalyst.gif]]
|-
| [[IUPAC nomenclature|Chemical name]]
| ''1-(4-chlorophenyl)-2-methyl-propan-2-amine hydrochloride''
|-
| [[CAS nummber]]
| 151-06-4
|-
| [[Chemical formula]]
| {{{formula|C<sub>10</sub>H<sub>15</sub>Cl<sub>2</sub>N
|-
| [[Molecular mass]]
| {{{mol_mass|220.14g mol<sup>-1</sup>
|-
| [[Simplified molecular input line entry specification|SMILES]]
| CC(N)(C)CC1=CC=C(Cl)C=C1.[H]Cl
|-
|}

[[image:chlorphentermine.gif|left]]
<jmol>
<jmolApplet>
<size>200</size>
<color>white</color>
<script>zoom 100; cpk on;frame 1; move 10 -20 10 0 0 0 0 0 3; delay 1;</script>
<inlineContents>32446.mol
3433
Chime 10230614293D
26 26 0 0 1 V2000
4.2640 -0.1120 0.1560 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7800 0.0080 -0.2040 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5520 1.3200 -0.9560 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3920 -1.1160 -1.0560 N 0 0 0 0 0 0 0 0 0 0 0 0
1.9400 0.0000 1.0720 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4760 0.0000 0.7080 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.1880 -1.1960 0.5320 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.5280 -1.2000 0.2000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.2040 0.0000 0.0440 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8880 -0.0040 -0.3680 Cl 0 0 0 0 0 0 0 0 0 0 0 0
-1.5360 1.1920 0.2200 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.1960 1.1920 0.5560 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5520 0.7200 0.7920 H 0 0 0 0 0 0 0 0 0 0 0 0
4.4280 -1.0480 0.6920 H 0 0 0 0 0 0 0 0 0 0 0 0
4.8640 -0.1040 -0.7480 H 0 0 0 0 0 0 0 0 0 0 0 0
3.1480 1.3280 -1.8640 H 0 0 0 0 0 0 0 0 0 0 0 0
1.4960 1.4120 -1.2120 H 0 0 0 0 0 0 0 0 0 0 0 0
2.8400 2.1600 -0.3200 H 0 0 0 0 0 0 0 0 0 0 0 0
3.0360 -1.1320 -1.8320 H 0 0 0 0 0 0 0 0 0 0 0 0
2.5600 -1.9560 -0.5240 H 0 0 0 0 0 0 0 0 0 0 0 0
2.1720 -0.8920 1.6520 H 0 0 0 0 0 0 0 0 0 0 0 0
2.1680 0.8840 1.6640 H 0 0 0 0 0 0 0 0 0 0 0 0
0.3360 -2.1320 0.6560 H 0 0 0 0 0 0 0 0 0 0 0 0
-2.0520 -2.1360 0.0640 H 0 0 0 0 0 0 0 0 0 0 0 0
-2.0600 2.1280 0.0960 H 0 0 0 0 0 0 0 0 0 0 0 0
0.3240 2.1280 0.6960 H 0 0 0 0 0 0 0 0 0 0 0 0
12 26 1 0
11 25 1 0
11 12 1 0
9 11 1 0
9 10 1 0
8 24 1 0
8 9 1 0
7 23 1 0
7 8 1 0
6 7 1 0
6 12 1 0
5 22 1 0
5 21 1 0
5 6 1 0
4 20 1 0
4 19 1 0
3 18 1 0
3 17 1 0
3 16 1 0
2 5 1 0
2 4 1 0
2 3 1 0
1 15 1 0
1 14 1 0
1 13 1 0
1 2 1 0
M END</inlineContents>
</jmolApplet>
</jmol>

It:chlorphentermine

2006-10-23T14:22:24Z

Ls105:

==Chlorphentermine==
===Structure===
[[image:chlorphentermine.gif|left]]
<jmol>
<jmolApplet>
<size>200</size>
<color>white</color>
<script>zoom 100; cpk on;frame 1; move 10 -20 10 0 0 0 0 0 3; delay 1;</script>
<inlineContents>32446.mol
3433
Chime 10230614293D
26 26 0 0 1 V2000
4.2640 -0.1120 0.1560 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7800 0.0080 -0.2040 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5520 1.3200 -0.9560 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3920 -1.1160 -1.0560 N 0 0 0 0 0 0 0 0 0 0 0 0
1.9400 0.0000 1.0720 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4760 0.0000 0.7080 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.1880 -1.1960 0.5320 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.5280 -1.2000 0.2000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.2040 0.0000 0.0440 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8880 -0.0040 -0.3680 Cl 0 0 0 0 0 0 0 0 0 0 0 0
-1.5360 1.1920 0.2200 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.1960 1.1920 0.5560 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5520 0.7200 0.7920 H 0 0 0 0 0 0 0 0 0 0 0 0
4.4280 -1.0480 0.6920 H 0 0 0 0 0 0 0 0 0 0 0 0
4.8640 -0.1040 -0.7480 H 0 0 0 0 0 0 0 0 0 0 0 0
3.1480 1.3280 -1.8640 H 0 0 0 0 0 0 0 0 0 0 0 0
1.4960 1.4120 -1.2120 H 0 0 0 0 0 0 0 0 0 0 0 0
2.8400 2.1600 -0.3200 H 0 0 0 0 0 0 0 0 0 0 0 0
3.0360 -1.1320 -1.8320 H 0 0 0 0 0 0 0 0 0 0 0 0
2.5600 -1.9560 -0.5240 H 0 0 0 0 0 0 0 0 0 0 0 0
2.1720 -0.8920 1.6520 H 0 0 0 0 0 0 0 0 0 0 0 0
2.1680 0.8840 1.6640 H 0 0 0 0 0 0 0 0 0 0 0 0
0.3360 -2.1320 0.6560 H 0 0 0 0 0 0 0 0 0 0 0 0
-2.0520 -2.1360 0.0640 H 0 0 0 0 0 0 0 0 0 0 0 0
-2.0600 2.1280 0.0960 H 0 0 0 0 0 0 0 0 0 0 0 0
0.3240 2.1280 0.6960 H 0 0 0 0 0 0 0 0 0 0 0 0
12 26 1 0
11 25 1 0
11 12 1 0
9 11 1 0
9 10 1 0
8 24 1 0
8 9 1 0
7 23 1 0
7 8 1 0
6 7 1 0
6 12 1 0
5 22 1 0
5 21 1 0
5 6 1 0
4 20 1 0
4 19 1 0
3 18 1 0
3 17 1 0
3 16 1 0
2 5 1 0
2 4 1 0
2 3 1 0
1 15 1 0
1 14 1 0
1 13 1 0
1 2 1 0
M END</inlineContents>
</jmolApplet>
</jmol>

It:chlorphentermine

2006-10-23T13:50:25Z

Ls105:

==Chlorphentermine==

[[image:chlorphentermine.gif|left]]
<jmol>
<jmolApplet>
<size>200</size>
<color>red</color>
<script>zoom 80; cpk on;frame 1; move 10 -20 10 0 0 0 0 0 3; delay 1;</script>
<inlineContents>32446.mol
Chime 10230614293D
26 26 0 0 1 V2000
4.2640 -0.1120 0.1560 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7800 0.0080 -0.2040 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5520 1.3200 -0.9560 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3920 -1.1160 -1.0560 N 0 0 0 0 0 0 0 0 0 0 0 0
1.9400 0.0000 1.0720 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4760 0.0000 0.7080 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.1880 -1.1960 0.5320 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.5280 -1.2000 0.2000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.2040 0.0000 0.0440 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8880 -0.0040 -0.3680 Cl 0 0 0 0 0 0 0 0 0 0 0 0
-1.5360 1.1920 0.2200 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.1960 1.1920 0.5560 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5520 0.7200 0.7920 H 0 0 0 0 0 0 0 0 0 0 0 0
4.4280 -1.0480 0.6920 H 0 0 0 0 0 0 0 0 0 0 0 0
4.8640 -0.1040 -0.7480 H 0 0 0 0 0 0 0 0 0 0 0 0
3.1480 1.3280 -1.8640 H 0 0 0 0 0 0 0 0 0 0 0 0
1.4960 1.4120 -1.2120 H 0 0 0 0 0 0 0 0 0 0 0 0
2.8400 2.1600 -0.3200 H 0 0 0 0 0 0 0 0 0 0 0 0
3.0360 -1.1320 -1.8320 H 0 0 0 0 0 0 0 0 0 0 0 0
2.5600 -1.9560 -0.5240 H 0 0 0 0 0 0 0 0 0 0 0 0
2.1720 -0.8920 1.6520 H 0 0 0 0 0 0 0 0 0 0 0 0
2.1680 0.8840 1.6640 H 0 0 0 0 0 0 0 0 0 0 0 0
0.3360 -2.1320 0.6560 H 0 0 0 0 0 0 0 0 0 0 0 0
-2.0520 -2.1360 0.0640 H 0 0 0 0 0 0 0 0 0 0 0 0
-2.0600 2.1280 0.0960 H 0 0 0 0 0 0 0 0 0 0 0 0
0.3240 2.1280 0.6960 H 0 0 0 0 0 0 0 0 0 0 0 0
12 26 1 0
11 25 1 0
11 12 1 0
9 11 1 0
9 10 1 0
8 24 1 0
8 9 1 0
7 23 1 0
7 8 1 0
6 7 1 0
6 12 1 0
5 22 1 0
5 21 1 0
5 6 1 0
4 20 1 0
4 19 1 0
3 18 1 0
3 17 1 0
3 16 1 0
2 5 1 0
2 4 1 0
2 3 1 0
1 15 1 0
1 14 1 0
1 13 1 0
1 2 1 0
M END</inlineContents>
</jmolApplet>
</jmol>

It:chlorphentermine

2006-10-23T13:43:37Z

Ls105:

==Chlorphentermine==

[[image:chlorphentermine.gif|left]]

It:chlorphentermine

2006-10-23T13:40:07Z

Ls105:

[[image:chlorphentermine.gif|left]]

File:Chlorphentermine.gif

2006-10-23T13:34:39Z

Ls105:

It:Roaccutane

2006-10-21T15:39:37Z

Ls105:

<jmol>
<jmolApplet>
<size>500</size>
<color>white</color>
<script>zoom 100; cpk off;frame 1; move 40 -20 20 0 0 0 0 0 3; delay 1;</script>
<inlineContents>test.pdb
title1
title2
ATOM 1 C1 MOL 1 14.263 13.508 0.005 1.00 0.00
ATOM 2 C2 MOL 1 15.445 12.906 0.072 1.00 0.00
ATOM 3 C3 MOL 1 12.940 12.770 -0.027 1.00 0.00
ATOM 4 C4 MOL 1 16.692 13.626 0.034 1.00 0.00
ATOM 5 C5 MOL 1 12.825 11.196 -0.135 1.00 0.00
ATOM 6 C6 MOL 1 11.833 13.525 0.052 1.00 0.00
ATOM 7 C7 MOL 1 17.817 12.921 0.063 1.00 0.00
ATOM 8 C8 MOL 1 16.708 15.125 -0.058 1.00 0.00
ATOM 9 C9 MOL 1 13.847 10.514 -1.092 1.00 0.00
ATOM 10 C10 MOL 1 13.053 10.611 1.285 1.00 0.00
ATOM 11 C11 MOL 1 11.426 10.791 -0.613 1.00 0.00
ATOM 12 C12 MOL 1 11.973 15.022 0.150 1.00 0.00
ATOM 13 C13 MOL 1 10.425 12.944 0.039 1.00 0.00
ATOM 14 C14 MOL 1 19.122 13.553 0.008 1.00 0.00
ATOM 15 C15 MOL 1 10.413 11.431 0.300 1.00 0.00
ATOM 16 C16 MOL 1 20.200 12.776 0.050 1.00 0.00
ATOM 17 C17 MOL 1 21.537 13.348 -0.007 1.00 0.00
ATOM 18 C18 MOL 1 22.581 12.508 0.048 1.00 0.00
ATOM 19 C19 MOL 1 21.682 14.844 -0.126 1.00 0.00
ATOM 20 C20 MOL 1 24.024 12.882 0.002 1.00 0.00
ATOM 21 O21 MOL 1 24.869 11.984 0.071 1.00 0.00
ATOM 22 O22 MOL 1 24.460 14.200 -0.117 1.00 0.00
TER</inlineContents>
</jmolApplet>
</jmol>
'''Roaccutane 3-D'''
[[Image:Roaccutane.gif|thumb|right|200|Roaccutane]]

'''Roaccutane''' otherwise known as ''isoretinoin'', ''Tasmar'' or ''Teriosal''.
{| border="1"
|+
{| border="1"
! Formula !! Molecular weight !! Melting Point
|-
! C<sub>20</sub>H<sub>28</sub>O<sub>2</sub>
| 300.44 || 189-190C
|-
===Interesting Fact===
'''Roaccutane''' is a form of Vitamin A prescribed by dermatologists for severe '''acne''', and it is only given to patients who have not responded to previous milder treatments. Roaccutane makes the sebaceous gland less productive, reduces the size of the sebaceous glands and the inflammation of the skin in acne.

It:Roaccutane

2006-10-21T15:37:44Z

Ls105:

<jmol>
<jmolApplet>
<size>500</size>
<color>white</color>
<script>zoom 100; cpk off;frame 1; move 40 -20 20 0 0 0 0 0 3; delay 1;</script>
<inlineContents>test.pdb
title1
title2
ATOM 1 C1 MOL 1 14.263 13.508 0.005 1.00 0.00
ATOM 2 C2 MOL 1 15.445 12.906 0.072 1.00 0.00
ATOM 3 C3 MOL 1 12.940 12.770 -0.027 1.00 0.00
ATOM 4 C4 MOL 1 16.692 13.626 0.034 1.00 0.00
ATOM 5 C5 MOL 1 12.825 11.196 -0.135 1.00 0.00
ATOM 6 C6 MOL 1 11.833 13.525 0.052 1.00 0.00
ATOM 7 C7 MOL 1 17.817 12.921 0.063 1.00 0.00
ATOM 8 C8 MOL 1 16.708 15.125 -0.058 1.00 0.00
ATOM 9 C9 MOL 1 13.847 10.514 -1.092 1.00 0.00
ATOM 10 C10 MOL 1 13.053 10.611 1.285 1.00 0.00
ATOM 11 C11 MOL 1 11.426 10.791 -0.613 1.00 0.00
ATOM 12 C12 MOL 1 11.973 15.022 0.150 1.00 0.00
ATOM 13 C13 MOL 1 10.425 12.944 0.039 1.00 0.00
ATOM 14 C14 MOL 1 19.122 13.553 0.008 1.00 0.00
ATOM 15 C15 MOL 1 10.413 11.431 0.300 1.00 0.00
ATOM 16 C16 MOL 1 20.200 12.776 0.050 1.00 0.00
ATOM 17 C17 MOL 1 21.537 13.348 -0.007 1.00 0.00
ATOM 18 C18 MOL 1 22.581 12.508 0.048 1.00 0.00
ATOM 19 C19 MOL 1 21.682 14.844 -0.126 1.00 0.00
ATOM 20 C20 MOL 1 24.024 12.882 0.002 1.00 0.00
ATOM 21 O21 MOL 1 24.869 11.984 0.071 1.00 0.00
ATOM 22 O22 MOL 1 24.460 14.200 -0.117 1.00 0.00
TER</inlineContents>
</jmolApplet>
</jmol>
'''Roaccutane 3-D'''
[[Image:Roaccutane.gif|thumb|right|200|Roaccutane]]

'''Roaccutane''' otherwise known as ''isoretinoin'', ''Tasmar'' or ''Teriosal''.

{| border="1"
|+
{| border="1"
! Formula !! Molecular weight !! Melting Point
|-
! C<sub>20</sub>H<sub>28</sub>O<sub>2</sub>
| 300.44 || 189-190C
|-
===Interesting Fact===
'''Roaccutane''' is a form of Vitamin A prescribed by dermatologists for severe '''acne''', and it is only given to patients who have not responded to previous milder treatments. Roaccutane makes the sebaceous gland less productive, reduces the size of the sebaceous glands and the inflammation of the skin in acne.

It:Roaccutane

2006-10-21T15:37:12Z

Ls105:

<jmol>
<jmolApplet>
<size>500</size>
<color>white</color>
<script>zoom 100; cpk off;frame 1; move 40 -20 20 0 0 0 0 0 3; delay 1;</script>
<inlineContents>test.pdb
title1
title2
ATOM 1 C1 MOL 1 14.263 13.508 0.005 1.00 0.00
ATOM 2 C2 MOL 1 15.445 12.906 0.072 1.00 0.00
ATOM 3 C3 MOL 1 12.940 12.770 -0.027 1.00 0.00
ATOM 4 C4 MOL 1 16.692 13.626 0.034 1.00 0.00
ATOM 5 C5 MOL 1 12.825 11.196 -0.135 1.00 0.00
ATOM 6 C6 MOL 1 11.833 13.525 0.052 1.00 0.00
ATOM 7 C7 MOL 1 17.817 12.921 0.063 1.00 0.00
ATOM 8 C8 MOL 1 16.708 15.125 -0.058 1.00 0.00
ATOM 9 C9 MOL 1 13.847 10.514 -1.092 1.00 0.00
ATOM 10 C10 MOL 1 13.053 10.611 1.285 1.00 0.00
ATOM 11 C11 MOL 1 11.426 10.791 -0.613 1.00 0.00
ATOM 12 C12 MOL 1 11.973 15.022 0.150 1.00 0.00
ATOM 13 C13 MOL 1 10.425 12.944 0.039 1.00 0.00
ATOM 14 C14 MOL 1 19.122 13.553 0.008 1.00 0.00
ATOM 15 C15 MOL 1 10.413 11.431 0.300 1.00 0.00
ATOM 16 C16 MOL 1 20.200 12.776 0.050 1.00 0.00
ATOM 17 C17 MOL 1 21.537 13.348 -0.007 1.00 0.00
ATOM 18 C18 MOL 1 22.581 12.508 0.048 1.00 0.00
ATOM 19 C19 MOL 1 21.682 14.844 -0.126 1.00 0.00
ATOM 20 C20 MOL 1 24.024 12.882 0.002 1.00 0.00
ATOM 21 O21 MOL 1 24.869 11.984 0.071 1.00 0.00
ATOM 22 O22 MOL 1 24.460 14.200 -0.117 1.00 0.00
TER</inlineContents>
</jmolApplet>
</jmol>
'''Roaccutane 3-D'''
[[Image:Roaccutane.gif|thumb|right|200|Roaccutane]]

'''Roaccutane''' otherwise known as ''isoretinoin'', ''Tasmar'' or ''Teriosal''.

{| border="1"
|+ Physical Properties of Roaccutane
{| border="1"
! Formula !! Molecular weight !! Melting Point
|-
! C<sub>20</sub>H<sub>28</sub>O<sub>2</sub>
| 300.44 || 189-190C
|-
Interesting Fact
'''Roaccutane''' is a form of Vitamin A prescribed by dermatologists for severe '''acne''', and it is only given to patients who have not responded to previous milder treatments. Roaccutane makes the sebaceous gland less productive, reduces the size of the sebaceous glands and the inflammation of the skin in acne.

File:Roaccutane.gif

2006-10-21T15:29:41Z

Ls105:

It:Roaccutane

2006-10-21T15:29:01Z

Ls105:

<jmol>
<jmolApplet>
<size>500</size>
<color>white</color>
<script>zoom 100; cpk off;frame 1; move 40 -20 20 0 0 0 0 0 3; delay 1;</script>
<inlineContents>test.pdb
title1
title2
ATOM 1 C1 MOL 1 14.263 13.508 0.005 1.00 0.00
ATOM 2 C2 MOL 1 15.445 12.906 0.072 1.00 0.00
ATOM 3 C3 MOL 1 12.940 12.770 -0.027 1.00 0.00
ATOM 4 C4 MOL 1 16.692 13.626 0.034 1.00 0.00
ATOM 5 C5 MOL 1 12.825 11.196 -0.135 1.00 0.00
ATOM 6 C6 MOL 1 11.833 13.525 0.052 1.00 0.00
ATOM 7 C7 MOL 1 17.817 12.921 0.063 1.00 0.00
ATOM 8 C8 MOL 1 16.708 15.125 -0.058 1.00 0.00
ATOM 9 C9 MOL 1 13.847 10.514 -1.092 1.00 0.00
ATOM 10 C10 MOL 1 13.053 10.611 1.285 1.00 0.00
ATOM 11 C11 MOL 1 11.426 10.791 -0.613 1.00 0.00
ATOM 12 C12 MOL 1 11.973 15.022 0.150 1.00 0.00
ATOM 13 C13 MOL 1 10.425 12.944 0.039 1.00 0.00
ATOM 14 C14 MOL 1 19.122 13.553 0.008 1.00 0.00
ATOM 15 C15 MOL 1 10.413 11.431 0.300 1.00 0.00
ATOM 16 C16 MOL 1 20.200 12.776 0.050 1.00 0.00
ATOM 17 C17 MOL 1 21.537 13.348 -0.007 1.00 0.00
ATOM 18 C18 MOL 1 22.581 12.508 0.048 1.00 0.00
ATOM 19 C19 MOL 1 21.682 14.844 -0.126 1.00 0.00
ATOM 20 C20 MOL 1 24.024 12.882 0.002 1.00 0.00
ATOM 21 O21 MOL 1 24.869 11.984 0.071 1.00 0.00
ATOM 22 O22 MOL 1 24.460 14.200 -0.117 1.00 0.00
TER</inlineContents>
</jmolApplet>
</jmol>
'''Roaccutane 3-D'''
[[Image:Roaccutane.gif|thumb|right|200|Roaccutane]]
'''Roaccutane''' otherwise known as ''isoretinoin'', ''Tasmar'' or ''Teriosal''.
{| border="1"
|+ Physical Properties of Roaccutane
{| border="1"
! Formula !! Molecular weight !! Melting Point
|-
! C<sub>20</sub>H<sub>28</sub>O<sub>2</sub>
| 300.44 || 189-190C
|-